Homework Answers
Add Answer to:
1) Draw the enol forms of the molecule shown here no OH 2) Provide the product...
what is the ideal speed to take a 85 m radius curve banked at 30.0 angle 4) Provide acceptable IUPAC name for t...
what is the ideal speed to take a 85 m radius curve banked at
30.0 angle
4) Provide acceptable IUPAC name for the structure below 5) Provide a complete name that includes the descriptor for the alkene shown below H2SO4 You Husoo HCI w 1) BH 2) H2O, OH NBS DMSO H2O 6) Draw the two products that result from ozonolysis of 2-methyloct-2-ene 7) Which reagent adds to an alkene exclusively in an ANTI fashion? A)HPd-C (B) Brz (C BH3,...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following reactions. Question Answer 8. 1. NaH OH ? 2. OTs 9. NBS ? major product 10. Nal Br ? Acetone Br 11. 1. NaNH2 H3C-CECH ? 2. OTS 12. OH Br NaOH ? cyclic compound 13. OH HBT ? 14. ? OH cat. H2SO4 H20 Room temp. 15. Br MeOH
provide the major product for the following reaction? (1) BH3, ether (2) H202, OH
provide
the major product for the following reaction?
(1) BH3, ether (2) H202, OH
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions...
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) H2O 1. Hg(OAC), CH, OH 2. NaBH H2SO4 H20 1) BH-THF 2) H202, KOH HBr Bry, H2O HBr ROOR 1. BH3-THF 2. H2O2, NaOH H20, H2SO4 1. NaNH2 H2 H-CEC-CH2 CH2 CH3 2. CH CH Br Lindlar cat 1. Sia BH-THF 2. H2O2, H2O
Provide the major organic product of the reaction shown. OH PBry Draw the molecule on the...
Provide the major organic product of the reaction shown. OH PBry Draw the molecule on the canvas by choosing buttons from the Tools (for bonds), Atoms, an Do ®H: 120 EXP Cont a
Provide the major product for the following reaction? (2)Zn, H* ano Provide the major product for...
Provide the major product for the following reaction? (2)Zn, H* ano Provide the major product for the following reaction? Br2 CH Cl2 H- S Provide the major product for the following reaction? heat H- -H Provide the major product for the following reaction? 1) Hg(OAc)2, H20/TH 2) NABH4 н- H Provide the major product for the following reaction? (1) BH3, ether HO-0H (2) Provide the major product for the following reaction? (1) BH3, ether (2) H202 OH
1) R'-MgBr in THF 2)H,o NaH Ho or OH PAA X2. H20 1) Hg(OAc)2, R'OH 2)...
1) R'-MgBr in THF 2)H,o NaH Ho or OH PAA X2. H20 1) Hg(OAc)2, R'OH 2) NaBH4, NaOH, H20 Os0 NaHSO, H2O I) 2)CH, SCH HyIO HBr ROOR 1)BH3. THF 2)H202, NaOH, H2O Mg, THF PBr3 NaOH )OTHF 2) H30 CrOj. H,SO, 1) NaH 2)RXDMF "О-R DMF PCC DCM ) THF 2) H3O+ SOCI pyridine Li Hexanes
Structure Analysis Provide the major product for the following reactions: 1. BH, THF 2. H2O2.NaOH Os04...
Structure Analysis Provide the major product for the following reactions: 1. BH, THF 2. H2O2.NaOH Os04 NMO THF/H20 1. NaNH2 2. H20 HOSO, H2SO4 но 13. For one of the following reaction, provide a complete and detailed electron pushing mechanism accounting for the product that is obtained/indicated. Only one reaction mechanism will be graded. Use proper arrows. HB
20. Provide the reagents necessary to complete the following the following transformation. A. 1. BH3 THF2....
20. Provide the reagents necessary to complete the following the following transformation. A. 1. BH3 THF2. H2O2. HO- B. H20, H2SO4 C. OsO4 H202 D. CH3CO3H E. 1. CH3CO3H 2. H, H20 21. Provide the major organic product of the reaction below. 10. 2. (CHS uraw the major organic product generated in the reaction below. Pay particular attention to and stereochemical detail. CH3 CH, KMnO4 (warm, conc.) CH, H 23. Give the structure of the alkene which would yield the...
Provide the product you'd expect from the following reaction? OH SOCIL pyridine Draw the allylic radical...
Provide the product you'd expect from the following reaction? OH SOCIL pyridine Draw the allylic radical intermediates you would expect to form as intermediates in the following reaction NBS "Вг + hv "Вr Predict the product(s) you'd expect when the following molecule is treated with NBS and irradiated with UV light? Draw all possible monochlorinated products you'd expect upon treating cyclohexane with Cl2 and irradiated with UV light. Draw all possible monochlorinated products you'd expect upon treating 2-methylbutane with Cl2...
what is the ideal speed to take a 85 m radius curve banked at
30.0 angle
4) Provide acceptable IUPAC name for the structure below 5) Provide a complete name that includes the descriptor for the alkene shown below H2SO4 You Husoo HCI w 1) BH 2) H2O, OH NBS DMSO H2O 6) Draw the two products that result from ozonolysis of 2-methyloct-2-ene 7) Which reagent adds to an alkene exclusively in an ANTI fashion? A)HPd-C (B) Brz (C BH3,...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following reactions. Question Answer 8. 1. NaH OH ? 2. OTs 9. NBS ? major product 10. Nal Br ? Acetone Br 11. 1. NaNH2 H3C-CECH ? 2. OTS 12. OH Br NaOH ? cyclic compound 13. OH HBT ? 14. ? OH cat. H2SO4 H20 Room temp. 15. Br MeOH
provide
the major product for the following reaction?
(1) BH3, ether (2) H202, OH
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) H2O 1. Hg(OAC), CH, OH 2. NaBH H2SO4 H20 1) BH-THF 2) H202, KOH HBr Bry, H2O HBr ROOR 1. BH3-THF 2. H2O2, NaOH H20, H2SO4 1. NaNH2 H2 H-CEC-CH2 CH2 CH3 2. CH CH Br Lindlar cat 1. Sia BH-THF 2. H2O2, H2O
Provide the major organic product of the reaction shown. OH PBry Draw the molecule on the canvas by choosing buttons from the Tools (for bonds), Atoms, an Do ®H: 120 EXP Cont a
Provide the major product for the following reaction? (2)Zn, H* ano Provide the major product for the following reaction? Br2 CH Cl2 H- S Provide the major product for the following reaction? heat H- -H Provide the major product for the following reaction? 1) Hg(OAc)2, H20/TH 2) NABH4 н- H Provide the major product for the following reaction? (1) BH3, ether HO-0H (2) Provide the major product for the following reaction? (1) BH3, ether (2) H202 OH
1) R'-MgBr in THF 2)H,o NaH Ho or OH PAA X2. H20 1) Hg(OAc)2, R'OH 2) NaBH4, NaOH, H20 Os0 NaHSO, H2O I) 2)CH, SCH HyIO HBr ROOR 1)BH3. THF 2)H202, NaOH, H2O Mg, THF PBr3 NaOH )OTHF 2) H30 CrOj. H,SO, 1) NaH 2)RXDMF "О-R DMF PCC DCM ) THF 2) H3O+ SOCI pyridine Li Hexanes
Structure Analysis Provide the major product for the following reactions: 1. BH, THF 2. H2O2.NaOH Os04 NMO THF/H20 1. NaNH2 2. H20 HOSO, H2SO4 но 13. For one of the following reaction, provide a complete and detailed electron pushing mechanism accounting for the product that is obtained/indicated. Only one reaction mechanism will be graded. Use proper arrows. HB
20. Provide the reagents necessary to complete the following the following transformation. A. 1. BH3 THF2. H2O2. HO- B. H20, H2SO4 C. OsO4 H202 D. CH3CO3H E. 1. CH3CO3H 2. H, H20 21. Provide the major organic product of the reaction below. 10. 2. (CHS uraw the major organic product generated in the reaction below. Pay particular attention to and stereochemical detail. CH3 CH, KMnO4 (warm, conc.) CH, H 23. Give the structure of the alkene which would yield the...
Provide the product you'd expect from the following reaction? OH SOCIL pyridine Draw the allylic radical intermediates you would expect to form as intermediates in the following reaction NBS "Вг + hv "Вr Predict the product(s) you'd expect when the following molecule is treated with NBS and irradiated with UV light? Draw all possible monochlorinated products you'd expect upon treating cyclohexane with Cl2 and irradiated with UV light. Draw all possible monochlorinated products you'd expect upon treating 2-methylbutane with Cl2...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago