In the reaction scheme below, choose the appropriate starting material and nucleophile that will get you...
Determine the major organic product for the following reaction scheme. (If no reaction, draw the starting material.) 1. 2Li, Et, Hac HACCI 2. 0.5 equiv Cul 3. (CH),CH(CH), Br Hac
For each reaction scheme, propose a pathway to obtain the desired product from the indicated starting material, by filling in the missing intermediate products and reagents. OH Reagents to use for each step
What is the major product of the reaction scheme shown below? you think there is no reaction then draw the starting material. (No need to use wedges and hashes to show stereochemistry) CH,COZH ? What is the major product of the reaction scheme shown below ? If you think there is no reaction then draw the starting material. (No need to use wedges and hashes to show stereochemistry) Ph PCH, ? + Ph, po H What is the major product...
3) For each reaction below, indicate which starting material is the Nucleophile and which is the Electrophile. Show arrows to demonstrate how the transformation occurs. A) Putty » NH2 © NH2
For each scheme, propose a pathway to obtain the desired product from the indicated starting material, by filling in the missing intermediate products (stable enough to isolate and take a spectrum) and reagents. OH Reagents to use for each step C) C) o + en
can you please show how eaxh reagent affects the starting material to get to the product 1. EtMgBr, Et20 2. HBO NH a) NaOH b) 1-bromopropane c) HCI, H2O, A d) NaOH, H20 H₂N ONa ONa 1. DIBAL-H, -78 °C ОMe Et 2. MeOH, HCI Оме
starting with only 1-propanol as your ONLY organic starting material, come up with a reaction scheme to produce: CH3-CH2-C(=0)-O-CH2-CH2-CH3 As your final product Show all work
What starting material is required in order to complete the reaction scheme for the synthesis shown below? OCH3 1. Na 2. CH₂ Br CH₃ 7 I.NaNO2 / HCI 2. KI Product ? CH3 2 Br KMnO4 H₂o" heat CH3 1. HNO₃ H₂SO4 / heat 2. Sn / HCl 3. NaHCO₃
Cyclohexenone is a useful starting material for drug synthesis. For each reaction below, predict the major addition product for the reaction between an ?,?-unsaturated ketone and carbon nucleophile.
Cyclohexenone is a useful starting material for drug synthesis. For each reaction below, predict the major addition product for the reaction between an a,B-unsaturated ketone and carbon nucleophile. (1) (CH, CH, Culi (2) H* (1)CH,CH,MgBr (2) H