Homework Answers
Add Answer to:
3. What is necessary for an intermolecular hydrogen bond? 4. What intermolecular forces are found in...
no intermolecular forces in this substance Question 2 Which of the following compounds will hydrogen bond...
no intermolecular forces in this substance Question 2 Which of the following compounds will hydrogen bond with water (HO)? Select all that apoly 0 Cala НЕ CH₂O HCN Question 3 Which of the following will have the highest boiling point?
2. Identify the strongest type of intermolecular forces in acetone, ethanol, water and hexane. (Structures listed...
2. Identify the strongest type of intermolecular forces in acetone, ethanol, water and hexane. (Structures listed on page 15.) Experiment 2 Intermolecular Forces There are three general types of intermolecular forces. All substances exhibit London Dispersion Forces (LDF), and they are generally the weakest of the three types. These London forces are due to the attractions between small, temporary dipoles that arise from the constant, random movement of the electrons in a substance. As molar mass increases, the size of...
3. Circle the hydrogen-bond donors and acceptors present in the following molecule. Draw the possible hydrogen...
3. Circle the hydrogen-bond donors and acceptors present in the following molecule. Draw the possible hydrogen bonding with two molecules of A. HO OH A 4. What is the strongest intermolecular attractive force between compound A and compound B? Use the structures of A and B to show the intermolecular forces between them. CH3 B A
A 13. (a) Which would have the stronger intermolecular force, CHA or Cla? Briefly explain your...
A 13. (a) Which would have the stronger intermolecular force, CHA or Cla? Briefly explain your answer. V (b) CHa boils at 111 k while Cola boils at 350 K. Does this data support or contradict your answer to part (a)? Briefly explain eng point 14. Why does ethane (CH) have a higher boiling point (184 K) than methane (CH 111 K)? 163 Model III: Another set of boiling point data Substance Boiling point Boiling point HF Substance HO H...
identfiy the predominant intermolecular forces in each of the given substance Ionic interactions hydrogen bonding van...
identfiy the predominant intermolecular forces in each of the given
substance
Ionic interactions
hydrogen bonding
van der waals interactions
Answer Bank KCI NH, CH П н, сн, Н,0 но СН3СНОН H. Urea is an organic compound widely used as a fertilizer. Its solubility in water allows it to be made into aqueous fertilizer solutions and applied to crops in a spray. What is the maximum theoretical number of water molecules that one urea molecule can hydrogen bond with? Ignore shape...
Classify each substance based on the intermolecular forces present in that substance. Dispersion only Dipole-dipole and...
Classify each substance based on the intermolecular forces present in that substance. Dispersion only Dipole-dipole and dispersion only Hydrogen bonding, dipole-dipole, and dispersion Answer Bank CH,C H2o CH co Match each property of a liquid to what it indicates about the relative strength of the intermolecular forces in that liquid. Weak intermolecular forces Strong intermolecular forces high surface tension high vapor pressure high boiling point high viscosity Answer Bank
What type(s) of intermolecular forces are expected between SO2Cl2 molecules? ball & stick V - labels...
What type(s) of intermolecular forces are expected between SO2Cl2 molecules? ball & stick V - labels Indicate with a Y (yes) or an N (no) which apply. dipole forces induced dipole forces hydrogen bonding What type(s) of intermolecular forces are expected between PC13 molecules? Choose all that apply dispersion hydrogen bonding dipole-dipole ion-ion What type(s) of intermolecular forces are expected between H20 molecules? ball & stick v + labels Indicate with a Y (yes) or an N (no) which apply....
Q3: Unit 9 & 10 Consider the compound IFCI,. What intermolecular forces are found betu en...
Q3: Unit 9 & 10 Consider the compound IFCI,. What intermolecular forces are found betu en molecules of IFCI,? And what is the f mal charge of one molecule of IFCI, A. London Dispersion Forces (LDF) Only: FC = -1 B. LDF & Dipole-Dipole (D-D) Forces: FC = 0 C. LDF, D-D, & Hydrogen Bonding (H-Bond): FC = 1 D. LDF, D-D, H-Bond, & Covalent Bonding: FC = 0 EG: Trigonal bipyramidal MG: T-shaped
Order the three types of intermolecular forces: dipole-dipole, London force, hydrogen bonds in terms of strength...
Order the three types of intermolecular forces: dipole-dipole, London force, hydrogen bonds in terms of strength from weakest to strongest. Give a brief description of each of the different intermolecular forces. Question 24 (6 points) The boiling points for H2O (BP = 100°C) and HS (BP-60°C) are drastically different despite oxygen and sulfur being next to each other on the periodic table. Explain these differences in boiling points utilizing your labels of intermolecular forces and the relative strength of the...
INTERMOLECULAR FORCES INTRODUCTION LEARNING OBJECTIVES To relate the effecet of intermolecular fo...
INTERMOLECULAR FORCES INTRODUCTION LEARNING OBJECTIVES To relate the effecet of intermolecular forces on relative melting points and vapour pressures of some organic substances THEORY Weak attractive forces that occur between individual molecules in substances are called intermolecular forces. These include London dispersion forces, dipole-dipole forces and hydrogen-bonding forces. Collectively, the three types of intermolecular forces are referred to as Van der Waals forces. These attractive forces are much weaker than the chemical bonds between atoms in a molecule. Note that...
no intermolecular forces in this substance Question 2 Which of the following compounds will hydrogen bond with water (HO)? Select all that apoly 0 Cala НЕ CH₂O HCN Question 3 Which of the following will have the highest boiling point?
2. Identify the strongest type of intermolecular forces in acetone, ethanol, water and hexane. (Structures listed on page 15.) Experiment 2 Intermolecular Forces There are three general types of intermolecular forces. All substances exhibit London Dispersion Forces (LDF), and they are generally the weakest of the three types. These London forces are due to the attractions between small, temporary dipoles that arise from the constant, random movement of the electrons in a substance. As molar mass increases, the size of...
3. Circle the hydrogen-bond donors and acceptors present in the following molecule. Draw the possible hydrogen bonding with two molecules of A. HO OH A 4. What is the strongest intermolecular attractive force between compound A and compound B? Use the structures of A and B to show the intermolecular forces between them. CH3 B A
A 13. (a) Which would have the stronger intermolecular force, CHA or Cla? Briefly explain your answer. V (b) CHa boils at 111 k while Cola boils at 350 K. Does this data support or contradict your answer to part (a)? Briefly explain eng point 14. Why does ethane (CH) have a higher boiling point (184 K) than methane (CH 111 K)? 163 Model III: Another set of boiling point data Substance Boiling point Boiling point HF Substance HO H...
identfiy the predominant intermolecular forces in each of the given
substance
Ionic interactions
hydrogen bonding
van der waals interactions
Answer Bank KCI NH, CH П н, сн, Н,0 но СН3СНОН H. Urea is an organic compound widely used as a fertilizer. Its solubility in water allows it to be made into aqueous fertilizer solutions and applied to crops in a spray. What is the maximum theoretical number of water molecules that one urea molecule can hydrogen bond with? Ignore shape...
Classify each substance based on the intermolecular forces present in that substance. Dispersion only Dipole-dipole and dispersion only Hydrogen bonding, dipole-dipole, and dispersion Answer Bank CH,C H2o CH co Match each property of a liquid to what it indicates about the relative strength of the intermolecular forces in that liquid. Weak intermolecular forces Strong intermolecular forces high surface tension high vapor pressure high boiling point high viscosity Answer Bank
What type(s) of intermolecular forces are expected between SO2Cl2 molecules? ball & stick V - labels Indicate with a Y (yes) or an N (no) which apply. dipole forces induced dipole forces hydrogen bonding What type(s) of intermolecular forces are expected between PC13 molecules? Choose all that apply dispersion hydrogen bonding dipole-dipole ion-ion What type(s) of intermolecular forces are expected between H20 molecules? ball & stick v + labels Indicate with a Y (yes) or an N (no) which apply....
Q3: Unit 9 & 10 Consider the compound IFCI,. What intermolecular forces are found betu en molecules of IFCI,? And what is the f mal charge of one molecule of IFCI, A. London Dispersion Forces (LDF) Only: FC = -1 B. LDF & Dipole-Dipole (D-D) Forces: FC = 0 C. LDF, D-D, & Hydrogen Bonding (H-Bond): FC = 1 D. LDF, D-D, H-Bond, & Covalent Bonding: FC = 0 EG: Trigonal bipyramidal MG: T-shaped
Order the three types of intermolecular forces: dipole-dipole, London force, hydrogen bonds in terms of strength from weakest to strongest. Give a brief description of each of the different intermolecular forces. Question 24 (6 points) The boiling points for H2O (BP = 100°C) and HS (BP-60°C) are drastically different despite oxygen and sulfur being next to each other on the periodic table. Explain these differences in boiling points utilizing your labels of intermolecular forces and the relative strength of the...
INTERMOLECULAR FORCES INTRODUCTION LEARNING OBJECTIVES To relate the effecet of intermolecular forces on relative melting points and vapour pressures of some organic substances THEORY Weak attractive forces that occur between individual molecules in substances are called intermolecular forces. These include London dispersion forces, dipole-dipole forces and hydrogen-bonding forces. Collectively, the three types of intermolecular forces are referred to as Van der Waals forces. These attractive forces are much weaker than the chemical bonds between atoms in a molecule. Note that...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 15 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago