Based on their positions in the periodic table, predict the charge, write the formula, and select...
Based on their positions in the periodic table, predict the
charge, write the formula, and select the name for the monatomic
ion formed by each of the following elements. Spelling counts!
Click in the answer box to open the symbol palette.
| Predicted charge | Formula of ion | Name of ion | |
| a) sodium |
(select)2+3+2−1+1−3− |
(select)sodite ionsodium ionsodiate ionsodiumide ion |
|
| b) potassium |
(select)2+1−3−1+2−3+ |
(select)potassiumide ionpotasside ionpotassiate ionpotassium ion |
|
| c) rubidium |
(select)3−1−3+2+2−1+ |
||
Homework Answers
Add Answer to:
Based on their positions in the periodic table, predict the
charge, write the formula, and select...
According to the Star Trek Fifth Interstellar Geophysical Conference Standard version of the periodic table, there...
According to the Star Trek Fifth Interstellar Geophysical Conference Standard version of the periodic table, there are 140 known elements. In what group of the periodic table would you place element 117, "topaline," which is reported to have been discovered on Ganymede in 2021? Group If the symbol for topaline is To, predict the formula of a compound that would presumably result from the reaction between barium and topaline, and name the compound. Spelling counts formula name:
1) Predict the charge that a magnesium (Mg) ion would have A) 5- B) 1+ C)...
1) Predict the charge that a magnesium (Mg) ion would have A) 5- B) 1+ C) 1- D) 2+ 2) Predict the charge that an ion formed from sulfur would have. A) 1- B) 6+ C) 3- D) 4+ E) 2- 3) Which of the following does NOT describe a metal? A) good conductor of heat B) good conductor of electricity C) tends to gain electrons D) forms ionic compounds with nonmetals E) found on the left side of the...
II. Using the Periodic Table to determine the ionic charge, predict the formulas of the binary...
II. Using the Periodic Table to determine the ionic charge, predict the formulas of the binary compounds formed from the following combinations of elements and write the name for each compound. a. calcium and iodine b. aluminum and oxygen c. magnesium and nitrogen III. Write the name for each of the following ionic compounds: a. Na20 b. AlF; c. Cu2S d. Fe e . ZnCl2 IV. Name of the following covalent compounds: a. N₂O5 b. SCl2 c. Cho d. SiBra...
1. Predict the empirical formula for each of the following compounds given the formula of magnesium...
1. Predict the empirical formula for each of the following compounds given the formula of magnesium oxide, Mgo. (a) calcium oxide (b) strontium oxide (c) barium oxide (d) radium oxide 2. Predict the empirical formula for each of the following compounds given the formula of sodium chloride, NaCl. (a) sodium fluoride (b) potassium chloride (d) rubidium iodide (c) lithium bromide 3. A 1.250-g sample of copper wire was heated in air and reacted with oxygen to give 1.565 g of...
1. Based on their positions on the Periodic Table, which ONE of the following elements would...
1. Based on their positions on the Periodic Table, which ONE of the following elements would be expected to have the largest first ionization energy? A) Si B) K C) O D) As E) Ca 2. Based on their positions on the Periodic Table, rank these ions in order of decreasing ionic radius: F–, Mg2+, Na+, O2–, S2–. (The correct answer has largest ion first, smallest ion last.) A) S2– > O2– > F– > Na+ > Mg2+ B) O2–...
DATE NAME SECTION POSTLABORATORY ASSIGNMENT 1. Predict the empirical formula for each of the following compounds...
DATE NAME SECTION POSTLABORATORY ASSIGNMENT 1. Predict the empirical formula for each of the following compounds given the formula of magnesium oxide, MgO. (a) calcium oxide (b) strontium oxide (c) barium oxide (d) radium oxide 2. Predict the empirical formula for each of the following compounds given the formula of sodium chloride, NaCl. (a) sodium fluoride (b) potassium chloride (c) lithium bromide (d) rubidium iodide 3. A 1.250 g sample of copper wire was heated in air and reacted with...
1. How do you predict the ion(s) formed by an element? 2. Write the condensed electron...
1. How do you predict the ion(s) formed by an element? 2. Write the condensed electron configurations for Cu and Cu2+. 3. Name 3 ions that have the electron configuration equal to Ar. Input the answers with the symbol and charge with no space between. For example H+ or Ba2+.
10. Based on Periodic Table positions, only this set has two elements that would have similar...
10. Based on Periodic Table positions, only this set has two elements that would have similar chemical properties: A. 11 Na, 12Mg. sXe, ssCs B. 13A, 14S, SP. As C. 13A, 18K, Ge, Sn. D. SF, Zr, son, sal 11. The IUPAC name of Ba(CIO) is A. Barium chloride B. Barium chlorite C. Barium perchlorate D. Barium chlorate 12. The correct order of increasing effective nuclear charge is AK <Mg <P <NO B. Mg <K<P <NO C.O <N<P < Mg...
Predict which of the following has a covalent bond (refer to Periodic Table). HCl KCl NaCl...
Predict which of the following has a covalent bond (refer to Periodic Table). HCl KCl NaCl all of the above none of the above Draw the structural formula for the chloride ion, ClO_2^-, and state the type of bonds in a chloride ion. 1 single bond and 1 double bond 2 single bonds 1 single bond and 1 triple bond none of the above Predict which of the following has a covalent bond (refer to Periodic Table) CoS CaS CdS...
2. Predict the formula of the ionic compounds formed from the following pairs of elements using L...
2. Predict the formula of the ionic compounds formed from the following pairs of elements using Lewis symbols. Name the compounds. a. Al and I b. Rb andS 3. Rank the following in order of increasing bond length and bond strength. a. Si-F Si-C; Si-o 4. Calculate the amount of energy necessary to break all the bonds in formaldehyde CH20. What type of process is this? -O 5. Predict which pairs give ionic, polar covalent, or nonpolar covalent compounds by...
According to the Star Trek Fifth Interstellar Geophysical Conference Standard version of the periodic table, there are 140 known elements. In what group of the periodic table would you place element 117, "topaline," which is reported to have been discovered on Ganymede in 2021? Group If the symbol for topaline is To, predict the formula of a compound that would presumably result from the reaction between barium and topaline, and name the compound. Spelling counts formula name:
1) Predict the charge that a magnesium (Mg) ion would have A) 5- B) 1+ C) 1- D) 2+ 2) Predict the charge that an ion formed from sulfur would have. A) 1- B) 6+ C) 3- D) 4+ E) 2- 3) Which of the following does NOT describe a metal? A) good conductor of heat B) good conductor of electricity C) tends to gain electrons D) forms ionic compounds with nonmetals E) found on the left side of the...
II. Using the Periodic Table to determine the ionic charge, predict the formulas of the binary compounds formed from the following combinations of elements and write the name for each compound. a. calcium and iodine b. aluminum and oxygen c. magnesium and nitrogen III. Write the name for each of the following ionic compounds: a. Na20 b. AlF; c. Cu2S d. Fe e . ZnCl2 IV. Name of the following covalent compounds: a. N₂O5 b. SCl2 c. Cho d. SiBra...
1. Predict the empirical formula for each of the following compounds given the formula of magnesium oxide, Mgo. (a) calcium oxide (b) strontium oxide (c) barium oxide (d) radium oxide 2. Predict the empirical formula for each of the following compounds given the formula of sodium chloride, NaCl. (a) sodium fluoride (b) potassium chloride (d) rubidium iodide (c) lithium bromide 3. A 1.250-g sample of copper wire was heated in air and reacted with oxygen to give 1.565 g of...
DATE NAME SECTION POSTLABORATORY ASSIGNMENT 1. Predict the empirical formula for each of the following compounds given the formula of magnesium oxide, MgO. (a) calcium oxide (b) strontium oxide (c) barium oxide (d) radium oxide 2. Predict the empirical formula for each of the following compounds given the formula of sodium chloride, NaCl. (a) sodium fluoride (b) potassium chloride (c) lithium bromide (d) rubidium iodide 3. A 1.250 g sample of copper wire was heated in air and reacted with...
10. Based on Periodic Table positions, only this set has two elements that would have similar chemical properties: A. 11 Na, 12Mg. sXe, ssCs B. 13A, 14S, SP. As C. 13A, 18K, Ge, Sn. D. SF, Zr, son, sal 11. The IUPAC name of Ba(CIO) is A. Barium chloride B. Barium chlorite C. Barium perchlorate D. Barium chlorate 12. The correct order of increasing effective nuclear charge is AK <Mg <P <NO B. Mg <K<P <NO C.O <N<P < Mg...
Predict which of the following has a covalent bond (refer to Periodic Table). HCl KCl NaCl all of the above none of the above Draw the structural formula for the chloride ion, ClO_2^-, and state the type of bonds in a chloride ion. 1 single bond and 1 double bond 2 single bonds 1 single bond and 1 triple bond none of the above Predict which of the following has a covalent bond (refer to Periodic Table) CoS CaS CdS...
2. Predict the formula of the ionic compounds formed from the following pairs of elements using Lewis symbols. Name the compounds. a. Al and I b. Rb andS 3. Rank the following in order of increasing bond length and bond strength. a. Si-F Si-C; Si-o 4. Calculate the amount of energy necessary to break all the bonds in formaldehyde CH20. What type of process is this? -O 5. Predict which pairs give ionic, polar covalent, or nonpolar covalent compounds by...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 51 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago