Homework Answers
Add Answer to:
Hydrochloric acid dissolves solid aluminium hydroxide. What is the
complete ionic equation of this reaction?
Im...
The molecular equation for the reaction of hydrochloric acid (HCI) and sodium hydroxide (NaOH) is, NaOH...
The molecular equation for the reaction of hydrochloric acid (HCI) and sodium hydroxide (NaOH) is, NaOH (aq.) + HCl (aq.) -NaCl (aq.) +H20 (1) The net ionic equation is: O NaOH(aq.) + HCl (aq.) →NaCl (aq.) + H2O(1) O Na+ (aq.) + OH- (aq.) + H+(aq.) + CI+ (aq.) → H2O(1) + Na+ (aq.) + OH"(aq.) O none of the above are correct. O H+ (aq.) + OH- (aq.) → H2O(1)
3. Which is the total ionic equation for the reaction of hydrochloric acid with solid chromium(II)...
3. Which is the total ionic equation for the reaction of hydrochloric acid with solid chromium(II) hydroxide? None of the products are solids. ( work on paper 1. 3H'(a)+31(aq)+Cr" (aq)+3OH(aq) - Cr"(aq)+31(aq)+3H.0(D) 2. 3H (agH3CH(aq)-CH(OH),(s) Cr" (aq)+31(aq)+3H,0(1) 3. 6H(aq)+6C1- (aq)+Cr,0,(s)-2Cr" (aq)+6C1(aq)+31,0(1) 4. 3HClaCrOH,(s)- Cr" (aq)+31(aq)+3H,0(1) 5. H(aq)+CH(aq)+CrOH,(s)--Cr" (aq)+Cl(aq)+2H,0(1) alege shown bene
answer both questions 11.(4pt) What is the net ionic equation for the reaction of hydrochloric acid...
answer both questions
11.(4pt) What is the net ionic equation for the reaction of hydrochloric acid with potassium hydroxide? A. HCl + KOH → H2O + KCI B. H+ + Cl, + K. + OH. → H2O + K. + Cl. C. H+OH-H20 12. (4pt) In the reaction C() + O2(g) →COvo carbon is- . A. the reducing agent B. the electron acceptor C. reduced D. the oxidizing agent
Combine 2 equations to obtain the third reaction equation
Reaction 1: Solid sodium hydroxide dissolves in water to form an aqueous solution of ions.NaOH(s) → Na+(aq) + OH–(aq) ΔH1 = ? Reaction 2: Solid sodium hydroxide reacts with aqueous hydrochloric acid to form water and an aqueous solution of sodium chloride.NaOH(s) + H+(aq) + Cl–(aq) → H2O(l) + Na+(aq) + Cl–(aq) ΔH2 = ? Reaction 3: Solutions of aqueous sodium hydroxide and hydrochloric acid react to form water and aqueous sodium chloride.Na+(aq) + OH–(aq) + H+(aq) + Cl–(aq) → H2O(l) + Na+(aq) +...
1) The net ionic equation for the reaction between aqueous nitric acid and aqueous sodium hydroxide...
1) The net ionic equation for the reaction between aqueous nitric acid and aqueous sodium hydroxide is A) H+ (aq) + HNO3 (aq) + 2OH- (aq) → 2H20 (1) + NO3- (aq) B) HNO3 (aq) + NaOH(aq) → NaNO3(aq) + H20 (1) C) H+ (aq) + OH- (aq) + H2O (1) D) HNO3 (aq) + OH- (aq) + NO3- (aq) + H2O (1) E) H+ (aq) + Na+ (aq) + OH- (aq) → H20 (1) + Na+ (aq) 2) Which...
9 > Question 39 (2 points) What is the net ionic equation for the reaction of...
9 > Question 39 (2 points) What is the net ionic equation for the reaction of hydrochloric acid with potassium hydroxide if the molecular equation is HCl(aq) + KOH(aq) – H00) + KCl(aq)? 12 HCI + KOH — H20 + KCI 15 2H+ +2C1- + K2+ + 2OH- H20+ K2+ +2 C1- 18 OH+ + Cl- + K+ + OH- H20+ K+ + Cl- H+ + OH- H20 Question 40 (2 points) Which of the following is NOT an example...
QUESTIONS What is the net ionic equation for the neutralization of hydrofluoric acid with sodium hydroxide?...
QUESTIONS What is the net ionic equation for the neutralization of hydrofluoric acid with sodium hydroxide? O HF(09) + NaOH(0) H20(1) - Na() Ob HP(0q) + OH 7) + H2F09)+02-700) OCHF(0) + OH 709) + H 200 ) +F709) Od (09) + OH 709) + H20) OCH (09) + NaOH(aq) + H200) Na (0) QUESTIONE What is the partial pressure of carbon dioxide in a container that contains 3 mol of oxyge, 2 mol of nitrogen, and 5 mol of...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
3. Suppose after adding HCl to ppt 16, you do not have any black solid. What,...
3. Suppose after adding HCl to ppt 16, you do not have any black solid. What, if anything, should you do to test for Co2 and Ni*? Qual Scheme: Group III: Co?(pink), N1" (green), Fet+ (yellow), Cr" (blue-grey), Mn(pink), AP (colorless), Zn? (colorless). Unknown B Solution: Use 10 dps of unknown sample and 10 dps of H20 and go to Procedure for Group III. Procedure for Group II: Add 2 dps NHCl soln, add 6M NHOH until just basic to...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction?...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
The molecular equation for the reaction of hydrochloric acid (HCI) and sodium hydroxide (NaOH) is, NaOH (aq.) + HCl (aq.) -NaCl (aq.) +H20 (1) The net ionic equation is: O NaOH(aq.) + HCl (aq.) →NaCl (aq.) + H2O(1) O Na+ (aq.) + OH- (aq.) + H+(aq.) + CI+ (aq.) → H2O(1) + Na+ (aq.) + OH"(aq.) O none of the above are correct. O H+ (aq.) + OH- (aq.) → H2O(1)
3. Which is the total ionic equation for the reaction of hydrochloric acid with solid chromium(II) hydroxide? None of the products are solids. ( work on paper 1. 3H'(a)+31(aq)+Cr" (aq)+3OH(aq) - Cr"(aq)+31(aq)+3H.0(D) 2. 3H (agH3CH(aq)-CH(OH),(s) Cr" (aq)+31(aq)+3H,0(1) 3. 6H(aq)+6C1- (aq)+Cr,0,(s)-2Cr" (aq)+6C1(aq)+31,0(1) 4. 3HClaCrOH,(s)- Cr" (aq)+31(aq)+3H,0(1) 5. H(aq)+CH(aq)+CrOH,(s)--Cr" (aq)+Cl(aq)+2H,0(1) alege shown bene
answer both questions
11.(4pt) What is the net ionic equation for the reaction of hydrochloric acid with potassium hydroxide? A. HCl + KOH → H2O + KCI B. H+ + Cl, + K. + OH. → H2O + K. + Cl. C. H+OH-H20 12. (4pt) In the reaction C() + O2(g) →COvo carbon is- . A. the reducing agent B. the electron acceptor C. reduced D. the oxidizing agent
1) The net ionic equation for the reaction between aqueous nitric acid and aqueous sodium hydroxide is A) H+ (aq) + HNO3 (aq) + 2OH- (aq) → 2H20 (1) + NO3- (aq) B) HNO3 (aq) + NaOH(aq) → NaNO3(aq) + H20 (1) C) H+ (aq) + OH- (aq) + H2O (1) D) HNO3 (aq) + OH- (aq) + NO3- (aq) + H2O (1) E) H+ (aq) + Na+ (aq) + OH- (aq) → H20 (1) + Na+ (aq) 2) Which...
9 > Question 39 (2 points) What is the net ionic equation for the reaction of hydrochloric acid with potassium hydroxide if the molecular equation is HCl(aq) + KOH(aq) – H00) + KCl(aq)? 12 HCI + KOH — H20 + KCI 15 2H+ +2C1- + K2+ + 2OH- H20+ K2+ +2 C1- 18 OH+ + Cl- + K+ + OH- H20+ K+ + Cl- H+ + OH- H20 Question 40 (2 points) Which of the following is NOT an example...
QUESTIONS What is the net ionic equation for the neutralization of hydrofluoric acid with sodium hydroxide? O HF(09) + NaOH(0) H20(1) - Na() Ob HP(0q) + OH 7) + H2F09)+02-700) OCHF(0) + OH 709) + H 200 ) +F709) Od (09) + OH 709) + H20) OCH (09) + NaOH(aq) + H200) Na (0) QUESTIONE What is the partial pressure of carbon dioxide in a container that contains 3 mol of oxyge, 2 mol of nitrogen, and 5 mol of...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
3. Suppose after adding HCl to ppt 16, you do not have any black solid. What, if anything, should you do to test for Co2 and Ni*? Qual Scheme: Group III: Co?(pink), N1" (green), Fet+ (yellow), Cr" (blue-grey), Mn(pink), AP (colorless), Zn? (colorless). Unknown B Solution: Use 10 dps of unknown sample and 10 dps of H20 and go to Procedure for Group III. Procedure for Group II: Add 2 dps NHCl soln, add 6M NHOH until just basic to...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 19 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago