Homework Answers
Add Answer to:
Question Completion Status: QUESTION 28 1. An enzyme increases the rate of a biological process in...
12.) Which of the following factors influence the rate of a reaction? A) Temperature B) Reactant...
12.) Which of the following factors influence the rate of a reaction? A) Temperature B) Reactant concentration C) A catalyst D) Temperature, reactant concentration, and a catalyst 13.) A fast reaction rate for a chemical reaction is dependent on: A) having a large activation energy B) having a small activation energy C) being exothermic D) being endothermic 14.)) A catalyst is A) a substance that decreases the energy of the products. B) a product in a chemical reaction. c) a...
Question 12 How does an enzyme work to catalyze a reaction? -It lowers the activation energy...
Question 12 How does an enzyme work to catalyze a reaction? -It lowers the activation energy of a reaction. -It raises the temperature of a reaction. -It supplies the energy to speed up a reaction. -It increases the concentration of the reactants in a reaction. -It allows the reaction to proceed through different intermediates.
(6.4) The rate of a chemical reaction increases with an increase in the concentration of one...
(6.4) The rate of a chemical reaction increases with an increase in the concentration of one or more reactants. This is best explained by which statement? Select one: a. The higher concentration of reactants increases the activation energy of the reaction. Ob. The higher concentration of reactants increases the potential energy of the molecules. c. The higher concentration of reactants increases the frequency of collisions between molecules. d. The higher concentration of reactants increases the temperature of the molecules. Check...
29 (6 pts) How do concentration of reactants, temperature and catalysts affect the rate of a chemical reaction? Exp...
29 (6 pts) How do concentration of reactants, temperature and catalysts affect the rate of a chemical reaction? Explain. Concentration of reactants: mcreases more collisions within the reactants. collisions Temperature: Increase in temperature causes increase in more and more energy in collisions. (increases rate? Catalyst: Lowens energy of activation of reactants cate? (increases rutes
ory Window Help ¥ Question Completion Status: QUESTION 4 The graph represents the amount of product...
ory Window Help ¥ Question Completion Status: QUESTION 4 The graph represents the amount of product created in a reaction aided by one of two enzymes. [Enzyme A is represented by the line mostly on top and Enzyme B is represented by the line with the sharper peakJ What is a possible hypothesls for the investigation portrayed in this scenario? 12 10 -....Enzyme A -Enzyme B 0 5 10 15 20 25 30 35 40 45 50 56 60 65...
QUESTION 28 Among the following statements concerning the enzymes, all correct answers An apoenzyme consists of...
QUESTION 28 Among the following statements concerning the enzymes, all correct answers An apoenzyme consists of a holoenzyme and a.coenzyme Enzymes are biological catalysts that do not affect the reaction equilibrium The rate of reaction depends on the pH The catalytic site is formed of an active site and binding sites The activation energy of the uncatalyzed reaction is greater than the activation energy of the catalyzed reaction QUESTION 29 Which of the following statements are corrects? When the substrate...
Question Completion Status: QUESTION 5 Reaction coordinates describe the chemical pathway of a reaction. They indicate...
Question Completion Status: QUESTION 5 Reaction coordinates describe the chemical pathway of a reaction. They indicate thermodynamic favorability, equilibrium distribution of reactants and products, and relative rates at which reactions proceed. Evaluate the following reaction coordinates and rank them according to the properties of the reaction. Assume equivalence of Y axes for the two different curves. k1 reaction S P k-1 ighest/most positive [P]/IS] at equilibrium change in free energy (40) activation energy for forward rxn rate constant (k) for...
1. What is AG at 25 °C (298 K) for the reaction below? Show your answer...
1. What is AG at 25 °C (298 K) for the reaction below? Show your answer with four significant figures Cs) + 026) CO268 AH=-393.5 kJ/mol AS=0.0029 kJ/mol K 2. A certain reaction has AH = 10.3 kJ/mol and AS = 42.7J/K-mol. Calculate AG in kJ/mol at 338 K. Show your answer with four significant figures 3. Consider the following potential energy diagram that represents two different reactions. Which reaction is spontaneous? Which reaction is faster? Reaction A Reaction B...
7. An increase in the temperature of the reactants causes an increase in the rate of...
7. An increase in the temperature of the reactants causes an increase in the rate of reaction. The best explanation for this behavior is that as the temperature increases, a. the fraction of collisions with total kinetic energy greater than Ea increases. b. the concentration of reactants increases. c. the activation energy remains the same. d. the collision frequency decrease
a- In the induced-fit model of enzyme action, a _______ must bind to the enzyme's______ for...
a- In the induced-fit model of enzyme action, a _______ must bind to the enzyme's______ for the enzyme to perform its function. (A) catalyst; activation energy (B) product; catalytic site (C) product; active site (D) water molecule; allosteric site (E) substrate; active site b- Which of the following is CORRECT for an exergonic reaction? (A) more activation energy is needed than for an endergonic reaction (B) less activation energy is needed than for an endergonic reaction (C) products have more...
12.) Which of the following factors influence the rate of a reaction? A) Temperature B) Reactant concentration C) A catalyst D) Temperature, reactant concentration, and a catalyst 13.) A fast reaction rate for a chemical reaction is dependent on: A) having a large activation energy B) having a small activation energy C) being exothermic D) being endothermic 14.)) A catalyst is A) a substance that decreases the energy of the products. B) a product in a chemical reaction. c) a...
(6.4) The rate of a chemical reaction increases with an increase in the concentration of one or more reactants. This is best explained by which statement? Select one: a. The higher concentration of reactants increases the activation energy of the reaction. Ob. The higher concentration of reactants increases the potential energy of the molecules. c. The higher concentration of reactants increases the frequency of collisions between molecules. d. The higher concentration of reactants increases the temperature of the molecules. Check...
29 (6 pts) How do concentration of reactants, temperature and catalysts affect the rate of a chemical reaction? Explain. Concentration of reactants: mcreases more collisions within the reactants. collisions Temperature: Increase in temperature causes increase in more and more energy in collisions. (increases rate? Catalyst: Lowens energy of activation of reactants cate? (increases rutes
ory Window Help ¥ Question Completion Status: QUESTION 4 The graph represents the amount of product created in a reaction aided by one of two enzymes. [Enzyme A is represented by the line mostly on top and Enzyme B is represented by the line with the sharper peakJ What is a possible hypothesls for the investigation portrayed in this scenario? 12 10 -....Enzyme A -Enzyme B 0 5 10 15 20 25 30 35 40 45 50 56 60 65...
QUESTION 28 Among the following statements concerning the enzymes, all correct answers An apoenzyme consists of a holoenzyme and a.coenzyme Enzymes are biological catalysts that do not affect the reaction equilibrium The rate of reaction depends on the pH The catalytic site is formed of an active site and binding sites The activation energy of the uncatalyzed reaction is greater than the activation energy of the catalyzed reaction QUESTION 29 Which of the following statements are corrects? When the substrate...
Question Completion Status: QUESTION 5 Reaction coordinates describe the chemical pathway of a reaction. They indicate thermodynamic favorability, equilibrium distribution of reactants and products, and relative rates at which reactions proceed. Evaluate the following reaction coordinates and rank them according to the properties of the reaction. Assume equivalence of Y axes for the two different curves. k1 reaction S P k-1 ighest/most positive [P]/IS] at equilibrium change in free energy (40) activation energy for forward rxn rate constant (k) for...
1. What is AG at 25 °C (298 K) for the reaction below? Show your answer with four significant figures Cs) + 026) CO268 AH=-393.5 kJ/mol AS=0.0029 kJ/mol K 2. A certain reaction has AH = 10.3 kJ/mol and AS = 42.7J/K-mol. Calculate AG in kJ/mol at 338 K. Show your answer with four significant figures 3. Consider the following potential energy diagram that represents two different reactions. Which reaction is spontaneous? Which reaction is faster? Reaction A Reaction B...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 51 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago