Homework Answers
Add Answer to:
1. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember...
2. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember...
2. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember to include stereochemistry if necessary. If you create a racemic mixture, draw BOTH enantiomers and write "Racemic" A) CI S-CH3 он Pyridine B) он H2SO4 C) он H2CrO4 D) PCC он E) HBr он 2of 4
5. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember...
5. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember to include stereochemistry if necessary. If you create a racemic mixture, draw an asterisk "*" at all chiral carbons and write "Racemic" A)CO OCH NaOH LDA 1. LDA 3. Acid W/up 1. LDA 3. Acid W/up 1. LDA CI 3. Acid W/up 1. LDA CI 3. Acid W/up
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. HI H) 1) CH3Li CrO3, H2SO4 1) H 2) H30+ H20 (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CHCI2 K) H2SO4, 1800C OH Nah, DMSO...
For each of the reactions supply the missing final major product(s) in the boxes provided. Clearly...
For each of the reactions supply the missing final major product(s) in the boxes provided. Clearly show stereochemisty where appropriate. If a reaction produces a mixture of enantiomers draw both. Supply the name of the mechanism (Sn1, Sn2, E1, E2) by which the requested reaction occurs by. NaOH 80 °C, H20 Mechanism ОН HCI 0°C, Ether ОН CrO3 H2SO4
1) For the following reactions, draw the product(s). Remember to keep in mind carbocation rearrangements, stereoselectivity...
1) For the following reactions, draw the product(s). Remember to keep in mind carbocation rearrangements, stereoselectivity (syn/anti addition) and racemic mixture of enantiomers due to formation of new chiral centers. h) Lindlar's catalyst excess CH3CH2C CH HCI H2O, H2S04 HgSo k) 1.9-BBN 2. H202. NaOH CH3CH2CH2-CEc-CH3 excess Ce CH3CH2CH2-CEC-CH3 CCI4 1 eq Br2 CCl 1. Оз 2. H20 n) o) H 1) NaNH2 H3C 2) CH3CH2CH2Br
Q 2 - Fill in the boxes with the product(s) for the following reactions. Draw only...
Q 2 - Fill in the boxes with the product(s) for the following reactions. Draw only the predominate regioisomer and indicate the stereochemistry where appropriate. If a racemic mixture is formed, you may indicate this using a wavy line www or mark the chiral center with an asterisk (*), and write racemic in the box. You may also draw both enantiomers and write RACEMIC in the box. 1.BH3 2, H2O2, NaOH 1. Hg(OAc), H20 2. NaBH4 H3C CH3 1.BH 2....
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following...
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. Ha, Pd/C Cl2, hv A) Br CH, OH B) CH3CH,CH, OH H2SO4 D) NaBH "H CH,CH, OH SOCI TEA OTS E) CH SNa DMSO...
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following...
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. Ha, Pd/C Cl2, hv A) Br CH, OH B) CH3CH,CH, OH H2SO4 D) NaBH "H CH,CH, OH SOCI TEA OTS E) CH SNa DMSO...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
2. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember to include stereochemistry if necessary. If you create a racemic mixture, draw BOTH enantiomers and write "Racemic" A) CI S-CH3 он Pyridine B) он H2SO4 C) он H2CrO4 D) PCC он E) HBr он 2of 4
5. (4 pts each) In the box provided, draw the product(s) of the reactions given. Remember to include stereochemistry if necessary. If you create a racemic mixture, draw an asterisk "*" at all chiral carbons and write "Racemic" A)CO OCH NaOH LDA 1. LDA 3. Acid W/up 1. LDA 3. Acid W/up 1. LDA CI 3. Acid W/up 1. LDA CI 3. Acid W/up
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. HI H) 1) CH3Li CrO3, H2SO4 1) H 2) H30+ H20 (xs) CI mCPBA (CH3)3COK J) (CH3)3COH CHCI2 K) H2SO4, 1800C OH Nah, DMSO...
1) For the following reactions, draw the product(s). Remember to keep in mind carbocation rearrangements, stereoselectivity (syn/anti addition) and racemic mixture of enantiomers due to formation of new chiral centers. h) Lindlar's catalyst excess CH3CH2C CH HCI H2O, H2S04 HgSo k) 1.9-BBN 2. H202. NaOH CH3CH2CH2-CEc-CH3 excess Ce CH3CH2CH2-CEC-CH3 CCI4 1 eq Br2 CCl 1. Оз 2. H20 n) o) H 1) NaNH2 H3C 2) CH3CH2CH2Br
Q 2 - Fill in the boxes with the product(s) for the following reactions. Draw only the predominate regioisomer and indicate the stereochemistry where appropriate. If a racemic mixture is formed, you may indicate this using a wavy line www or mark the chiral center with an asterisk (*), and write racemic in the box. You may also draw both enantiomers and write RACEMIC in the box. 1.BH3 2, H2O2, NaOH 1. Hg(OAc), H20 2. NaBH4 H3C CH3 1.BH 2....
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. Ha, Pd/C Cl2, hv A) Br CH, OH B) CH3CH,CH, OH H2SO4 D) NaBH "H CH,CH, OH SOCI TEA OTS E) CH SNa DMSO...
2. Reactions: (27 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state 'No Reaction'. Ha, Pd/C Cl2, hv A) Br CH, OH B) CH3CH,CH, OH H2SO4 D) NaBH "H CH,CH, OH SOCI TEA OTS E) CH SNa DMSO...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
3. Reactions: (21 pts) Draw the structure of the expected organic product(s) formed in the following reactions including correct stereochemistry, if the product is racemic indicate this by either drawing both enantiomers or drawing one and writing racemic. Assume all reagents listed are present in excess unless otherwise noted. If no reaction occurs, state ‘No Reaction'. HI H) 1) CHELI 2) H30 CrOg, H2SO4 H20 (xs) 1) mCPBA J) (CH3),COK (CH3)3COH CH,CI2 K) H2SO4 180°C OH L NaH, DMSO Br...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago