Please provide an IUPAC name for each of the following structures CH3 HзС, CH2CH3CHCH3 F CH2CH3...
Give the IUPAC name for each compound 11.39 Give the IUPAC name for each compound. CH3 CH3 (CH3CH2)2C-CHCHCH2CHCH b. CH2 CCH2CH3 CH2CH2CH2CH2CH3 CH3 CH3 с. Cн,сс-Сн,— СH—С—сH,CH, CH2CH3
What is the IUPAC name for the following alkane? CH3 CH3-CH-CH2-CH2-CH2-CH3 What is the IUPAC name for the following alkane? CH2 CH CH2-CH3 CH2 Including the cis or trans designation, what is the IUPAC name of the following substance? It is not necessary to put cis or trans in italics. CH3 CH3CH2 CH2CHa Including the cis or trans designation, what is the IUPAC name of the following substance? It is not necessary to put cis or trans in italics. CH3...
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
Give the IUPAC name for the following structures: Part II: Give the IUPAC name for each of the following structures. (10 marks) 1. нс. CH CH3 CH3 2. нс. CH3 CH3 CH3 3 -CH3 CH3 CH3 4. F CH3 CI 5. À 6. HC CH3 Br CH3 H 7. H 8. H3C 9. HC CI HC CHE 10. H3c CH3
1) Name the following compounds, according to IUPAC rules: (20 pts.) a) b) CH3-CH2 CEC-CH-CH2-CH-CHs d) CH3 CH-CH-CH2-CH2-CH сH, CH3 e) CH3 CH3-C C-CH2-CH-CH2- CH3 f) CH3 -CH2-CH2-CH3 CH3-CH CH-CH-CH2 g) CH3 н - c-c CH-CH2-CH2 CH3 CH3 н i) -CHз CI Hас CH3-C CH2-CH3 CI j) CH2-CH3 "CH,—сн, CH2 CH3
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
Provide an IUPAC name for each of the compounds shown. (Specify (E)/(Z) stereochemistry, if relevant, for straight chain alkenes only. Pay attention to commas, dashes, etc.) CH3 CH3CH2CH H H₃C o I H CH3 CH3 CH3 eu CH3CHCO H CH3 Provide an IUPAC name for each of the compounds shown. (Specify (E)/(Z) stereochemistry, if relevant, for straight chain alkenes only. Pay attention to commas, dashes, etc.) ci? CH3 CH2CH3 mocloco CH3CH2CH2 C= H3CH2CH2C C
please explain the work Provide a mechanism for the following transformation. 7. CHз .CH3 Hзс, снз Он H2SO4
Provide an IUPAC name for each of rhe following compounds shown. Specify (E)/(Z) stereochemistry, if relevant, for straight chain alkenes only. Pay attention to commas, dashes, etc CH3 CHCI CI C=C C H. HH н CHCH(CH3)2 CH3 Br CH3 c=c H2C- CH2 H CH3 CHCI C=C
please provide nomenclature for a through j. thanks! Nomenclature Provide the IUPAC name for the following a. CHỊCH-CH(CH3)CH2CH(CHO)CH, C. (CH3)3CCH2C(CH3)3 d. C(CH3)4 f. CH3C(CI)2CH(CH3)2 h. (CH2CH2)2CHCH(CH3)CH2CH3 j. CH2CH(CH3)CCCH2CH3