Homework Answers
19)
I and II
In I , P is oxidised from +3 to +5
In II, Cu is oxidised from 0 to + 2 and Ag is reduced from + 1 to 0
20)
The balanced equation is
Cr2O72-(aq) + 6I-(aq) + 14H+(aq) ------> 2Cr3+ (aq) + I2(s) + 7H2O(l)
Therefore,
Coefficient of i- is 6
Add Answer to:
rect Question 19 0/5 pt Which of the following are oxidation-reduction reactions? 1. PC13 + Cl2...
Question 3 2.5 pts Which of the following are oxidation-reduction reactions? I. PCI; + Cl2 →...
Question 3 2.5 pts Which of the following are oxidation-reduction reactions? I. PCI; + Cl2 → PCI II. Cu + 2AgNO3 → Cu(NO3)2 + 2Ag CO2 + 2LiOH Li CO3 + H2O IV. FeCl2 + 2NaOH - Fe(OH)2 + 2NaCl III. I, II, III, and IV I and II o III I, II, and III IV
All of the following reactions can be described as displacement reactions except Select one: a. 2Na(s)...
All of the following reactions can be described as displacement reactions except Select one: a. 2Na(s) + 2H2O(1) ► 2NaOH(aq) + H2(g). ob. CoH(1) + Cl2(g) → CH3C1(1) + HCl(g). oc. CuSO4(aq) + Fe(s) → Cu(s) + FeSO4(aq). O d. Zn(s) + FeCl2(aq) → ZnCl2(aq) + Fe(s). e. Cu(s) + 2AgNO3(aq) + Cu(NO3)2(aq) + 2Ag(s).
(10 pts) Balance the following redox reactions by first separating the oxidation and reduction half-reactions. a....
(10 pts) Balance the following redox reactions by first separating the oxidation and reduction half-reactions. a. Cut (aq) + Fe (s) Fe3+ (aq) + Cu(s) b. Cu(s) + HNO3 (aq) Cu2+ (aq) + NO (g) (basic solution) c. NH(aq) + O2(g) → N03 (aq) + H2O(l) (acidic solution) d. Cd(s) + NiO(OH)(s) + Ca(OH)2(s) + Ni(OH)2(s) (Nicad battery) e. The oxidation of iodide ion (1) by permanganate ion (MnO4) in basic solution to yield molecular iodine (12) and manganese(IV) oxide...
1) Assign Oxidation States every element in each of the following species: i) NaMnO4 iv) SF...
1) Assign Oxidation States every element in each of the following species: i) NaMnO4 iv) SF ii) Cu(CIO4)2 v) LiH iii) Cl2 vi) H2O2 2) 3) 2HBr(aq) + Cds CdBr2(aq) + H2(g) Element Oxidized: Element Reduced: Balance the following redox reaction in acidic solution: Cr2O72- + C2H5OH → Cr + CO2
1. (a) Balance the following half-reactions by the ion-electron half-reaction method: (i) (acid solution) NO3- (aq)...
1. (a) Balance the following half-reactions by the ion-electron half-reaction method: (i) (acid solution) NO3- (aq) + N2O (g) (ii) (acid solution) Fe042- (aq) + Fe3+ (aq) (iii) (base solution) Fe203 () → Fe(OH)2 (S) (iv) (base solution) Cu20 (s) + Cu(OH)2 (S) (b) Which of the above equations are oxidation half-reactions? (c) Give the formulas of the reactants that become oxidized in the course of the reaction.
Test IV (Electrochemistry) 2018 Fall What is the oxidation number for the Which of the following...
Test IV (Electrochemistry) 2018 Fall What is the oxidation number for the Which of the following is true concerning a galvanic cell? (A) Oxidation occurs at the anode and is 1. 8. underlined manganese in Mn04 (A)-8 (8)-2 (C)-1 (D)4 (E) 7 where anions move towards where anions move towards where cations move towards where anions move towards where anions move towards 2. When balancing the below half-reaction in acidic solutionelectrons are added to the (B) Oxidation occurs at the...
1) Which of the following oxidation-reduction reactions will be spontaneous in the direction written? Select all...
1) Which of the following oxidation-reduction reactions will be spontaneous in the direction written? Select all that apply. Mg2+ (aq) + Be (s) → Mg (s) + Be2+ (aq) Cu2+ (aq) + Zn (s) → Cu (s) + Zn2+ (aq) Hg2+ (aq) + Cu (s) → Hg (l) + Cu2+ (aq) Pb2+ (aq) + Cu (s) → Pb (s) + Cu2+ (aq) Fe2+ (aq) + Pb (s) → Fe (s) + Pb2+ (aq) 2) What is the value (in V)...
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons &n
RODOX EXAMINATION An oxidation-reduction reaction involves the (1) sharing of electrons (3) transfer of electrons (2) sharing of protons (4) transfer of protons In this reaction, CO→ 2 CO + O2 the oxidation number of carbon changes from: (1) 0 to +4 (3) +3 to 0 (2) +2 to +4 (4) +4 to +2 Which balanced equation represents a redox reaction? AgNO3 (aq) +NaCl (aq) →AgCl (s) +NaNO3 (aq) H2CO3 (aq)...
1. Which of the followi ch of the following reactions is not readily explained by the...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids a...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Question 3 2.5 pts Which of the following are oxidation-reduction reactions? I. PCI; + Cl2 → PCI II. Cu + 2AgNO3 → Cu(NO3)2 + 2Ag CO2 + 2LiOH Li CO3 + H2O IV. FeCl2 + 2NaOH - Fe(OH)2 + 2NaCl III. I, II, III, and IV I and II o III I, II, and III IV
All of the following reactions can be described as displacement reactions except Select one: a. 2Na(s) + 2H2O(1) ► 2NaOH(aq) + H2(g). ob. CoH(1) + Cl2(g) → CH3C1(1) + HCl(g). oc. CuSO4(aq) + Fe(s) → Cu(s) + FeSO4(aq). O d. Zn(s) + FeCl2(aq) → ZnCl2(aq) + Fe(s). e. Cu(s) + 2AgNO3(aq) + Cu(NO3)2(aq) + 2Ag(s).
(10 pts) Balance the following redox reactions by first separating the oxidation and reduction half-reactions. a. Cut (aq) + Fe (s) Fe3+ (aq) + Cu(s) b. Cu(s) + HNO3 (aq) Cu2+ (aq) + NO (g) (basic solution) c. NH(aq) + O2(g) → N03 (aq) + H2O(l) (acidic solution) d. Cd(s) + NiO(OH)(s) + Ca(OH)2(s) + Ni(OH)2(s) (Nicad battery) e. The oxidation of iodide ion (1) by permanganate ion (MnO4) in basic solution to yield molecular iodine (12) and manganese(IV) oxide...
1) Assign Oxidation States every element in each of the following species: i) NaMnO4 iv) SF ii) Cu(CIO4)2 v) LiH iii) Cl2 vi) H2O2 2) 3) 2HBr(aq) + Cds CdBr2(aq) + H2(g) Element Oxidized: Element Reduced: Balance the following redox reaction in acidic solution: Cr2O72- + C2H5OH → Cr + CO2
1. (a) Balance the following half-reactions by the ion-electron half-reaction method: (i) (acid solution) NO3- (aq) + N2O (g) (ii) (acid solution) Fe042- (aq) + Fe3+ (aq) (iii) (base solution) Fe203 () → Fe(OH)2 (S) (iv) (base solution) Cu20 (s) + Cu(OH)2 (S) (b) Which of the above equations are oxidation half-reactions? (c) Give the formulas of the reactants that become oxidized in the course of the reaction.
Test IV (Electrochemistry) 2018 Fall What is the oxidation number for the Which of the following is true concerning a galvanic cell? (A) Oxidation occurs at the anode and is 1. 8. underlined manganese in Mn04 (A)-8 (8)-2 (C)-1 (D)4 (E) 7 where anions move towards where anions move towards where cations move towards where anions move towards where anions move towards 2. When balancing the below half-reaction in acidic solutionelectrons are added to the (B) Oxidation occurs at the...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 4 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago