Homework Answers
1. Here the mechanism proceeds by proton donor, since H2SO4 is stronger acid than HNO3. SO, NO2+, will form more easily.
Add Answer to:
Organic Chemistry Nitration lab. 1. Aromatic nitration requires the use of the HNO3 / H2SO4 mixture....
Post Lab Questions for Nitration of Acetanilide, Nitration of Methyl Benzoate, Nitration of Phenylacetonitrile, Nitration of...
Post Lab Questions for Nitration of Acetanilide, Nitration of Methyl Benzoate, Nitration of Phenylacetonitrile, Nitration of Phenol. 1. What product(s) do you expect to be formed in the nitration of phenol? Why? 2. All three of the nitrophenols have boiling points well above 200°C. Explain clearly why it was possible to distill something with such a high boiling point when the temperature of the distillate never rose much above 100°C. 3. What product did you actually obtain in the distillate?...
Help！！！！！！ Aromatic Nitration QUESTIONS 1 Which compound in each of the following pairs is more reactive...
Help！！！！！！
Aromatic Nitration QUESTIONS 1 Which compound in each of the following pairs is more reactive towards aromatic nitration? Expl your answers. a. phenol or nitrobenzene b. methyl benzoate or phenol c. nitrobenzene or methyl benzoate d. benzene or toluene 2. Show all possible mononitration products of toluene. Do you think it would be easy to isolate and identify all of them if each is produced in some amount? PRELABORATORY QUESTIONS 1. Lis three different combinations of reagents used for...
1-3? e-Laboratory Questions-Expa XP 3 Name: Nitration of Aromatic Compounds Due before lab begins. Answer in...
1-3?
e-Laboratory Questions-Expa XP 3 Name: Nitration of Aromatic Compounds Due before lab begins. Answer in space provided. 1. Which is nitrated faster? toluene or nitrobenzene? Explain. 2. Indicate the product formed on (mono) nitration of each of the following compounds: a) Cyanobenzene (benzonitrile) b) toluene c) benzoic acid 3. Why is methyl m-nitrobenzoate formed in this reaction instead of o- and p-? What product would you expect if methyl benzoate underwent dinitration? 4. Methyl-m-nitrobenzoate is an excellent (identification) derivative...
3-5?? e-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: tso ds Due before lab begins. Answer...
3-5??
e-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: tso ds Due before lab begins. Answer in space provided. 1. Which is nitrated faster? toluene or nitrobenzene? Explain. 2. Indicate the product formed on (mono) nitration of each of the following compounds: a) Cyanobenzene (benzonitrile) b) toluene c) benzoic acid. 3. Why is methyl m-nitrobenzoate formed in this reaction instead of o- and p-? What product would you expect if methyl benzoate underwent dinitration? 4. Methyl-m-nitrobenzoate is an excellent (identification)...
Nil 1. Which of the following compounds is least reactive by electrophilic aromatic nitration or sulfonation?...
Nil 1. Which of the following compounds is least reactive by electrophilic aromatic nitration or sulfonation? Briefly explain why. 2. Give the major product(s) of the following SpAr reactions. For an o-/p-director, show both products. If no reaction occurs, state why the reaction does not occur. CO,H HNO, H2SO4 +CH.CLAICH SOH Zn(Hg) AICI ? HỌC-CH-C-Cl + HCI/Heat CH3
Nitration of Methylbenzoate. Lab 1 6. Why is it important to maintain the reaction temperature low...
Nitration of Methylbenzoate. Lab 1 6. Why is it important to maintain the reaction temperature low and the addition of nitric acid-sulfuric acid mixture carried out slowly? 8. Which ring of phenyl benzoate would you expect to undergo nitration more easily? Explain. 9. Which is nitrated faster, toluene or phenol? Explain. phenol or nitrobenzene methyl benzoate or phenol nitrobenzene or methyl benzoate benzene or toluene 10. Show all mono, di and trinitration products of toluene. Do you think the mononitration...
numbers 1-3 Post-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: Due after completing the lab. 1....
numbers 1-3
Post-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: Due after completing the lab. 1. Why is concentrated sulfuric acid emploved in thie on? What is the electrophile that is produced by the reaction of sulfuric acid and nitric acid? 2. Why is it important to maintain the reaction temperature low and the addition of nitric acid-sulfuric acid mixture carried out slowly? 3. Explain why concentrated H2SO4, not concentrated HC1, was used in this experiment? 4. Which ring of...
3-5 pls Post-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: Due after completing the lab. 1....
3-5 pls
Post-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: Due after completing the lab. 1. Why is concentrated sulfuric acid employed in this reaction? What is the electrophile that is produced by the reaction of sulfuric acid and nitric acid? 2. Why is it important to maintain the reaction temperature low and the addition of nitric acid-sulfuric acid mixture carried out slowly? 3. Explain why concentrated H2SO, not concentrated HCl, was used in this experiment? 4. Which ring of...
Organic chemistry lab on Oxidation Puzzle Sample Questions 1. 2. 4. Write a mechanism for the...
Organic chemistry lab on Oxidation Puzzle
Sample Questions 1. 2. 4. Write a mechanism for the reaction of 2-butanol with sodium hypochlorite in an acetic acid solution. Provide two disadvantages associated with using dichromate for the process of oxidation (i.e. justify why you will be using NaOCl instead of dichromate). What is the purpose of adding NaHSO, solution to the reaction? Draw all of the possible products which could form if two equivalents of NaOCI are used in the oxidation...
Reaction 1: Nitration HNO3 NO2 H2SO4, H20 NO2 toluene NO2 ortho meta para Procedure for Reaction...
Reaction 1: Nitration HNO3 NO2 H2SO4, H20 NO2 toluene NO2 ortho meta para Procedure for Reaction 1: 1) To a stirred solution of 3 mL (44.7 mmoles) 67 % HNO3 in 3.75 mL of water, H2SO4 (9 mL) was slowly added at 10-15 °C. 2) This nitrating solution was added dropwise with vigorous stirring to 4 mL (37.5 mmoles) of toluene while cooling in ice-water in order to maintain the reaction temperature between 15 and 25 °C. 3) Stirring was...
Help！！！！！！
Aromatic Nitration QUESTIONS 1 Which compound in each of the following pairs is more reactive towards aromatic nitration? Expl your answers. a. phenol or nitrobenzene b. methyl benzoate or phenol c. nitrobenzene or methyl benzoate d. benzene or toluene 2. Show all possible mononitration products of toluene. Do you think it would be easy to isolate and identify all of them if each is produced in some amount? PRELABORATORY QUESTIONS 1. Lis three different combinations of reagents used for...
1-3?
e-Laboratory Questions-Expa XP 3 Name: Nitration of Aromatic Compounds Due before lab begins. Answer in space provided. 1. Which is nitrated faster? toluene or nitrobenzene? Explain. 2. Indicate the product formed on (mono) nitration of each of the following compounds: a) Cyanobenzene (benzonitrile) b) toluene c) benzoic acid 3. Why is methyl m-nitrobenzoate formed in this reaction instead of o- and p-? What product would you expect if methyl benzoate underwent dinitration? 4. Methyl-m-nitrobenzoate is an excellent (identification) derivative...
3-5??
e-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: tso ds Due before lab begins. Answer in space provided. 1. Which is nitrated faster? toluene or nitrobenzene? Explain. 2. Indicate the product formed on (mono) nitration of each of the following compounds: a) Cyanobenzene (benzonitrile) b) toluene c) benzoic acid. 3. Why is methyl m-nitrobenzoate formed in this reaction instead of o- and p-? What product would you expect if methyl benzoate underwent dinitration? 4. Methyl-m-nitrobenzoate is an excellent (identification)...
Nil 1. Which of the following compounds is least reactive by electrophilic aromatic nitration or sulfonation? Briefly explain why. 2. Give the major product(s) of the following SpAr reactions. For an o-/p-director, show both products. If no reaction occurs, state why the reaction does not occur. CO,H HNO, H2SO4 +CH.CLAICH SOH Zn(Hg) AICI ? HỌC-CH-C-Cl + HCI/Heat CH3
numbers 1-3
Post-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: Due after completing the lab. 1. Why is concentrated sulfuric acid emploved in thie on? What is the electrophile that is produced by the reaction of sulfuric acid and nitric acid? 2. Why is it important to maintain the reaction temperature low and the addition of nitric acid-sulfuric acid mixture carried out slowly? 3. Explain why concentrated H2SO4, not concentrated HC1, was used in this experiment? 4. Which ring of...
3-5 pls
Post-Laboratory Questions-EXP 3 Nitration of Aromatic Compounds Name: Due after completing the lab. 1. Why is concentrated sulfuric acid employed in this reaction? What is the electrophile that is produced by the reaction of sulfuric acid and nitric acid? 2. Why is it important to maintain the reaction temperature low and the addition of nitric acid-sulfuric acid mixture carried out slowly? 3. Explain why concentrated H2SO, not concentrated HCl, was used in this experiment? 4. Which ring of...
Organic chemistry lab on Oxidation Puzzle
Sample Questions 1. 2. 4. Write a mechanism for the reaction of 2-butanol with sodium hypochlorite in an acetic acid solution. Provide two disadvantages associated with using dichromate for the process of oxidation (i.e. justify why you will be using NaOCl instead of dichromate). What is the purpose of adding NaHSO, solution to the reaction? Draw all of the possible products which could form if two equivalents of NaOCI are used in the oxidation...
Reaction 1: Nitration HNO3 NO2 H2SO4, H20 NO2 toluene NO2 ortho meta para Procedure for Reaction 1: 1) To a stirred solution of 3 mL (44.7 mmoles) 67 % HNO3 in 3.75 mL of water, H2SO4 (9 mL) was slowly added at 10-15 °C. 2) This nitrating solution was added dropwise with vigorous stirring to 4 mL (37.5 mmoles) of toluene while cooling in ice-water in order to maintain the reaction temperature between 15 and 25 °C. 3) Stirring was...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 25 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago