Homework Answers
Higher the oxidation state of metal in complex compound , higher will be the stability of complex compound .
More the coordination number , more will be the thermal stability of complex compound .
The ligands forming a ring (i.e. di, tri, tetra etc dentate ligands) with central metal , also have more stable complex compound called chelate effect . ( Formation of such compounds are entropy driven ) .
Co(en)33+ complex ions is thermodynamically most stable among the given ions .
Add Answer to:
2. For each of the following compounds, select the one that would be most thermodynamically stable....
A37. Which one of the following coordination complexes would you expect to have the largest formation...
A37. Which one of the following coordination complexes would you expect to have the largest formation constant? (en is the bidentate ligand ethane-1,2- diamine, H2NCH2CH2NH2) 3+ (A) ICo(eno (B) ICo(en)o2 (C) [Co(NH3)6 (D) [Co(NH3)6l2+ (E) [Co(NH3)4] + 3+ Questions continue on next page
Draw both chair conformations of (1R,2S)-2-chlorocyclohexaneamine. Clearly label the most stable conformation, and provide a brief...
Draw both chair conformations of (1R,2S)-2-chlorocyclohexaneamine. Clearly label the most stable conformation, and provide a brief explanation for your choice.
Can someone please explain this! 15. Circle one of the following charged compounds which is most stable. (3 Points) Sle...
Can someone please explain this!
15. Circle one of the following charged compounds which is most stable. (3 Points) Sleast acidic +2 Which is the stronger influence for your choice? a) Resonance or b) Induction hyperconjugation)? (2 Points)
14) For the following pairs, pick the one that best satisfies the preceding description and give...
14) For the following pairs, pick the one that best satisfies the preceding description and give a brief explanation for your choice. Be sure to indicate the physical reason behind your choice, not just the memorized trend. (20 points) (a) The stronger oxidizing agent: Snoor Geo ? (b) The most thermodynamically stable material: PbO PbS ? or (c) The most reactive to water: KN or WN ? (include a balanced equation for the reaction of the chosen species with water)...
Which of the following compounds is the most stable? Which of the following compounds is the...
Which of the following compounds is the most stable?
Which of the following compounds is the most stable? (E)-2-methyl-1,3-pentadien 2-methyl-2,3-pentadiene 2-methyl-1,4-pentadiene (Z)-2-methyl-1,3-pentadiene 2-methyl-1,2-pentadiene
Rank the acidity of each of these compounds from least to most acidic.
Rank the acidity of each of these compounds from least to most acidic. The explicitly drawn hydrogens should be compared. For each pair, provide a brief explanation for your ranking.
3. (i) Rank order the following compounds with most reactive at top and most stable at...
3. (i) Rank order the following compounds with most reactive at top and most stable at the bottom. (ii) Provide a name for each functional group. (iii) Indicate how to make each functional group beginning with a carbonyl compound (e.g., phosgene, or the carboxylic acid or derivative thereof) and amine or alcohol or thiol. ROR RN-R I-z 0 Ann-R' Ron I-Z H H
Ranking Compounds by Acidity. Needed help with explanations to why each is. 2. Rank the compounds...
Ranking Compounds by Acidity. Needed help with explanations to
why each is.
2. Rank the compounds below by acidity. Provide a brief explanation for your answer. COOH COOH COOH COOH OCH NO2 3. Rank the labeled hydrogens below by acidity. Provide a brief explanation for your answer. CH, H CEC b .-CEC-H CH CH CH2-C=C-H 4. Rank the labeled hydrogen by acidity. Provide a brief explanation for your answer. CH-CH=CH-CEC-H 5. Rank the compounds below by acidity. Provide a brief...
Of each of the following pairs of compounds, identify the one which would be the more...
Of each of the following pairs of compounds, identify the one
which would be the more stable, and give a justification???
Q5. Of each of the following pairs of compounds, identify the one which would be the more stable, and give a justification. Justification A) cis or trans-CH3CH2CH=CHCH3 che o CH2 or CHCH; cichs ºn) or (ZCH,COCH=CHČOCH or (Z)-CH3COCH=CHCOCH3
2. Give a systematic name for each of the following compounds, and give the number of...
2. Give a systematic name for each of the following compounds, and give the number of d electrons for the transition metal: a. Cs2[FeCl4] b. W(CO)6 c. Na2[Cr(CO)5] d. [Ni(NH3)2(en)2](PF6)2 (PF6 is a (1-) ion, and is named as if phosphorus were a metal) e. [Ru(CN)6]3– f. K[OsF6]
A37. Which one of the following coordination complexes would you expect to have the largest formation constant? (en is the bidentate ligand ethane-1,2- diamine, H2NCH2CH2NH2) 3+ (A) ICo(eno (B) ICo(en)o2 (C) [Co(NH3)6 (D) [Co(NH3)6l2+ (E) [Co(NH3)4] + 3+ Questions continue on next page
Can someone please explain this!
15. Circle one of the following charged compounds which is most stable. (3 Points) Sleast acidic +2 Which is the stronger influence for your choice? a) Resonance or b) Induction hyperconjugation)? (2 Points)
14) For the following pairs, pick the one that best satisfies the preceding description and give a brief explanation for your choice. Be sure to indicate the physical reason behind your choice, not just the memorized trend. (20 points) (a) The stronger oxidizing agent: Snoor Geo ? (b) The most thermodynamically stable material: PbO PbS ? or (c) The most reactive to water: KN or WN ? (include a balanced equation for the reaction of the chosen species with water)...
Which of the following compounds is the most stable?
Which of the following compounds is the most stable? (E)-2-methyl-1,3-pentadien 2-methyl-2,3-pentadiene 2-methyl-1,4-pentadiene (Z)-2-methyl-1,3-pentadiene 2-methyl-1,2-pentadiene
3. (i) Rank order the following compounds with most reactive at top and most stable at the bottom. (ii) Provide a name for each functional group. (iii) Indicate how to make each functional group beginning with a carbonyl compound (e.g., phosgene, or the carboxylic acid or derivative thereof) and amine or alcohol or thiol. ROR RN-R I-z 0 Ann-R' Ron I-Z H H
Ranking Compounds by Acidity. Needed help with explanations to
why each is.
2. Rank the compounds below by acidity. Provide a brief explanation for your answer. COOH COOH COOH COOH OCH NO2 3. Rank the labeled hydrogens below by acidity. Provide a brief explanation for your answer. CH, H CEC b .-CEC-H CH CH CH2-C=C-H 4. Rank the labeled hydrogen by acidity. Provide a brief explanation for your answer. CH-CH=CH-CEC-H 5. Rank the compounds below by acidity. Provide a brief...
Of each of the following pairs of compounds, identify the one
which would be the more stable, and give a justification???
Q5. Of each of the following pairs of compounds, identify the one which would be the more stable, and give a justification. Justification A) cis or trans-CH3CH2CH=CHCH3 che o CH2 or CHCH; cichs ºn) or (ZCH,COCH=CHČOCH or (Z)-CH3COCH=CHCOCH3
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 6 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 23 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 24 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 38 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 6 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago