Homework Answers
Add Answer to:
Which of the following pairs of compounds would give the most successful crossed aldol condensation when...
0/1pts Incorrect Question 2 Which of the following pairs of compounds would give the most successful...
0/1pts Incorrect Question 2 Which of the following pairs of compounds would give the most successful crossed aldol condensation when combined in the presence of a strong base? (Note: by "successful" we mean that the reaction 1) actually works, and 2) gives only a single aldol condensation product.) Pair A Ph and Bu н н Pair B: and "н H Ph Pair C: and H Ph OMe Pair D and HT Pair D Pair C Pair B Pair A
Question 2 1 pts Which of the following pairs of compounds would give the most successful...
Question 2 1 pts Which of the following pairs of compounds would give the most successful crossed aldol condensation when combined in the presence of a strong base? (Note: by "successful" we mean that the reaction 1) actually works, and 2) gives only a single aldol condensation product.) masa - marce nie Paic: one and Love Pair o: ¿ and i Оме O
Give the starting carbonyl compounds needed to prepare the following compounds through an aldol condensation. 4....
Give the starting carbonyl compounds needed to prepare the following compounds through an aldol condensation. 4. b. CaHs c. d.
1. Which of the compounds listed below would produce the following aldol condensation product? 2. Which...
1. Which of the compounds listed below would produce
the following aldol condensation product?
2. Which is not a product of the claisen condensation
of ethyl ethanoate and ethyl butanoate?
3. A claisen-schmidt reaction shown below, is an
important step in the commercial synthesis of Vitamin A: what type
of reaction is the claisen- Schmidt?
4. Which of the following statements is true about the
anion formed from the reaction of diethyl malonate with sodium
ethoxide?
please help
A. cycloh...
36. Which of the following compounds is able to undergo a self-aldol condensation? A. phenylethanal B....
36. Which of the following compounds is able to undergo a self-aldol condensation? A. phenylethanal B. formaldehyde C. benzaldehyde D. 2,2-dimethylpropanal 37. The best synthesis of 1,4-dimethyl-2-nitrobenzene is: A. Benzene 1. HNO3, H2SO4 2. 2 CH,CI, 2 AICI: 1. HNO3, H2SO4 2. CH3CI, AICI: HNO3, H2SO4 B. toluene C. p-xylene D.m-nitrotoluene CH3CI, AICI: 38. Which of these is the most reliable way to make 3-heptene? A. CH,CH,CHBECH,CH,CH,CH3 + NaOCH3, heat B. CH3CH2CH-0 + Ph3P-CHCH,CH.CH C. CH CH CHOHCH2CH2CH2CH3 + H2SO4,...
identify which compound is more acidic and explain your choice. or each of the following compounds,...
identify which compound is more acidic and explain your choice. or each of the following compounds, Make sure you include structures of these which compounds in your answers ounds, 1. F (e) 24-Dimethy-3,5-hepanedione or 4, 4-Dimethy)-3,5-heptanedione (b) 1.2-Cyclopentanedione or 1,3-cyclopentanedione 2. When 2-hepten-4-one is treated with LDA, a proton is removed from one of the gamma (z) positions. identily which gamma position is deprotonated, and explain why the y proton is the most acidie proton in the compound. 3. Rank...
Identify the compound with the higher boiling point in each of the following pairs of compounds:...
Identify the compound with the higher boiling point in each of the following pairs of compounds: 1. CH2-CH2-OH or H--C--0--CHz OH 2. CHz---0-CH3 or CH3-CH-CH2-CH3 0 2, CH, -- pH 3. CHz--2-0-CH, or CH3-CH2-CH2-CH2-CH3 Write the products of hydrolysis or saponification for the following esters. н" 1. CH3-CH-CH2--0--0--CH3 + H2O O 2, CH4-C-0-CH + NaOH 3. O -8-6-CH2-CH; -CH ---CH3 + KOH — -0--CH-CH2-CH3 + H20 - Properties of Esters sters shave higher boiling points than alkanes but lower than...
Please complete for Tuesday, we will go through the questions and mark them in class. pg 156 - 4.23,...
Please complete for Tuesday, we will go through the questions and mark them in class. pg 156 - 4.23, 4.24, 4.26 pg 170 - 4.29, 4.31, pg 171-4.36 pg 175 - 4.59 pg 176- 4.74, 4.75, 4.80 pg 177-4.81, 4.82 pg 188- 5.1, 5.4, 5.5, 5.6, 5.11 - Using Table 5.1 pg 198-5.22, 5.25 pg 203 - 5.29 pg 206 - 5.37 pg 209 - 5.39 pg 2.14 5.61 pg 235-6.11, 6.14, 6.16 156 CHAPTER 4 Introduction to Organic Compounds...
1. Which of the following are the sites within the human body where carbon dioxide and...
1. Which of the following are the sites within the human body where carbon dioxide and oxygen are exchanged? A. Alveoli B. Arteries C. Synapses D. Venules 2. Which of the following describes the most important reason for repeating an experimental investigation? A. To verify the validity of the original findings B. To expand upon the original investigation C. To manipulate the independent variable D. To attempt to disprove the hypothesis 3. Lithium has an atomic number of 3 and...
Actions that damage a company and its employees should be stamped out, everyone would agree. But ...
Actions that damage a company and its employees should be stamped out, everyone would agree. But should the people responsible be stamped out, too? HBR CASE STUDY The Reign of Zero Tolerance by Ben Gerson "Mr. Pemberton?" manager. The guards had radioed her that the "Yes, that's me," Simon replied distractedly, his back turned. target wasn't putting up much resistance. "Your personal belongings will be messen The two burly gentlemen who had suddenly gered to your home later today," Sallie...
0/1pts Incorrect Question 2 Which of the following pairs of compounds would give the most successful crossed aldol condensation when combined in the presence of a strong base? (Note: by "successful" we mean that the reaction 1) actually works, and 2) gives only a single aldol condensation product.) Pair A Ph and Bu н н Pair B: and "н H Ph Pair C: and H Ph OMe Pair D and HT Pair D Pair C Pair B Pair A
Question 2 1 pts Which of the following pairs of compounds would give the most successful crossed aldol condensation when combined in the presence of a strong base? (Note: by "successful" we mean that the reaction 1) actually works, and 2) gives only a single aldol condensation product.) masa - marce nie Paic: one and Love Pair o: ¿ and i Оме O
Give the starting carbonyl compounds needed to prepare the following compounds through an aldol condensation. 4. b. CaHs c. d.
1. Which of the compounds listed below would produce
the following aldol condensation product?
2. Which is not a product of the claisen condensation
of ethyl ethanoate and ethyl butanoate?
3. A claisen-schmidt reaction shown below, is an
important step in the commercial synthesis of Vitamin A: what type
of reaction is the claisen- Schmidt?
4. Which of the following statements is true about the
anion formed from the reaction of diethyl malonate with sodium
ethoxide?
please help
A. cycloh...
36. Which of the following compounds is able to undergo a self-aldol condensation? A. phenylethanal B. formaldehyde C. benzaldehyde D. 2,2-dimethylpropanal 37. The best synthesis of 1,4-dimethyl-2-nitrobenzene is: A. Benzene 1. HNO3, H2SO4 2. 2 CH,CI, 2 AICI: 1. HNO3, H2SO4 2. CH3CI, AICI: HNO3, H2SO4 B. toluene C. p-xylene D.m-nitrotoluene CH3CI, AICI: 38. Which of these is the most reliable way to make 3-heptene? A. CH,CH,CHBECH,CH,CH,CH3 + NaOCH3, heat B. CH3CH2CH-0 + Ph3P-CHCH,CH.CH C. CH CH CHOHCH2CH2CH2CH3 + H2SO4,...
identify which compound is more acidic and explain your choice. or each of the following compounds, Make sure you include structures of these which compounds in your answers ounds, 1. F (e) 24-Dimethy-3,5-hepanedione or 4, 4-Dimethy)-3,5-heptanedione (b) 1.2-Cyclopentanedione or 1,3-cyclopentanedione 2. When 2-hepten-4-one is treated with LDA, a proton is removed from one of the gamma (z) positions. identily which gamma position is deprotonated, and explain why the y proton is the most acidie proton in the compound. 3. Rank...
Identify the compound with the higher boiling point in each of the following pairs of compounds: 1. CH2-CH2-OH or H--C--0--CHz OH 2. CHz---0-CH3 or CH3-CH-CH2-CH3 0 2, CH, -- pH 3. CHz--2-0-CH, or CH3-CH2-CH2-CH2-CH3 Write the products of hydrolysis or saponification for the following esters. н" 1. CH3-CH-CH2--0--0--CH3 + H2O O 2, CH4-C-0-CH + NaOH 3. O -8-6-CH2-CH; -CH ---CH3 + KOH — -0--CH-CH2-CH3 + H20 - Properties of Esters sters shave higher boiling points than alkanes but lower than...
Please complete for Tuesday, we will go through the questions and mark them in class. pg 156 - 4.23, 4.24, 4.26 pg 170 - 4.29, 4.31, pg 171-4.36 pg 175 - 4.59 pg 176- 4.74, 4.75, 4.80 pg 177-4.81, 4.82 pg 188- 5.1, 5.4, 5.5, 5.6, 5.11 - Using Table 5.1 pg 198-5.22, 5.25 pg 203 - 5.29 pg 206 - 5.37 pg 209 - 5.39 pg 2.14 5.61 pg 235-6.11, 6.14, 6.16 156 CHAPTER 4 Introduction to Organic Compounds...
Actions that damage a company and its employees should be stamped out, everyone would agree. But should the people responsible be stamped out, too? HBR CASE STUDY The Reign of Zero Tolerance by Ben Gerson "Mr. Pemberton?" manager. The guards had radioed her that the "Yes, that's me," Simon replied distractedly, his back turned. target wasn't putting up much resistance. "Your personal belongings will be messen The two burly gentlemen who had suddenly gered to your home later today," Sallie...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 31 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago