calculate the ppm of Fe2+ in a 0.6321g/2L solution of iron(II)ammonium sulfate hexahydrate.
Homework Answers
Add Answer to:
calculate the ppm of Fe2+ in a 0.6321g/2L solution of
iron(II)ammonium sulfate hexahydrate.
2.5g of AR ammonium iron (ll) sulfate hexahydrate crystals are dissolved in 40mL of 1M sulfuric acid solution. Solution...
2.5g of AR ammonium iron (ll) sulfate hexahydrate crystals are dissolved in 40mL of 1M sulfuric acid solution. Solution is then titrated with 6.4mL of 0.02M potassium permanganate (VII) solution. a) Write an overall equation for the reaction. b) How many moles of permanganate are present in the titre value? c) How many moles of Fe^2+ are present in the solution? d) What mass of Fe^2+ is present in the ammonium iron (ll) sulfate hexahydrate? e) What is the percentage...
What is the formula mass of iron(II) ammonium sulfate hexahydrate? submit your answer to 6 significant...
What is the formula mass of iron(II) ammonium sulfate hexahydrate? submit your answer to 6 significant figures
2. (2 points) Calculate the percentage of Fe in pure iron(I) ammonium sulfate hexahydrate: (NH4)2[Fe(SO4)2]. 6...
2. (2 points) Calculate the percentage of Fe in pure iron(I) ammonium sulfate hexahydrate: (NH4)2[Fe(SO4)2]. 6 H2O.
You wish to prepare 250.0250.0 mL of a 225.0225.0 ppm w/v Fe2+Fe2+ (MW=55.845 g/molMW=55.845 g/mol) solution....
You wish to prepare 250.0250.0 mL of a 225.0225.0 ppm w/v Fe2+Fe2+ (MW=55.845 g/molMW=55.845 g/mol) solution. How many grams of ferrous ammonium sulfate hexahydrate (Fe(NH4)2(SO4)2⋅6H2O(Fe(NH4)2(SO4)2⋅6H2O, MW=392.14 g/molMW=392.14 g/mol) are needed to prepare this solution? Assume the final solution has a density of 1.00 g/mL.
If 10.36 g of ammonium nickel(II) sulfate hexahydrate is isolated by vacuum filtration, what is the percent yield of the reaction?
If 10.36 g of ammonium nickel(II) sulfate hexahydrate is isolated by vacuum filtration, what is the percent yield of the reaction?
1. When iron(II) ammonium sulfate is dissolved in water, it dissociates into its component ions. ()...
1. When iron(II) ammonium sulfate is dissolved in water, it dissociates into its component ions. () → () + ( ) + ( ) 2. When oxalic acid is added, the iron (II) ions precipitate as iron(II) oxalate dihydrate. Fe2+ (aq) + (aq) + __H20 (1) ► ( ) + _ H(aq) 3. Next, potassium oxalate is added to the washed precipitate. Potassium oxalate dissociates into its ions in solution. At high oxalate concentrations, iron (II) oxalate combines with another...
8. If 45.52 mL of a potassium permanganate solution is needed to titrate 2.145 g of...
8. If 45.52 mL of a potassium permanganate solution is needed to titrate 2.145 g of iron(II) ammonium sulfate hexahydrate, calculate the molarity of the KMnO4 solution
1. A solid sample containing some Fe2+ weighs 2.360 g. It required 36.44 mL 0.0244 M...
1. A solid sample containing some Fe2+ weighs 2.360 g. It required 36.44 mL 0.0244 M KMnO, to titrate the Fe- in the dissolved sample to a pink end point. The balanced redox reaction is shown below. 8 H + MnO4 + 5 Fe2+ + Mn2+ + 5 Fe3+ + 4H20 Calculate each of the following quantities. 2. (2 points) Calculate the percentage of Fe in pure iron(II) ammonium sulfate hexahydrate: (NH4)2[Fe(SO4)2]• 6 H20.
1. write out the ion formulas for the components of iron (ii) ammonium sulfate and show...
1. write out the ion formulas for the components of iron (ii) ammonium sulfate and show the overall formula and how the charges are balanced. 2. write out the formulas for the ions and water components of potassium trisoxalatoiron (iii) trihydrate and show overall formula has the charges balanced.
An acidified solution of manganate (VII) of permanganate ions, MnO4-, is a strong oxidising agent and...
An acidified solution of manganate (VII) of permanganate ions, MnO4-, is a strong oxidising agent and will be used in an experiment to determine the percentage of iron in a sample of ammonium iron (II) sulfate hexahydrate. The titration is self-indicating because at the equivalence point the products are a different colour than the original reactants. The two half reactions are: MnO4-(aq) + 8H+(aq) + 5e- ---> Mn2+(aq) + 4H2O(l) Fe^2+(aq) ---> Fe^3+(aq) + e- a) What is a redox...
2. (2 points) Calculate the percentage of Fe in pure iron(I) ammonium sulfate hexahydrate: (NH4)2[Fe(SO4)2]. 6 H2O.
1. When iron(II) ammonium sulfate is dissolved in water, it dissociates into its component ions. () → () + ( ) + ( ) 2. When oxalic acid is added, the iron (II) ions precipitate as iron(II) oxalate dihydrate. Fe2+ (aq) + (aq) + __H20 (1) ► ( ) + _ H(aq) 3. Next, potassium oxalate is added to the washed precipitate. Potassium oxalate dissociates into its ions in solution. At high oxalate concentrations, iron (II) oxalate combines with another...
8. If 45.52 mL of a potassium permanganate solution is needed to titrate 2.145 g of iron(II) ammonium sulfate hexahydrate, calculate the molarity of the KMnO4 solution
1. A solid sample containing some Fe2+ weighs 2.360 g. It required 36.44 mL 0.0244 M KMnO, to titrate the Fe- in the dissolved sample to a pink end point. The balanced redox reaction is shown below. 8 H + MnO4 + 5 Fe2+ + Mn2+ + 5 Fe3+ + 4H20 Calculate each of the following quantities. 2. (2 points) Calculate the percentage of Fe in pure iron(II) ammonium sulfate hexahydrate: (NH4)2[Fe(SO4)2]• 6 H20.
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 18 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago