Please help with this one along with the mechanism, thanks!
Homework Answers
For your understanding, provided numbering. If you have any
doubt please let me know. Thank you. Please give rating. 6.
Add Answer to:
Please help with this one along with the mechanism,
thanks!
OEt 1. NaoEt 2.0
Organic Chemistry 3) Propose a stepwise mechanism for the following transformations- NaOEt 0 EtOH H OET...
Organic Chemistry
3) Propose a stepwise mechanism for the following transformations- NaOEt 0 EtOH H OET + CI Et 4) Propose a stepwise mechanism for the following transformations H2O+ HO.O. OH shi Ho Hogan
OH OEt [1] NaOEt [1] NaOEt Н,о- B A 12] CHgl (21 (EIO)2C=O A A= draw...
OH OEt [1] NaOEt [1] NaOEt Н,о- B A 12] CHgl (21 (EIO)2C=O A A= draw structure... B = draw structure ...
what is the product? 1) NaOEt OET 2). PHCH28 1 H heat
what is the product?
1) NaOEt OET 2). PHCH28 1 H heat
What is the major product of the following reaction? 1. NaOEt E10 ΟΕΙ 2. Hz0+ OEt...
What is the major product of the following reaction? 1. NaOEt E10 ΟΕΙ 2. Hz0+ OEt Eto OH OEt
Give a full detailed mechanism and indicate any stereochemistry is necessary thanks. Et Ph OEt Ph Ph Et Ph OEt Ph Ph
Give a full detailed mechanism and indicate any stereochemistry
is necessary thanks.
Et Ph OEt Ph Ph
Et Ph OEt Ph Ph
major product of the reaction below would be... OEt 1) NaOEt 2) BrCH2CH2CH3 3) H30, heat...
major product of the reaction below would be... OEt 1) NaOEt 2) BrCH2CH2CH3 3) H30, heat Select one: O a. ОН ob. DH OC O= Od
Draw the organic product formed in the following reaction. OEt [1] NaOEt, EtOH [2] H, 0+...
Draw the organic product formed in the following reaction. OEt [1] NaOEt, EtOH [2] H, 0+ 0 Et draw structure ...
Can someone please explain number 10 40 °C, EtOH hadcs NaOEt OEt ???" "C F3 EtOH...
Can someone please explain number 10
40 °C, EtOH hadcs NaOEt OEt ???" "C F3 EtOH NaH 10 EtOOC ?COOEt NaBH3CN O +H3C-NH2 2. (a) Draw the all possible resonance structures of aniline, Marks 5+ 5 : NH2
please help with this mechanism. thanks! PLP, NES NADA
please help with this mechanism. thanks!
PLP, NES NADA
Thank you！ 9. What would be the product of the following conversion? 1. NaOEt, EIOH OEt...
Thank you！
9. What would be the product of the following conversion? 1. NaOEt, EIOH OEt 2. H,о- OEt ОН О OEt OEt OEt OE OEt e. d. 10. What is the product of the Dieckmann condensation of the following diester? 1.NaOCH, CH,Oн HgCOoc coOCHs 2. H,0* осн, COOCH COOCH b. d. both a) and b) e. a), b), and c) a. C. 11. Consider the synthesis below. What is compound X? COOEt COOH 1. КОВи 1. NAOH, H2O, heat...
Organic Chemistry
3) Propose a stepwise mechanism for the following transformations- NaOEt 0 EtOH H OET + CI Et 4) Propose a stepwise mechanism for the following transformations H2O+ HO.O. OH shi Ho Hogan
OH OEt [1] NaOEt [1] NaOEt Н,о- B A 12] CHgl (21 (EIO)2C=O A A= draw structure... B = draw structure ...
what is the product?
1) NaOEt OET 2). PHCH28 1 H heat
What is the major product of the following reaction? 1. NaOEt E10 ΟΕΙ 2. Hz0+ OEt Eto OH OEt
Give a full detailed mechanism and indicate any stereochemistry
is necessary thanks.
Et Ph OEt Ph Ph
Et Ph OEt Ph Ph
major product of the reaction below would be... OEt 1) NaOEt 2) BrCH2CH2CH3 3) H30, heat Select one: O a. ОН ob. DH OC O= Od
Draw the organic product formed in the following reaction. OEt [1] NaOEt, EtOH [2] H, 0+ 0 Et draw structure ...
Can someone please explain number 10
40 °C, EtOH hadcs NaOEt OEt ???" "C F3 EtOH NaH 10 EtOOC ?COOEt NaBH3CN O +H3C-NH2 2. (a) Draw the all possible resonance structures of aniline, Marks 5+ 5 : NH2
please help with this mechanism. thanks!
PLP, NES NADA
Thank you！
9. What would be the product of the following conversion? 1. NaOEt, EIOH OEt 2. H,о- OEt ОН О OEt OEt OEt OE OEt e. d. 10. What is the product of the Dieckmann condensation of the following diester? 1.NaOCH, CH,Oн HgCOoc coOCHs 2. H,0* осн, COOCH COOCH b. d. both a) and b) e. a), b), and c) a. C. 11. Consider the synthesis below. What is compound X? COOEt COOH 1. КОВи 1. NAOH, H2O, heat...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 17 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago