Homework Answers
Add Answer to:
The standard potential for the cell Cl2(g) + Cu(s) CuCl2(aq) is +1.02 V. Determine the potential...
The standard potential for the cell Cl2(g) + Cu(s) ⇔ CuCl2(aq) is +1.02 V. Determine the...
The standard potential for the cell Cl2(g) + Cu(s) ⇔ CuCl2(aq) is +1.02 V. Determine the potential of the cell at 298 K when the partial pressure of chlorine gas is 0.100 bar and the concentration of copper(II) chloride is 0.017 mol dm-3.
Consider the following cell reaction at 18°C: Ca(e)+Cu+ (aq) + Ca2+ (aq) + Cu() Calculate the...
Consider the following cell reaction at 18°C: Ca(e)+Cu+ (aq) + Ca2+ (aq) + Cu() Calculate the standard cell potential of this cell from the standard electrode potentials, and from this, obtain AG" for the cell reaction. Calculate AF. Use these values of AN and AG to obtain AS for the cell reaction. Ca²+ (aq) +20 + Ca() --2.76 V Cu? (g) +20 + Cu(s) - 0.84 V AH;(O.*()) -- 542.8 kJ/mol AH;(Out (as)) - 64.8 kJ/mol V AG- AH- kJ...
5. Consider the galvanic cell, Pb(s) Pb(aq) || Cu(aq) Cu(s) What should be done to increase...
5. Consider the galvanic cell, Pb(s) Pb(aq) || Cu(aq) Cu(s) What should be done to increase the cell potential (i.e., become more positive)? Be specific when stating which concentration should be increased or decreased. 6. Calculate the cell potential (Ecell) at 25°C for the cell Fe(s) / (Fe*(0.100 M) || Pd**(1.0 * 10M) | Pd(s) Given that the standard reduction potential for Fe* /Fe is -0.45 V and for Pd/Pd is +0.95 V. 8. Balance the following reduction-oxidation reaction in...
V. Concentration Cell Copper - Copper Cy(s), CuCl2 (0.01) || Cu(s), CuCl2 (1.0 M) 1. Draw...
V. Concentration Cell Copper - Copper Cy(s), CuCl2 (0.01) || Cu(s), CuCl2 (1.0 M) 1. Draw the schematic of the electrochemical cell that includes all the components (metals, solutions, salt bridges, voltmeters, etc.). Annotate on the schematic which side is the anode, which side is the cathode, the sign of each half cell, the composition of the metals and solutions, and the direction of the flow of the electrons through the cell. 2. Write the half reactions that occur at...
The standard cell potential of the following cell: M(s) IM(aq)Il Cu (aq) I Cu(s) is +1.28...
The standard cell potential of the following cell: M(s) IM(aq)Il Cu (aq) I Cu(s) is +1.28 V at 25°C. a) Calculate the standard reduction potential for the redox couple, M(s)/M"(aą). b) Identify the metal M. c) Write the cell notation for this Voltaic cell
For the reaction 2Co3+(aq)+2Cl−(aq)→2Co2+(aq)+Cl2(g). E∘=0.483 V what is the cell potential at 25 ∘C if the...
For the reaction
2Co3+(aq)+2Cl−(aq)→2Co2+(aq)+Cl2(g). E∘=0.483 V what is the cell
potential at 25 ∘C if the concentrations are [Co3+]= 0.628 M ,
[Co2+]= 1.40×10−2 M , and [Cl−]= 0.652 M , and the pressure of Cl2
is PCl2= 7.80 atm ? Express your answer with the appropriate
units.
- Part A For the reaction 2CO3+ (aq) + 2CT (aq)+2Co2+ (aq) + Cl2(g). E=0.483 V what is the cell potential at 25°C if the concentrations are Co3+1 = 0.628 M, Co2+1...
1) Calculate the cell potential, E°cell, for the following electrochemical reaction. Cu(s) + I2(g) → Cu+2(aq)...
1) Calculate the cell potential, E°cell, for the following electrochemical reaction. Cu(s) + I2(g) → Cu+2(aq) + 2I-1(aq) E = ? a.-0.87 V b.-0.19 V c.0.19 V d.0.87 V 2) Calculate the equilibrium constant (Keq) for the following reaction at 25 °C? (Faraday's Constant = 96,500 J / V · mol) & (R = 8.314 J / mol · K) 2Fe+3(aq) + Sn+2(aq) → 2Fe+2(aq) + Sn+4(aq) K = ? a. 4.04 x 107 b. 3.44 x 1018 c. 4.48...
Determine the Cell potential for Cr(3+)(aq) + Cl2(aq) --> Cr2O7(2-)(aq) + Cl-(aq). Assume 1.0 M and...
Determine the Cell potential for Cr(3+)(aq) + Cl2(aq) --> Cr2O7(2-)(aq) + Cl-(aq). Assume 1.0 M and all partial pressures are 1.0 atm. a. 0.06 V b. 1.50 V c. 0.03 V Determine the Cell potential for Cu(2+)(aq) + Mg(s) --> Mg(2+)(aq) + Cu(s) a. 8.83 V b. 2.71 V c. 4.45 V Suppose you had a container with 3 separate bulbs filled with a gaseous compound. For this particular experiment you have 10 molecules filling the flask. What is the...
Determine the Cell potential for Cr(3+)(aq) + Cl2(aq) --> Cr2O7(2-)(aq) + Cl-(aq). Assume 1.0 M and...
Determine the Cell potential for Cr(3+)(aq) + Cl2(aq) --> Cr2O7(2-)(aq) + Cl-(aq). Assume 1.0 M and all partial pressures are 1.0 atm. a. 0.06 V b. 1.50 V c. 0.03 V Determine the Cell potential for Cu(2+)(aq) + Mg(s) --> Mg(2+)(aq) + Cu(s) a. 8.83 V b. 2.71 V c. 4.45 V Suppose you had a container with 3 separate bulbs filled with a gaseous compound. For this particular experiment you have 10 molecules filling the flask. What is the...
For the reaction 2Co3+(aq)+2Cl−(aq)→2Co2+(aq)+Cl2(g). E∘=0.483 V what is the cell potential at 25 ∘C if the...
For the reaction 2Co3+(aq)+2Cl−(aq)→2Co2+(aq)+Cl2(g). E∘=0.483 V what is the cell potential at 25 ∘C if the concentrations are [Co3+]= 0.614 M , [Co2+]= 0.508 M , and [Cl−]= 0.321 M , and the pressure of Cl2 is PCl2= 7.90 atm ?
Consider the following cell reaction at 18°C: Ca(e)+Cu+ (aq) + Ca2+ (aq) + Cu() Calculate the standard cell potential of this cell from the standard electrode potentials, and from this, obtain AG" for the cell reaction. Calculate AF. Use these values of AN and AG to obtain AS for the cell reaction. Ca²+ (aq) +20 + Ca() --2.76 V Cu? (g) +20 + Cu(s) - 0.84 V AH;(O.*()) -- 542.8 kJ/mol AH;(Out (as)) - 64.8 kJ/mol V AG- AH- kJ...
5. Consider the galvanic cell, Pb(s) Pb(aq) || Cu(aq) Cu(s) What should be done to increase the cell potential (i.e., become more positive)? Be specific when stating which concentration should be increased or decreased. 6. Calculate the cell potential (Ecell) at 25°C for the cell Fe(s) / (Fe*(0.100 M) || Pd**(1.0 * 10M) | Pd(s) Given that the standard reduction potential for Fe* /Fe is -0.45 V and for Pd/Pd is +0.95 V. 8. Balance the following reduction-oxidation reaction in...
The standard cell potential of the following cell: M(s) IM(aq)Il Cu (aq) I Cu(s) is +1.28 V at 25°C. a) Calculate the standard reduction potential for the redox couple, M(s)/M"(aą). b) Identify the metal M. c) Write the cell notation for this Voltaic cell
For the reaction
2Co3+(aq)+2Cl−(aq)→2Co2+(aq)+Cl2(g). E∘=0.483 V what is the cell
potential at 25 ∘C if the concentrations are [Co3+]= 0.628 M ,
[Co2+]= 1.40×10−2 M , and [Cl−]= 0.652 M , and the pressure of Cl2
is PCl2= 7.80 atm ? Express your answer with the appropriate
units.
- Part A For the reaction 2CO3+ (aq) + 2CT (aq)+2Co2+ (aq) + Cl2(g). E=0.483 V what is the cell potential at 25°C if the concentrations are Co3+1 = 0.628 M, Co2+1...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 36 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago