show step by step thanks 15 the coefficient for O, when the equation is balanced using...
Balance the following equation using the smallest possible integers and determine the coefficient of HCI? O 2 0 3 5 pts D Question 3 What is the coefficient of N2 when the following equation is properly balanced with the smallest set of whole numbers?
-How many aluminum atoms are there in 21.0 g of Al2S3? -When balanced with the smallest set of whole numbers, the coefficient of O2 in the following equation is: __ C3H8 + __ O2 -------------> __ CO2 + __ H2O
When the following equation is balanced with the smallest set of whole numbers, what is the coefficient of H2O? CsOH + H3PO4 --> Cs3PO4 + H2O Select one: a. 1 b. 3 c. 6 d. 2
What is the coefficient of H.So, when the following equation is properly balanced with the smallest set of whole numbers? __Cas(PO4h + H2SO4 - Caso + HPO. A) 3 B) 8 C) 10 D) 11 2) What is the coefficient of H20 when the following equation is properly balanced with smallest set of whole numbers? ALC + H2O - AM(OH), + CHE A) 3 B) 4 C) 6 D) 12 E) 24 3) of the reactions below, which one is...
1.) When the following acid based neutralization reaction is correctly balanced, with the smallest set of whole numbers, the coefficient of H2O will be __? __H2C2O4(aq) + __Al(OH)3(aq) ---> Al2(C2O4)3(aq) + H2O(l) a.) 9 b.) 8 c.) 6 d.) 4 e.) 2 2.) Using the following acid based neutralization reaction, how many grams of CO2 gas is produced when 105 grams of oxalic acid, H2C2O4, is mixed with 105 grmas of cobalt (III) carbonate, CO2(CO3)3. (Use Limiting Reagent) 3H2C2O4(aq) +...
1) 1) What is the stoichiometric coefficient for water when the following equation is balanced using the lowest whole-number coefficients? _C3HgO(l) + _02(8) - — CO2(g) + ___ _H2O(1) A) 6 B) 3 098 D) 7 2) Which of the following correctly illustrates the conservation of mass for the reaction below? 2) 4Na(s) + O2(g) - 2Na2O(s) A) 92.0 g Na, 16.0 g O2, 108 g Na2O B) 92.0 g Na, 16.0 g 02, 124 g Na2O C) 23.0 g...
estion 24 of 32 > What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various ionic strengths can be found in this table. Cro - (u = 0.005 M) Y= Fe3+ (u = 0.05 M) y = Eu+ (u = 0.1 M) Y = (CH,CH, NH* a = 0.001 M) y = privacy policy contact us hele Activity Coefficients Chempendix for Aqueous Solutions at 25°C Ion Tonic Strength 0.01 M)...
24. Balance the equation below using the smallest set of whole numbers. What is the coefficient of H2O? __PC(O) +_HO(1) ►_H3PO3(aq) + HCl(aq) A) 1 B) 2 C) 3 D) 5 E) none of these 25. How many atoms are in 5.54 g of F? A) 6.02 x 10- atoms B) 0.146 atoms C) 0.292 atoms D) 8.78 x 10" atoms E) 1.76 x 10" atoms silicon atoms is 26. The mass of 1.63 x 10 A) 2.71 x 10-...
What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...
do numbers 15,16,17,18,19,20 please
c) 5 in front of O 15. Consider the balanced equation: 2 excess oxygen, then which of the follow e equation: 2S (s) + 30. () >> 250, Ir 64.29 of sulfur are reacted with which of the following will be true? The amount of So, that for will 0.1gb) 40.0 B ) 160.23d) 22.49 €) 52B 16.200 mL of a 15.0% v/v alcohol in water 15.0% V/v alcohol in water solution would contain how many...