Homework Answers
1)
Hydrolysis and esterification
B) substitution and elimination
C) substitution
D) reduction and elimination
Add Answer to:
#1 Suggest a way to accomplish each transformation and indicate to which reaction family each proposed...
what is the major product in the following reaction? which reaction sequence would accomplish this transformation?...
what is the major product in the following reaction?
which reaction sequence would accomplish this
transformation?
What is the major product in the following reaction? 1. CHyl (excess) NH 2. Ag2O, H2O, heat HN Which reaction sequence would accomplish this transformation? yogh Н 1. H30+, CH2OH 2. NaBH, 3. H20+ O 1. p-TsOH, HOCH,CH,OH 2. NaBH4 3. H30+ 01. pTsOH, HOCH,CH,OH 2. CH3MgBr 3. H307 O 1. CH_MgBr 2. H3O+ 3. CH3OH What is the best starting material to synthesize...
1. Provide the necessary reaction conditions (reagents and solvents) to perform the indicated transformation. More than...
1. Provide the necessary reaction conditions (reagents
and solvents) to perform the indicated transformation. More than
one step may be necessary. Synthesis of reagents used in the
transformation are not required. Consider equivalents, selectivity,
and stereochemistry. Very little partial credit will be
given.
مل مل . . است Me OH CH سرعت -- له Me Me OH Me H0 Me Me- DH - We Me لكم OH 0 م --کمت و سلم . یک ما لكم . Me Me Me
1. Indicate the conditions you would use to accomplish each of the following transformations by s...
1. Indicate the conditions you would use to accomplish each of the following transformations by selecting the appropriate letter from this list. Write the letter above the reaction arrow. You may use some choices more than once, or not at all. A 1) Hg(OAc)2, H20; 2) NaBH B 1) BHs 2) H2O2, NaOH, H2O C 1)Os, 2) (CH3)2S D Os04, TBHP, H20 E 1)Os; 2) H202 F HBr H H2SO4 (cat), H2O I Br2, H20 J H2, Pd/C K NaOH...
Which of the following reaction sequences would accomplish the chemical transformation, shown below? (choose all correct)...
Which of the following reaction sequences would accomplish the chemical transformation, shown below? (choose all correct) 1. CH CH2MgBr, then H20; 2. PCC CH3CH2MgBr, then H20 1. Cros. H2SO4: 2. SOCI:3. LICU(CH2CH3)2, the H2O 1. Cros. H2SO4; 2.CH,OH, H2SO4:3. CH3CHMgCl, then H2O
please help with these ASAP, thanks! Which reaction sequence would accomplish this transformation? Н HO Н...
please help with these ASAP, thanks!
Which reaction sequence would accomplish this transformation? Н HO Н 1. H307, CH3OH 2. NaBH4 3. H30+ O 1. pTSOH, HOCH2CH2OH 2. CH3MgBr 3. H30+ O 1. p-TSOH, HOCH2CH2OH 2. NaBH4 3.H30+ O 1. CH3MgBr 2. H30+ 3. CH3OH What is the major product in the following reaction? KMnO4 ОН g ОН он ОН
Which reagents will accomplish the following transformation? OH HN H2N A. 1. MeMgBr/Et20 2. acid workup...
Which reagents will accomplish the following transformation? OH HN H2N A. 1. MeMgBr/Et20 2. acid workup B. Zn° / HCI OC. NaBH4 (aq) OD. 1. LiAlH4 / Et20 2. acid workup Which is the major product of this reaction sequence? KOH H2O/H30* Hoc-Ppha ОА. OC
Which reagent or set of reagents will best accomplish this transformation? b OH (A) OsO (B)...
Which reagent or set of reagents will best accomplish this transformation? b OH (A) OsO (B) 1) Hg(OAc); /H:0 2) NaBH, I-BOOH (D) HOOH (C) 1) THF-BH, 2) H-02/OH/H,0 7 What is the product of this reaction? (A) W model Å Which best represents a step in the mechanism for " I- @ AR .-
3) For each reaction below, indicate which starting material is the Nucleophile and which is the...
3) For each reaction below, indicate which starting material is the Nucleophile and which is the Electrophile. Show arrows to demonstrate how the transformation occurs. A) Putty » NH2 © NH2
Which reaction sequence would accomplish this transformation? HO ter H 01.H20+, CH2OH 2. NaBH4 3. Hz0+...
Which reaction sequence would accomplish this transformation? HO ter H 01.H20+, CH2OH 2. NaBH4 3. Hz0+ O 1. pTSOH, HOCH,CH,OH 2. CH3MgBr 3. H30+ O 1. p-TsOH, HOCH CH2OH 2. NaBH4 3. H30+ O 1. CH3MgBr 2. H30+ 3. CH3OH What is the best reagent(s) for the following transformation? O OH 1. LiAlH4 2. H30+ OCH3CH2OH, H2SO4 O NaOH, heat mCPBA What is the major product in the following reaction? 1. CH2CH2MgBr 2. H30* O o o OH OH What...
Which reagents would best accomplish the following transformation? ОН N 1. Potassium Phthalimide 2. CH3NH2 3....
Which reagents would best accomplish the following transformation? ОН N 1. Potassium Phthalimide 2. CH3NH2 3. N2H4 O 1. CH3NH2 2. LiAlH4 3. H30+ O 1. SOCl2, pyridine 2. CH3NH2 O 1. p-TsOH, HOCH CHOH 2. CH3NH2 3. H30+ ? 3:13 PM 7/30/2020 Which reaction sequence would accomplish this transformation? oth HO H O 1. CH3MgBr 2. H30+ 3. CH3OH 1. H30+, CH3OH 2. NaBH4 3. H30+ O 1. p-TOH, HOCH CH2OH 2. NaBH: 3. H30+ O 1. pTSOH, HOCH,CH,OH...
what is the major product in the following reaction?
which reaction sequence would accomplish this
transformation?
What is the major product in the following reaction? 1. CHyl (excess) NH 2. Ag2O, H2O, heat HN Which reaction sequence would accomplish this transformation? yogh Н 1. H30+, CH2OH 2. NaBH, 3. H20+ O 1. p-TsOH, HOCH,CH,OH 2. NaBH4 3. H30+ 01. pTsOH, HOCH,CH,OH 2. CH3MgBr 3. H307 O 1. CH_MgBr 2. H3O+ 3. CH3OH What is the best starting material to synthesize...
1. Provide the necessary reaction conditions (reagents
and solvents) to perform the indicated transformation. More than
one step may be necessary. Synthesis of reagents used in the
transformation are not required. Consider equivalents, selectivity,
and stereochemistry. Very little partial credit will be
given.
مل مل . . است Me OH CH سرعت -- له Me Me OH Me H0 Me Me- DH - We Me لكم OH 0 م --کمت و سلم . یک ما لكم . Me Me Me
1. Indicate the conditions you would use to accomplish each of the following transformations by selecting the appropriate letter from this list. Write the letter above the reaction arrow. You may use some choices more than once, or not at all. A 1) Hg(OAc)2, H20; 2) NaBH B 1) BHs 2) H2O2, NaOH, H2O C 1)Os, 2) (CH3)2S D Os04, TBHP, H20 E 1)Os; 2) H202 F HBr H H2SO4 (cat), H2O I Br2, H20 J H2, Pd/C K NaOH...
Which of the following reaction sequences would accomplish the chemical transformation, shown below? (choose all correct) 1. CH CH2MgBr, then H20; 2. PCC CH3CH2MgBr, then H20 1. Cros. H2SO4: 2. SOCI:3. LICU(CH2CH3)2, the H2O 1. Cros. H2SO4; 2.CH,OH, H2SO4:3. CH3CHMgCl, then H2O
please help with these ASAP, thanks!
Which reaction sequence would accomplish this transformation? Н HO Н 1. H307, CH3OH 2. NaBH4 3. H30+ O 1. pTSOH, HOCH2CH2OH 2. CH3MgBr 3. H30+ O 1. p-TSOH, HOCH2CH2OH 2. NaBH4 3.H30+ O 1. CH3MgBr 2. H30+ 3. CH3OH What is the major product in the following reaction? KMnO4 ОН g ОН он ОН
Which reagents will accomplish the following transformation? OH HN H2N A. 1. MeMgBr/Et20 2. acid workup B. Zn° / HCI OC. NaBH4 (aq) OD. 1. LiAlH4 / Et20 2. acid workup Which is the major product of this reaction sequence? KOH H2O/H30* Hoc-Ppha ОА. OC
Which reagent or set of reagents will best accomplish this transformation? b OH (A) OsO (B) 1) Hg(OAc); /H:0 2) NaBH, I-BOOH (D) HOOH (C) 1) THF-BH, 2) H-02/OH/H,0 7 What is the product of this reaction? (A) W model Å Which best represents a step in the mechanism for " I- @ AR .-
3) For each reaction below, indicate which starting material is the Nucleophile and which is the Electrophile. Show arrows to demonstrate how the transformation occurs. A) Putty » NH2 © NH2
Which reaction sequence would accomplish this transformation? HO ter H 01.H20+, CH2OH 2. NaBH4 3. Hz0+ O 1. pTSOH, HOCH,CH,OH 2. CH3MgBr 3. H30+ O 1. p-TsOH, HOCH CH2OH 2. NaBH4 3. H30+ O 1. CH3MgBr 2. H30+ 3. CH3OH What is the best reagent(s) for the following transformation? O OH 1. LiAlH4 2. H30+ OCH3CH2OH, H2SO4 O NaOH, heat mCPBA What is the major product in the following reaction? 1. CH2CH2MgBr 2. H30* O o o OH OH What...
Which reagents would best accomplish the following transformation? ОН N 1. Potassium Phthalimide 2. CH3NH2 3. N2H4 O 1. CH3NH2 2. LiAlH4 3. H30+ O 1. SOCl2, pyridine 2. CH3NH2 O 1. p-TsOH, HOCH CHOH 2. CH3NH2 3. H30+ ? 3:13 PM 7/30/2020 Which reaction sequence would accomplish this transformation? oth HO H O 1. CH3MgBr 2. H30+ 3. CH3OH 1. H30+, CH3OH 2. NaBH4 3. H30+ O 1. p-TOH, HOCH CH2OH 2. NaBH: 3. H30+ O 1. pTSOH, HOCH,CH,OH...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 41 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago