Homework Answers
First of all, acetal formation is reversible and occurs at high temperatures.
And if you observe , the Reaction it was done under reflux conditions hence we should use solvent with high boiling point. Here toulene has 110°C . Hence it is suitable for acetal formation.
If we take any polar solvents, the Reaction moves in reverse direction. Deprotection of acetal.
Add Answer to:
Why
is toluene used as the solvent for the formation of the acetal?
p-TSOH toluene OEt...
If a protecting group was not used, what would be the product of the Grignard reaction? CHOEt + HO OH P-TOH toluene...
If
a protecting group was not used, what would be the product of the
Grignard reaction?
CHOEt + HO OH P-TOH toluene reflux QO CH -CH CH2 O Et 0 2 O 2 PhMgBr ether 0 0 Ph. Ph. CHIPh HCI, HO acetone reflux CH3 HO CHỊ cold CHỦ CH "Ph MgBr ОН CH; CHAM CH3CH, CHPh
Draw the arrows for the 7-step mechanism for hydrolysis of an acetal to a carbonyl. Мар...
Draw the arrows for the 7-step mechanism for hydrolysis of an acetal to a carbonyl. Мар - + CH,CH,OH ACETAL HEMIACETAL 3 Ere X Step Step :0 OH2 H One Two H H H 16 Step 3. Step Step H H H -H Five :0: H Four H H1 Hi H → Step 6 ht H o: Step Draw the arrows for the 7-step mechanism in formation of the mixed acetal shown. Map from СН,ОН OH ܠܢ + HO H...
1. Predict the major product for the reactions shown below; pick any 5: HO xs CHal Ag20 NaOEt EtOH, Δ -H2O HO но он 0 он H2SO4 H20, A heat 1) PhMgBr 1) NaOH, Br2 2) 5% HCI 2)H3O+, Δ OEt 1) PPh3 3...
1. Predict the major product for the reactions shown below; pick any 5: HO xs CHal Ag20 NaOEt EtOH, Δ -H2O HO но он 0 он H2SO4 H20, A heat 1) PhMgBr 1) NaOH, Br2 2) 5% HCI 2)H3O+, Δ OEt 1) PPh3 3) KOtBu 2) O 1) NaOH on. Br 2) O o
1. Predict the major product for the reactions shown below; pick any 5: HO xs CHal Ag20 NaOEt EtOH, Δ -H2O HO но он 0 он...
laracteryze trie DreIS-AATder product. 3. The solvent used in this experiment is toluene. Draw one of...
laracteryze trie DreIS-AATder product. 3. The solvent used in this experiment is toluene. Draw one of the Diels- Alder products from the reaction of toluene with maleic anhydride. Why is this product not formed?
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid...
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid glycerophospholipid The hydrolysis of an unknown lipid produces one glycerol molecule, two stearic acid molecules, choline, and an (unspecified) anion. What kind of lipid was the unknown? O a wax O a triacylglycerol O a glycerophospholipid O a fatty acid O a sphingomyelin What is the correct number for the ketone functional group in this structure? CH, NH, НО CH, | / NH7 Н-...
Draw the arrows for the 7-step mechanism in formation of the mixed acetal shown. Map CH,OH...
Draw the arrows for the 7-step mechanism in formation of the mixed acetal shown. Map CH,OH OH mi # + HO ht Mixed ACETAL HEMIACETAL click to edit H. 0 Step он H Step w HỘ One H Two HⓇ H H 16 Step 3. Step HÖCH3 Step + H H Five Four Step 6 Draw the arrows for the 7-step mechanism for hydrolysis of an acetal to a carbonyl. Map . H2O Hö: H,O L; E i + CH,CH,OH...
Hg(OAc), CH,OH Mola), CHOMME NaBHA 1) BH/THF (2)-3-hexene 2) H202/OH CH3 Br2 CH2Cl2 (solvent) - CH2 CH2Cl2 (solvent) Cl...
Hg(OAc), CH,OH Mola), CHOMME NaBHA 1) BH/THF (2)-3-hexene 2) H202/OH CH3 Br2 CH2Cl2 (solvent) - CH2 CH2Cl2 (solvent) Cl2 ch H2O CH3 1) CH,COH 2) H30 20) PhCOH CH2Cl2 (solvent) CH3 OSOA H202 CH3 1) 03 2) (CH3)2S KMnO4 (hot, conc.)
1. What reagents can be used to convert 1-hexyne into 2-hexanone? A) 1. Sia2BH; 2. H202,...
1. What reagents can be used to convert 1-hexyne into 2-hexanone? A) 1. Sia2BH; 2. H202, NaOH B) Hg2+, H2sO4, H20 C) 1. 03; 2. (CH3)2S D) 1. CH3MgBr; 2. CO2 2. What would be the product of th following reaction? trace HCl A) B) он он C) D) CH3 3. What is the major organic product of the following reaction? + CH CH NHCH,CH CH IV N-C2Hs L. C2H5 он CH CH3 V. п. NCH C2H5 CHs A) I...
Map at assify these structures as hemiacetal, hemiketal, acetal, ketal, or other. Each structure needs to...
Map at assify these structures as hemiacetal, hemiketal, acetal, ketal, or other. Each structure needs to go int a box, and they will shrink to fit as needed when you put more than one in a box. Jasperse: Read the hint before you start, because I didn't emphasize the distinction between hemiacetals and hemiketals, or between acetals and ketals. Hemiacetal Hemiketal Acetal Ketal Other ОН OCH3 CH3COCH3 CH2CH3 O II CH3COCH3 OH CH3 | CH3CHOCHZ OCH3 CH3 H3COH H3C CH3...
give major product O 11. Ç(CH3)3 1) CH3CCI, AICI: 2) (CH3)2NH H2, Raney-Ni, heat 12. ÇO...
give major product
O 11. Ç(CH3)3 1) CH3CCI, AICI: 2) (CH3)2NH H2, Raney-Ni, heat 12. ÇO Me 1) PhMgBr (2 equiv.) 2) H20, H30 13. CNH2 1) Brz, NaOH, H20 2) CH,CCI, pyridine 14. HNO3 CHO но +н н+он н+он нон CH OH оо 15. H2NCO, 1) (CH3),COCOCOC(CH3)3 Ph -N: C: NH- PhNHNH | 16. CHO HOTH HOH (3 equiv.) H-OH HO+H CH2OH ai
If
a protecting group was not used, what would be the product of the
Grignard reaction?
CHOEt + HO OH P-TOH toluene reflux QO CH -CH CH2 O Et 0 2 O 2 PhMgBr ether 0 0 Ph. Ph. CHIPh HCI, HO acetone reflux CH3 HO CHỊ cold CHỦ CH "Ph MgBr ОН CH; CHAM CH3CH, CHPh
Draw the arrows for the 7-step mechanism for hydrolysis of an acetal to a carbonyl. Мар - + CH,CH,OH ACETAL HEMIACETAL 3 Ere X Step Step :0 OH2 H One Two H H H 16 Step 3. Step Step H H H -H Five :0: H Four H H1 Hi H → Step 6 ht H o: Step Draw the arrows for the 7-step mechanism in formation of the mixed acetal shown. Map from СН,ОН OH ܠܢ + HO H...
1. Predict the major product for the reactions shown below; pick any 5: HO xs CHal Ag20 NaOEt EtOH, Δ -H2O HO но он 0 он H2SO4 H20, A heat 1) PhMgBr 1) NaOH, Br2 2) 5% HCI 2)H3O+, Δ OEt 1) PPh3 3) KOtBu 2) O 1) NaOH on. Br 2) O o
1. Predict the major product for the reactions shown below; pick any 5: HO xs CHal Ag20 NaOEt EtOH, Δ -H2O HO но он 0 он...
laracteryze trie DreIS-AATder product. 3. The solvent used in this experiment is toluene. Draw one of the Diels- Alder products from the reaction of toluene with maleic anhydride. Why is this product not formed?
How is this molecule classified? НО НО ОН ОН ОН O prostaglandin fatty acid Osphingosine steroid glycerophospholipid The hydrolysis of an unknown lipid produces one glycerol molecule, two stearic acid molecules, choline, and an (unspecified) anion. What kind of lipid was the unknown? O a wax O a triacylglycerol O a glycerophospholipid O a fatty acid O a sphingomyelin What is the correct number for the ketone functional group in this structure? CH, NH, НО CH, | / NH7 Н-...
Draw the arrows for the 7-step mechanism in formation of the mixed acetal shown. Map CH,OH OH mi # + HO ht Mixed ACETAL HEMIACETAL click to edit H. 0 Step он H Step w HỘ One H Two HⓇ H H 16 Step 3. Step HÖCH3 Step + H H Five Four Step 6 Draw the arrows for the 7-step mechanism for hydrolysis of an acetal to a carbonyl. Map . H2O Hö: H,O L; E i + CH,CH,OH...
Hg(OAc), CH,OH Mola), CHOMME NaBHA 1) BH/THF (2)-3-hexene 2) H202/OH CH3 Br2 CH2Cl2 (solvent) - CH2 CH2Cl2 (solvent) Cl2 ch H2O CH3 1) CH,COH 2) H30 20) PhCOH CH2Cl2 (solvent) CH3 OSOA H202 CH3 1) 03 2) (CH3)2S KMnO4 (hot, conc.)
1. What reagents can be used to convert 1-hexyne into 2-hexanone? A) 1. Sia2BH; 2. H202, NaOH B) Hg2+, H2sO4, H20 C) 1. 03; 2. (CH3)2S D) 1. CH3MgBr; 2. CO2 2. What would be the product of th following reaction? trace HCl A) B) он он C) D) CH3 3. What is the major organic product of the following reaction? + CH CH NHCH,CH CH IV N-C2Hs L. C2H5 он CH CH3 V. п. NCH C2H5 CHs A) I...
Map at assify these structures as hemiacetal, hemiketal, acetal, ketal, or other. Each structure needs to go int a box, and they will shrink to fit as needed when you put more than one in a box. Jasperse: Read the hint before you start, because I didn't emphasize the distinction between hemiacetals and hemiketals, or between acetals and ketals. Hemiacetal Hemiketal Acetal Ketal Other ОН OCH3 CH3COCH3 CH2CH3 O II CH3COCH3 OH CH3 | CH3CHOCHZ OCH3 CH3 H3COH H3C CH3...
give major product
O 11. Ç(CH3)3 1) CH3CCI, AICI: 2) (CH3)2NH H2, Raney-Ni, heat 12. ÇO Me 1) PhMgBr (2 equiv.) 2) H20, H30 13. CNH2 1) Brz, NaOH, H20 2) CH,CCI, pyridine 14. HNO3 CHO но +н н+он н+он нон CH OH оо 15. H2NCO, 1) (CH3),COCOCOC(CH3)3 Ph -N: C: NH- PhNHNH | 16. CHO HOTH HOH (3 equiv.) H-OH HO+H CH2OH ai
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 1 minute ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 58 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago