write balanced equations and create a matrix ions charts
Homework Answers
Add Answer to:
write balanced equations and create a matrix ions charts
6. Na SO4, Ba(OH)2 - SO42- +...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag)...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
help with thes 12. In the reaction, K2SO4(99) + Ba(NO3)2(aq) + BaSO4(s) + 2 KNO3(aq), which...
help with thes
12. In the reaction, K2SO4(99) + Ba(NO3)2(aq) + BaSO4(s) + 2 KNO3(aq), which ions are the spectator ions? a. Ba2+ and SO42- b. Ba2+ and K+ c. Ba2+ and NO3 d. K+ and SO42- e. K+ and NO3 13 Which is the net ionic equation for the reaction which takes place when HCl(ag) is added to KOH(aq)? a. HCl(aq) + KOH(99) KCl(aq) + H2O(1) b. H(aq) + OH(aq) + H2O(1) c. HCl(aq) + OH(aq) + Cl(aq) +...
2,3,&4 2) Write a balanced net ionic equation for the reaction of H2SO4(ag) with Ba(OH)2(aq) A)...
2,3,&4
2) Write a balanced net ionic equation for the reaction of H2SO4(ag) with Ba(OH)2(aq) A) 2 H+ (aq) + SO42-(aq) + Ba2+ (aq) + 2 OH-(aq) --BaSO4(s) + 2 H2001) B) Ba2+ (aq) + SO42-(aq) -BaSO46) C) H2SO4(aq) + Ba(OH)2(aq) -BaSO4(s) + 2 H20(1) D) H+ (aq) + OH+(aq) +2001 3) Write a balanced net ionic equation for the reaction of AgNO3(aq) with Cu(s). A) 2 AgNO3(aq) + Cu(s) - 2 Ag(s) + CUNO3(aq) B) AgNO3(aq) + Cu(s) -Ag(s)...
Soluble Ions 1. Cations 2. Anions Empirical Solubility Rules The presence of these ions tend to...
Soluble Ions 1. Cations 2. Anions Empirical Solubility Rules The presence of these ions tend to make the ionic compound water soluble (note exceptions). Ions Exceptions (compounds are insoluble despite having these cations) Li", Na, K, Exceptions = Li,Co, and LigPO4 NH Exceptions (compounds are insoluble Ious despite having these anions) NO,, nitrate ion No exceptions, all nitrates are water soluble C₂H₂O₂: No exceptions, all acetates are water soluble No acetate ion CIO4, CIO3. No exceptions, all perchlorate and chlorate...
Write balanced and net equations NiCl2 + Na2CO3 NiCl2 + NH Br Ba(OH)2 + HCI Ba(OH)2...
Write balanced and net equations
NiCl2 + Na2CO3 NiCl2 + NH Br Ba(OH)2 + HCI Ba(OH)2 + NaCO3 Ba(OH)2 + NH Br HCl + Na.Co HCl + NH Br Na,CO, + NH Br
For all of the following experiments, under standard conditions, which species could be spontaneously produced? A...
For all of the following
experiments, under standard conditions, which species could be
spontaneously produced?
A lead wire is placed in a solution containing
Cu2+
yes no Cu
yes no PbO2
yes no No reaction
Crystals of I2 are added to a solution of
NaCl.
yes no I-
yes no No reaction
yes no Cl2
A silver wire is placed in a solution containing
Cu2+
no yes Cu
no yes No reaction
no yes Ag+
Half-Reaction 8° (V) Half-Reaction 8° (V) 2.87 1.99 1.82 1.78 1.70 1.69 1.68 1.60...
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090...
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...
please write legible 1. Identify each of the following reactions as a precipitation reaction, an acid-base...
please write legible
1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction, or as a redox reaction + a. Pb(NO3)2 (aq) + 2 HCl(aq) PbCl (s) + 2 HNO, (aq) b. 2 Hxe + O2 + 2 H2O c. HNO, (aq) + KOH(aq) KNO, (aq) + H20 (1) d. Zna + 2HCl(a) - ZnClaraq) + Halle e. Ba?'(aq) + 2 Br(aq) + 2 Na(aq) + SO/"(aq) BaSO. (s) + 2 Na'(aq) + 2 Br" (aq)...
Candidate l: Zn(s) | Zn2+(aq,0.500 M) I Cu2+(aq, 1.00 M) Cu(s) Candidate 2: Pb(s) | Pb2+(aq,...
Candidate l: Zn(s) | Zn2+(aq,0.500 M) I Cu2+(aq, 1.00 M) Cu(s) Candidate 2: Pb(s) | Pb2+(aq, 0.500 M) || Cu2+(aq, 1.00 M) Cu(s) Candidate 3: Mg(s) | Mg2+(aq, 0.500 M) | Pb2+(aq, 1.00 M)| Pb(s) (a) 6 pts) Choose one of the candidate voltaic cells #1, #2, or #3. Draw a schematic cell diagram for the candidate voltaic cell of choice. Clearly label anode, cathode, electrodes, ions and their concentrations, salt bridge, and the flow of electrons. (b) (5 pts)...
if you can't answer all ,please don't answer 1) of the reactions below, which one is...
if you can't answer all ,please don't answer
1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...
16) Write a balanced net ionic equation for the reaction of H2SO4iag) with Ba(OH)2(g) A) Ba2+(ag) + SO42-(a)- BaSO4) B) 2 H+(aq) SO42-(a) Ba2 (ag) +2 OH-(a)-BaSO4(0 2 H20) C) H2SO4(a) + Ba(OH)2(e) - BaSO40) 2 H20() D) H (ag) OH(ag)--H2O) 16) 17) Write a balanced net ionic equation for the reaction of Pb(NO3)2(ag) with Nal(ag). A) Pb2 (ag)+2 NO3-(4g) +2 Na+ (ag) +2 1-(a4)-- Pb2+(ag)+ 2 1-(a4)+ 2 Na (a) +2 NO3-(a) B) Pb2+(ag) 2 NO3-(a) + 2 Na...
help with thes
12. In the reaction, K2SO4(99) + Ba(NO3)2(aq) + BaSO4(s) + 2 KNO3(aq), which ions are the spectator ions? a. Ba2+ and SO42- b. Ba2+ and K+ c. Ba2+ and NO3 d. K+ and SO42- e. K+ and NO3 13 Which is the net ionic equation for the reaction which takes place when HCl(ag) is added to KOH(aq)? a. HCl(aq) + KOH(99) KCl(aq) + H2O(1) b. H(aq) + OH(aq) + H2O(1) c. HCl(aq) + OH(aq) + Cl(aq) +...
2,3,&4
2) Write a balanced net ionic equation for the reaction of H2SO4(ag) with Ba(OH)2(aq) A) 2 H+ (aq) + SO42-(aq) + Ba2+ (aq) + 2 OH-(aq) --BaSO4(s) + 2 H2001) B) Ba2+ (aq) + SO42-(aq) -BaSO46) C) H2SO4(aq) + Ba(OH)2(aq) -BaSO4(s) + 2 H20(1) D) H+ (aq) + OH+(aq) +2001 3) Write a balanced net ionic equation for the reaction of AgNO3(aq) with Cu(s). A) 2 AgNO3(aq) + Cu(s) - 2 Ag(s) + CUNO3(aq) B) AgNO3(aq) + Cu(s) -Ag(s)...
Soluble Ions 1. Cations 2. Anions Empirical Solubility Rules The presence of these ions tend to make the ionic compound water soluble (note exceptions). Ions Exceptions (compounds are insoluble despite having these cations) Li", Na, K, Exceptions = Li,Co, and LigPO4 NH Exceptions (compounds are insoluble Ious despite having these anions) NO,, nitrate ion No exceptions, all nitrates are water soluble C₂H₂O₂: No exceptions, all acetates are water soluble No acetate ion CIO4, CIO3. No exceptions, all perchlorate and chlorate...
Write balanced and net equations
NiCl2 + Na2CO3 NiCl2 + NH Br Ba(OH)2 + HCI Ba(OH)2 + NaCO3 Ba(OH)2 + NH Br HCl + Na.Co HCl + NH Br Na,CO, + NH Br
For all of the following
experiments, under standard conditions, which species could be
spontaneously produced?
A lead wire is placed in a solution containing
Cu2+
yes no Cu
yes no PbO2
yes no No reaction
Crystals of I2 are added to a solution of
NaCl.
yes no I-
yes no No reaction
yes no Cl2
A silver wire is placed in a solution containing
Cu2+
no yes Cu
no yes No reaction
no yes Ag+
Half-Reaction 8° (V) Half-Reaction 8° (V) 2.87 1.99 1.82 1.78 1.70 1.69 1.68 1.60...
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...
please write legible
1. Identify each of the following reactions as a precipitation reaction, an acid-base reaction, or as a redox reaction + a. Pb(NO3)2 (aq) + 2 HCl(aq) PbCl (s) + 2 HNO, (aq) b. 2 Hxe + O2 + 2 H2O c. HNO, (aq) + KOH(aq) KNO, (aq) + H20 (1) d. Zna + 2HCl(a) - ZnClaraq) + Halle e. Ba?'(aq) + 2 Br(aq) + 2 Na(aq) + SO/"(aq) BaSO. (s) + 2 Na'(aq) + 2 Br" (aq)...
Candidate l: Zn(s) | Zn2+(aq,0.500 M) I Cu2+(aq, 1.00 M) Cu(s) Candidate 2: Pb(s) | Pb2+(aq, 0.500 M) || Cu2+(aq, 1.00 M) Cu(s) Candidate 3: Mg(s) | Mg2+(aq, 0.500 M) | Pb2+(aq, 1.00 M)| Pb(s) (a) 6 pts) Choose one of the candidate voltaic cells #1, #2, or #3. Draw a schematic cell diagram for the candidate voltaic cell of choice. Clearly label anode, cathode, electrodes, ions and their concentrations, salt bridge, and the flow of electrons. (b) (5 pts)...
if you can't answer all ,please don't answer
1) of the reactions below, which one is a decomposition reaction? A) Ca(NO3)2 + Na2S -- CdS +2NaNO3 B) NH4Cl- NH3 + HCI C) 2Mg + 02 - 2MgO D) 2N2 + 3H2 → 2NH3 E) 2CH4 + 402 - 2002 + 4H20 miches of - x 1? 2 2) Calculate the percentage by mass of ammonia in cisplatin, PtCl2/NH3 12. A) 12.53 B) 5.68 C) 18.09 D) 11.35 E) 4.67 3)...
Most questions answered within 3 hours.
-
Humans have used horses for transportation for millions of
years. Therefore, they will use horses for...
asked 1 hour ago -
The following are the Jensen Corporation's unit costs of making
and selling an item at a...
asked 2 hours ago -
Does direct Medicare reimbursement of Advanced practice nurses
increase access to their services?
asked 2 hours ago -
List and explain why a company would choose to use a
published
compensation survey vs. creating...
asked 3 hours ago -
A discrete random variable X can take values from 1 to 10. Find
the variance of...
asked 3 hours ago -
The primary financial goal of a corporation is to maximize:
shareholders wealth.
earnings per share.
stock...
asked 3 hours ago -
determine whether the vectors u=(1,2,3,), v=(-2,1,0) and
w=(1,0,1) are linearly dependent or independent.
asked 3 hours ago -
python
Define a function called print_values which takes a dictionary
object as a parameter. The function...
asked 4 hours ago -
In Chapter 1 you created a program named Triangle in
which you displayed a seven-line triangle...
asked 4 hours ago -
Research question: What are the differences between separately
stated and non separately stated transactions in an...
asked 4 hours ago -
By using Arduino write a code that connects two LEDs to two
push-buttons. Each button controls...
asked 5 hours ago -
Bank of America has bonds that pay a coupon interest rate of 5.5
percent and mature...
asked 6 hours ago