Homework Answers
Spontaneity is anything which is sudden action expressing superiority
Description is any form which explains in a systematic way like a strategy
Provisionalisim is a way of finding things in a right way like certainty
Problem orientation is getting familiar with the expected event and finding solutions to it in firm of evaluation
Equality is a process of being same to all like neutrality
Empathy is placing oneself in others position and thinking and having a control on it
Add Answer to:
Match the following characteristics of Supportive Communication with its corresponding characteristic of Defensive Communication. Spontaneity 1....
BE4-2 Match each of the following components of internal control with its description. Components of Internal...
BE4-2 Match each of the following components of internal control with its description. Components of Internal Control a. Procedures for maintaining ser b. Routine activities that are meai 1. Control environment 2. Risk assessment 3. Control activities 4. Information and communication 5. Monitoring c. Transfer of data from lower ma d. Formal policies to evaluate inte e. Overall attitude of the company
Q3- Match the following structures to the corresponding IR spectra? explain the characteristic peaks write the...
Q3- Match the following structures to the corresponding IR spectra? explain the characteristic peaks write the approximate wave number of each important peak? A- ОН H3C H CH3 HC CH3 H3CCH2 LLO THINSMETTENCE 4000 2000 SOO HAVENUFIRERI- 1- Corresponding structure THE CANCER Sodo con AVENUMBER: Eur . D'a 2- Corresponding structure TRANSMETTANCEIXI dugo 3000 150 1000 HAVENUMBERI 3- Corresponding structure TRANSMETTENCES 2000 000 HAVENUMBERI- 4- Corresponding structure immmmm THANSNETENCEI21 2000 eoOo sua NAVENURSERI- 5- Corresponding structure TRENSMETTENCEI21 1000 200 saa...
Matching (10% . each 2%) Match the qualitative characteristics below with the following statements (Each qualitativ...
Matching (10% . each 2%) Match the qualitative characteristics below with the following statements (Each qualitative characteristic can use more than one time) A. Timeliness F. Predictive value B. Completeness G. Neutrality C. Free from crror H. Confirmatory value D. Understandability I. Verifiability E. Comparability J. Materiality 1. 2. An item is not reported because its effect on income would not change a decision Information about an economic phenomenon that changes past or present expectations based on previous evaluations. Issuance...
Match the hydrogen indicated with an arrow in each of the following compounds with its corresponding...
Match the hydrogen indicated with an arrow in each of the following compounds with its corresponding splitting pattern (multiplicity): H H < 1. S 2. d < 3. t H 4. O 5. dd 6. dt
HW 17, Problem 3. Compute the characteristic values and corresponding characteristic vectors of the given matrix....
HW 17, Problem 3.
Compute the characteristic values and corresponding
characteristic vectors of the given matrix. Write the vectors in
their general form and give a specific numerical example. Also
prove that if A is the given original Matrix and D, is its
diagonization matrix then A and D are similar.
4 1 6 6 3 2 -5 -2
Attempt Results Ent (1 point) Match the following with the corresponding description. Type the correct letter...
Attempt Results Ent (1 point) Match the following with the corresponding description. Type the correct letter in each box. 1. distribution 2. height 3. race 4. GPA A. values a variable takes and how often it takes those values B. an example of a quantitative variable C. an example of a categorical variable Note: Preview My Answers Submit Answers You have attempted this problem 0 times. You have unlimited attermpts remaining.
what choice is correct for each one? Next to the following list of eight characteristics of...
what choice is correct for each one?
Next to the following list of eight characteristics of business organizations, select a brief description of how each characteristic applies to corporations. Characteristic Descriptions 1. Legal status 2 Mutual agency 3. Owner authority and control 4 Owner liability Entity with similar rights as individual Stockholders cannot bind corporation to contracts 5 Tax status of income 6. Transferability of ownership Shareholders elect board of directors 7. Ability to raise large capital amounts 8 Duration...
Match the following terms to their definitions. (Match each definition with the letter of its corresponding...
Match the following terms to their definitions. (Match each definition with the letter of its corresponding term. Abbreviation used: EUP=equivalent units of production) (Click on the icon to view the definitions.) 1 Definitions "osts, 1. Direct labor plus manufacturing overhead 2. Prepared by department for EUP, production costs, and assignment of costs 3. Equivalent units of production 4. Process costing system 5. Transferred in costs 6. Weighted-average method a. b. c. d. e. 1. Expresses partially completed units in terms...
Next to the following list of eight characteristics of business organizations, select a brief description of...
Next to the following list of eight characteristics of business organizations, select a brief description of how each characteristic applies to corporations. Descriptions High because buying stock is attractive Characteristic 1. Ability to raise large capital amounts 2. Duration of life 3. Government regulation 4. Legal status 5. Mutual agency 6. Owner authority and control 7. Owner liability 8. Tax status of income High because buying stock is attractive Indefinite More severe than partnerships and proprietorships Entity with similar rights...
1. Match the following formed element of the blood with its distinguishing morphological characteristic. Basophil Eosinophil...
1. Match the following formed element of the blood with its distinguishing morphological characteristic. Basophil Eosinophil Erythrocyte Lymphocyte Monocyte Neutrophil A. Anucleate B. Kidney shaped nucleus C. Large nuclear to cytoplasmic ratio D. Orange cytoplasmic granules E. Purple cytoplasmic granules F. Segmented nucleus with 3-5 lobes
BE4-2 Match each of the following components of internal control with its description. Components of Internal Control a. Procedures for maintaining ser b. Routine activities that are meai 1. Control environment 2. Risk assessment 3. Control activities 4. Information and communication 5. Monitoring c. Transfer of data from lower ma d. Formal policies to evaluate inte e. Overall attitude of the company
Q3- Match the following structures to the corresponding IR spectra? explain the characteristic peaks write the approximate wave number of each important peak? A- ОН H3C H CH3 HC CH3 H3CCH2 LLO THINSMETTENCE 4000 2000 SOO HAVENUFIRERI- 1- Corresponding structure THE CANCER Sodo con AVENUMBER: Eur . D'a 2- Corresponding structure TRANSMETTANCEIXI dugo 3000 150 1000 HAVENUMBERI 3- Corresponding structure TRANSMETTENCES 2000 000 HAVENUMBERI- 4- Corresponding structure immmmm THANSNETENCEI21 2000 eoOo sua NAVENURSERI- 5- Corresponding structure TRENSMETTENCEI21 1000 200 saa...
Matching (10% . each 2%) Match the qualitative characteristics below with the following statements (Each qualitative characteristic can use more than one time) A. Timeliness F. Predictive value B. Completeness G. Neutrality C. Free from crror H. Confirmatory value D. Understandability I. Verifiability E. Comparability J. Materiality 1. 2. An item is not reported because its effect on income would not change a decision Information about an economic phenomenon that changes past or present expectations based on previous evaluations. Issuance...
Match the hydrogen indicated with an arrow in each of the following compounds with its corresponding splitting pattern (multiplicity): H H < 1. S 2. d < 3. t H 4. O 5. dd 6. dt
HW 17, Problem 3.
Compute the characteristic values and corresponding
characteristic vectors of the given matrix. Write the vectors in
their general form and give a specific numerical example. Also
prove that if A is the given original Matrix and D, is its
diagonization matrix then A and D are similar.
4 1 6 6 3 2 -5 -2
Attempt Results Ent (1 point) Match the following with the corresponding description. Type the correct letter in each box. 1. distribution 2. height 3. race 4. GPA A. values a variable takes and how often it takes those values B. an example of a quantitative variable C. an example of a categorical variable Note: Preview My Answers Submit Answers You have attempted this problem 0 times. You have unlimited attermpts remaining.
what choice is correct for each one?
Next to the following list of eight characteristics of business organizations, select a brief description of how each characteristic applies to corporations. Characteristic Descriptions 1. Legal status 2 Mutual agency 3. Owner authority and control 4 Owner liability Entity with similar rights as individual Stockholders cannot bind corporation to contracts 5 Tax status of income 6. Transferability of ownership Shareholders elect board of directors 7. Ability to raise large capital amounts 8 Duration...
Match the following terms to their definitions. (Match each definition with the letter of its corresponding term. Abbreviation used: EUP=equivalent units of production) (Click on the icon to view the definitions.) 1 Definitions "osts, 1. Direct labor plus manufacturing overhead 2. Prepared by department for EUP, production costs, and assignment of costs 3. Equivalent units of production 4. Process costing system 5. Transferred in costs 6. Weighted-average method a. b. c. d. e. 1. Expresses partially completed units in terms...
Next to the following list of eight characteristics of business organizations, select a brief description of how each characteristic applies to corporations. Descriptions High because buying stock is attractive Characteristic 1. Ability to raise large capital amounts 2. Duration of life 3. Government regulation 4. Legal status 5. Mutual agency 6. Owner authority and control 7. Owner liability 8. Tax status of income High because buying stock is attractive Indefinite More severe than partnerships and proprietorships Entity with similar rights...
1. Match the following formed element of the blood with its distinguishing morphological characteristic. Basophil Eosinophil Erythrocyte Lymphocyte Monocyte Neutrophil A. Anucleate B. Kidney shaped nucleus C. Large nuclear to cytoplasmic ratio D. Orange cytoplasmic granules E. Purple cytoplasmic granules F. Segmented nucleus with 3-5 lobes
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago