Homework Answers
nm = 10-9 m
1 in. = 0.0254 m
Add Answer to:
A cell membrane has a thickness of about 7.4 nm. How many cell membranes would it...
Cell Membranes and Dielectrics Many cells in the body have a cell membrane whose inner and...
Cell Membranes and Dielectrics Many cells in the body have a cell membrane whose inner and outer surfaces carry opposite charges, just like the plates of a parallel-plate capacitor. Suppose a typical cell membrane has a thickness of 8.2×10−9 m , and its inner and outer surfaces carry charge densities of -5.3×10−4 C/m2 and +5.3×10−4 C/m2 , respectively. In addition, assume that the material in the cell membrane has a dielectric constant of 5.5. Part A . Find the direction...
Cell membranes (the walled enclosure around a cell) are typically about d = 7.0 nm thick....
Cell membranes (the walled enclosure around a cell) are typically about d = 7.0 nm thick. They are partially permeable to allow charged material to pass in and out, as needed. Equal but opposite charge densities build up on the inside and outside faces of such a membrane, and these charges prevent additional charges from passing through the cell wall. We can model a cell membrane as a parallel-plate capacitor, with the membrane itself containing proteins embedded in an organic...
#20a7michelle Please help me, thanks Consider a portion of a cell membrane that has a thickness...
#20a7michelle Please help me, thanks Consider a portion of a cell membrane that has a thickness of 7.50 nm and 1.5
A typical cell membrane is 8.15 nm thick and has an electrical resistivity of 1.35E+7 Ω·m....
A typical cell membrane is 8.15 nm thick and has an electrical resistivity of 1.35E+7 Ω·m. If the potential difference between the inner and outer surfaces of a cell membrane is 78.2 mV, how much current flows through a square area of membrane 1.07 μm on a side? Suppose the thickness of the membrane is quadrupled, but the resistivity and potential difference remain the same. How much current flows through the same area of membrane now?
A typical cell membrane is 7.96 nm thick and has an electrical resistivity of 1.40E+7 Ω·m....
A typical cell membrane is 7.96 nm thick and has an electrical resistivity of 1.40E+7 Ω·m. If the potential difference between the inner and outer surfaces of a cell membrane is 71.7 mV, how much current flows through a square area of membrane 1.12 μm on a side? b) Suppose the thickness of the membrane is doubled, but the resistivity and potential difference remain the same. How much current flows through the same area of membrane now?
3) Electrical model of a cell membrane Consider a piece of cell membrane. The membrane has...
3) Electrical model of a cell membrane Consider a piece of cell membrane. The membrane has a specific conductivity of Om = 10-10 (12 cm)', a dielectric constant Em = 8 and thickness dm = 7.5 nm. On both sides of the membrane are two boundary layers with equal specific conductivity Op = OL = 102 (2 cm)-1. The thickness of these layers is dp = 50 nm and di = 100 nm and their capacitance is negligible. a) What...
C. Imagine a person has a new disease that causes the cell membranes of the liver...
C. Imagine a person has a new disease that causes the cell membranes of the liver to become less viscous. i. Why could this be a problem? ii. If you could use gene therapy to make those liver cells change the constituents of the cell membrane what would you add or take away to make the cells function properly?
A cell membrane has a surface area of 1.2 × 10−7 m2, a dielectric constant of...
A cell membrane has a surface area of 1.2 × 10−7 m2, a dielectric constant of 5.5, and a thickness of 7.1 nm. The potential difference across the membrane is 60 mV. Round youranswers to two significant figures. (a) What is the magnitude of the charge on each surface of the membrane? Q = pC (b) How many ions are on each surface of the membrane, assuming they are singly charged (|q| = e)? ___ × 10
MEMBRANE STRUCTURE AND TRANSPORT ACROSS CELL MEMBRANES 1. An organelle that is characterized by extensive, folded...
MEMBRANE STRUCTURE AND TRANSPORT ACROSS CELL MEMBRANES 1. An organelle that is characterized by extensive, folded membranes and is often associated with ribosomes 2. Label the following diagram Qutsde of cel LE nside of cell 3. List 4 functions of the plasma membrane c. d. 4. Complete the table below with the role cach component of the plasma membrane plays Plasma membrane components Role in the membrane Phospholipid Bilayer Cholesterol Glycopeoteins Glycolipids Protein Receptor Site Protein channel Protein Carrier 5....
How do viruses acquire an envelope? Viruses manufacture cell membranes because it is encoded in their...
How do viruses acquire an envelope? Viruses manufacture cell membranes because it is encoded in their nucleic acid. Animal viruses don't make membranous envelopes; these are only produced in phage viruses. Only DNA viruses make envelopes because they have a gene for phospholipid production. When virus are released from host cell, they take the host cell membrane along with synthesized viral glycoproteins.
3) Electrical model of a cell membrane Consider a piece of cell membrane. The membrane has a specific conductivity of Om = 10-10 (12 cm)', a dielectric constant Em = 8 and thickness dm = 7.5 nm. On both sides of the membrane are two boundary layers with equal specific conductivity Op = OL = 102 (2 cm)-1. The thickness of these layers is dp = 50 nm and di = 100 nm and their capacitance is negligible. a) What...
MEMBRANE STRUCTURE AND TRANSPORT ACROSS CELL MEMBRANES 1. An organelle that is characterized by extensive, folded membranes and is often associated with ribosomes 2. Label the following diagram Qutsde of cel LE nside of cell 3. List 4 functions of the plasma membrane c. d. 4. Complete the table below with the role cach component of the plasma membrane plays Plasma membrane components Role in the membrane Phospholipid Bilayer Cholesterol Glycopeoteins Glycolipids Protein Receptor Site Protein channel Protein Carrier 5....
How do viruses acquire an envelope? Viruses manufacture cell membranes because it is encoded in their nucleic acid. Animal viruses don't make membranous envelopes; these are only produced in phage viruses. Only DNA viruses make envelopes because they have a gene for phospholipid production. When virus are released from host cell, they take the host cell membrane along with synthesized viral glycoproteins.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 37 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago