Homework Answers
Add Answer to:
QUESTION 4 1 points What is true about the following mechanism? ОН НСІ Sn1 Its mechanism...
1) What is the product and Mechanism for the following SN2 reaction? (5 Points) 2) What...
1) What is the product and Mechanism for the following SN2 reaction? (5 Points) 2) What is/are the product(s) and Mechanism for the following E2 reaction? (5 Points) NaOCH 3) What is/are the product(s) and Mechanism for the following SN1/E1 Reaction? (5 Points) CH,CH,OH 4) What kind of reagent would be needed in order to get this SN2 product? (5 Points) SN2
1. Consider the following substituted alkanes. Indicate if the molecule would prefer to undergo an SN1...
1. Consider the following substituted alkanes. Indicate if the molecule would prefer to undergo an SN1 reaction, an reaction, BOTH S1/E1 or neither: -BOK 2. Briefly explain why you selected what you did for question 1a, 1b, and 1c. 3. Provide the missing reactant(s) or product(s) as necessary for the following Sy1 reactions. Be sure to use wedges/dashes to indicate stereochemistry where relevant. осн. HOCH,CH, heat 4. Draw the complete mechanism for the following reaction. Include all lone pairs, formal...
30. Late papers not accepted. Work Independently. 1. Predict the most likely reaction mechanism (SN1, SN2,...
30. Late papers not accepted. Work Independently. 1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH₂ Na O=CH₂ Hic Br 2 Draw complete mechanism with arrows for the SNI/E1 mechanism. Check for carbocation rearrangements CH3 + H2O 3. Which is the major product for the following reaction? Y CH + NaOH CH HO HO H₃ CH₂ H₃ HOCH CH₂ H₃ CHE CH₂ CH₂ CH3 CH 4. Name the following including the R/S, E/Z...
Question 1 What is the mechanism of the synthesis of methyl salicylate? esterification Sn1 SnAcyl AnE Question 2 Which compound is responsible for the burnt-fat odor in the test for gly...
Question 1 What is the mechanism of the synthesis of methyl salicylate? esterification Sn1 SnAcyl AnE Question 2 Which compound is responsible for the burnt-fat odor in the test for glycerol? glycerol acrolein acetic acicd o fatty acid Question 3 Which of the following reagents is NOT used for the synthesis of methyl salicylate? o acetic acid methanol salicylic acid sulfuric acid Question 4 Which of the following chemically define a soap? salt of a thoester salt of a carboxylic...
Question 2 4 pts E1 and Sn1 reactions can compete. Check all of the reasons why...
Question 2 4 pts E1 and Sn1 reactions can compete. Check all of the reasons why E1 predominates in this week's reaction. Note: this question is graded by Canvas as "right minus wrong", subtracting points for wrong answers. o no good nucleophile is present in solution the E1 product is distilled out of the reaction mixture as it is formed, thus the reaction is driven to completion (Le Chatelier's Principle) the intermediate carbocation is too sterically hindered for substitution to...
For the chemical reaction answer the following questions: 1. Is the mechanism Sn1 or Sn2? 2....
For the chemical reaction answer the following questions:
1. Is the mechanism Sn1 or Sn2?
2. What kind of substrate reacts in the following reaction? (2 °
, 2 ° allylic , 3 ° )
3. Is the role of the alkyl halide reactant an acid, base,
electrophile, nucleophile , or both a nucleophile and base?
4. Is the role of the reagent KI an acid, base, electrophile,
nucleophile , or both a nucleophile and base?
5. What is the...
1. In both the sodium iodide test and the silver nitrate test, why does 2-bromobutane react faster...
1. In both the sodium iodide
test and the silver nitrate test, why does 2-bromobutane react
faster than 2-chlorobutane?
Bromine is a better leaving group since it is a weaker base than
chlorine is.
2. a. Why does benzyl chloride react under both
SN1 and SN2 conditions?
Benzyl
chloride is a primary alkyl halide, hence reactive under SN2
conditions.
The
primary carbocation formed due to the departure of Cl- is
stabilized by the pi electrons in the benzene ring.
b. Why is...
Question 35 (2.5 points) What is the relationship between the following compounds? н он н он...
Question 35 (2.5 points) What is the relationship between the following compounds? н он н он но н но ༢ ཙ ༩ ། O diastereomers enantiomers identical compounds constitutional isomers O completely unrelated compounds Question 36 (2.5 points) Consider the following molecule with its shown stereochemistry. What positions do the substituents occupy when the molecule in its most stable conformation? 1: axial 2: equatorial O 1:equatorial 2: axial 1: axial 2: axial all of the above are equally stable. 1:equatorial...
I don't quite understand how to draw the shape and how the whole question will progress...
I don't quite understand how to draw the shape and how
the whole question will progress please explain how it will look
and why and how to solve this question - thank you
HU (S)-(1-Bromoethyl) benzene Planar, achital Figure 7-3 Racemization upon SNT benzene. Initial ionization furnishes a p water, yields racemic alcohol. он (R)-1-Phenylethanol Racemic mixture nization upon Sn1 hydrolysis of the chiral and optically pure (SH1-bromoethyl on Turnishes a planar, achiral carbocation. This ion, when trapped with Exercise...
please answer questions 1-4 Question 1 Which of the following is the most stable carbocation? СН3...
please answer questions 1-4
Question 1 Which of the following is the most stable carbocation? СН3 V. CH2 What is the major product of the following reaction? Н HBO C CHS CH CH CH3-CH ( CH, Br CH2-CH-C–CH, Br Br CH CH CH3-CH:-¢-CH Br ін, CHE CH CH.-CH- Br CH. D Question 3 What is the major product of the following reaction? CH, НО 1 Оснок IV. CH2OH CH3 "О" ОН Д. он СН3 CH3 Но Ш. CH, ОН Question...
1) What is the product and Mechanism for the following SN2 reaction? (5 Points) 2) What is/are the product(s) and Mechanism for the following E2 reaction? (5 Points) NaOCH 3) What is/are the product(s) and Mechanism for the following SN1/E1 Reaction? (5 Points) CH,CH,OH 4) What kind of reagent would be needed in order to get this SN2 product? (5 Points) SN2
1. Consider the following substituted alkanes. Indicate if the molecule would prefer to undergo an SN1 reaction, an reaction, BOTH S1/E1 or neither: -BOK 2. Briefly explain why you selected what you did for question 1a, 1b, and 1c. 3. Provide the missing reactant(s) or product(s) as necessary for the following Sy1 reactions. Be sure to use wedges/dashes to indicate stereochemistry where relevant. осн. HOCH,CH, heat 4. Draw the complete mechanism for the following reaction. Include all lone pairs, formal...
30. Late papers not accepted. Work Independently. 1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH₂ Na O=CH₂ Hic Br 2 Draw complete mechanism with arrows for the SNI/E1 mechanism. Check for carbocation rearrangements CH3 + H2O 3. Which is the major product for the following reaction? Y CH + NaOH CH HO HO H₃ CH₂ H₃ HOCH CH₂ H₃ CHE CH₂ CH₂ CH3 CH 4. Name the following including the R/S, E/Z...
Question 1 What is the mechanism of the synthesis of methyl salicylate? esterification Sn1 SnAcyl AnE Question 2 Which compound is responsible for the burnt-fat odor in the test for glycerol? glycerol acrolein acetic acicd o fatty acid Question 3 Which of the following reagents is NOT used for the synthesis of methyl salicylate? o acetic acid methanol salicylic acid sulfuric acid Question 4 Which of the following chemically define a soap? salt of a thoester salt of a carboxylic...
Question 2 4 pts E1 and Sn1 reactions can compete. Check all of the reasons why E1 predominates in this week's reaction. Note: this question is graded by Canvas as "right minus wrong", subtracting points for wrong answers. o no good nucleophile is present in solution the E1 product is distilled out of the reaction mixture as it is formed, thus the reaction is driven to completion (Le Chatelier's Principle) the intermediate carbocation is too sterically hindered for substitution to...
For the chemical reaction answer the following questions:
1. Is the mechanism Sn1 or Sn2?
2. What kind of substrate reacts in the following reaction? (2 °
, 2 ° allylic , 3 ° )
3. Is the role of the alkyl halide reactant an acid, base,
electrophile, nucleophile , or both a nucleophile and base?
4. Is the role of the reagent KI an acid, base, electrophile,
nucleophile , or both a nucleophile and base?
5. What is the...
1. In both the sodium iodide
test and the silver nitrate test, why does 2-bromobutane react
faster than 2-chlorobutane?
Bromine is a better leaving group since it is a weaker base than
chlorine is.
2. a. Why does benzyl chloride react under both
SN1 and SN2 conditions?
Benzyl
chloride is a primary alkyl halide, hence reactive under SN2
conditions.
The
primary carbocation formed due to the departure of Cl- is
stabilized by the pi electrons in the benzene ring.
b. Why is...
Question 35 (2.5 points) What is the relationship between the following compounds? н он н он но н но ༢ ཙ ༩ ། O diastereomers enantiomers identical compounds constitutional isomers O completely unrelated compounds Question 36 (2.5 points) Consider the following molecule with its shown stereochemistry. What positions do the substituents occupy when the molecule in its most stable conformation? 1: axial 2: equatorial O 1:equatorial 2: axial 1: axial 2: axial all of the above are equally stable. 1:equatorial...
I don't quite understand how to draw the shape and how
the whole question will progress please explain how it will look
and why and how to solve this question - thank you
HU (S)-(1-Bromoethyl) benzene Planar, achital Figure 7-3 Racemization upon SNT benzene. Initial ionization furnishes a p water, yields racemic alcohol. он (R)-1-Phenylethanol Racemic mixture nization upon Sn1 hydrolysis of the chiral and optically pure (SH1-bromoethyl on Turnishes a planar, achiral carbocation. This ion, when trapped with Exercise...
please answer questions 1-4
Question 1 Which of the following is the most stable carbocation? СН3 V. CH2 What is the major product of the following reaction? Н HBO C CHS CH CH CH3-CH ( CH, Br CH2-CH-C–CH, Br Br CH CH CH3-CH:-¢-CH Br ін, CHE CH CH.-CH- Br CH. D Question 3 What is the major product of the following reaction? CH, НО 1 Оснок IV. CH2OH CH3 "О" ОН Д. он СН3 CH3 Но Ш. CH, ОН Question...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 26 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 57 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago