What is the major product of the following reaction?
Please explain why there is not
a retention of configuration for the ethyl. I get that this is an
E1 elimination. That the NaoMe has to take from the beta carbon
attached to the ethyl because that is the anto-periplanar hydrogen.
What I dont understand is why the ethyl group changes and why
answer C is not the answer. Thank you!
Homework Answers
Add Answer to:
What is the major product of the following reaction?
Please explain why there is not
a...
What is the major product of the following E2 reaction? Please explain. What is the major...
What is the major product of the following E2 reaction? Please
explain.
What is the major product of the follow ing E2 reaction? heat > Product (s) но- CН3CHCH2CH3 Br А) Н н CH3CH2CC Н в) С Н3СН2СH-CH2 C) CНЗ CНЗ С-C Н н D) CH 3C CH2 CНЗ E) Н СНЗ CНЗ Н
What major product forms from the following E2 elimination reaction? Answer options: Question 4 1.5 pts...
What major product forms from the following E2
elimination reaction?
Answer options:
Question 4 1.5 pts What major product forms from the following E2 elimination reaction? CH3 Br excess KOH ethanol, heat CH3 Hints: (1) Please be sure you understand where the possible anti-periplanar eliminations can occur for this substituted cyclohexane. Therefore, it is recommended that you convert the starting alkyl halide into its chair structural representation. (2) The ring beta-proton should be trans to the alpha-halogen leaving group in...
What is the major product of the following reactions? Question 4 What is the major product...
What is the major product of the following
reactions?
Question 4 What is the major product of the following reaction? H2CO Br NaOEU/EtOH CHM 2210 Question 5 What is the major product of the following reaction? NaO Me/MeOH Question 6: What is the major product of the following reaction? NaBr, H20 Question 7 What is the major product of the following reaction? NaoMe, MeOH Br
Questions: What is the major product of the following reaction? NaOme/MeOH Question 6: What is the...
Questions: What is the major product of the following reaction? NaOme/MeOH Question 6: What is the major product of the following reaction? NaBr, H20
Name: 1 What is the major product of the following reaction? (CHдЬсo (CHЊ,сон Br IV A) I B) II C) III D) IV 2. What...
Name: 1 What is the major product of the following reaction? (CHдЬсo (CHЊ,сон Br IV A) I B) II C) III D) IV 2. What is the major elimination product obtained from the following reaction? NaOMe MeOH Br IV A) I B) II C) III D) IV 3. Which of the following is the most reactive substrate in an E2 reaction? CHiCH(Br)CH2CHs (CHs)sCBr CH3Br CH3CH2CH2CH2Br п ш IV I B) II С) ш D) IV A) I 4 Which of...
6) Predict the major product in each of the following reactions and indicate if it came...
6) Predict the major product in each of the following reactions and indicate if it came from an Sn1, S2, E1, or E2 reaction. H3C Br NaOme CH3 H2O H Br MeOH 'BUOK H Br DMSO H3C Br NaOme CH3 H20 MeOH H OTS ЕКОН
Predict the major product for the following reaction: NaOH H2O
Predict the major product for the following reaction: NaOH H2O Predict the major product for the following reaction: NaoMe MeOH
What is the major product of the following reaction sequence involving glycolic acid (HOCH2COOH) as the...
What is the major product of the following reaction sequence
involving glycolic acid (HOCH2COOH) as the starting
material?
I understand why Thionyl chloride gets rid of the hydroxyl group
on the carboxylic acid and substitutes it for the chlorine. But,
I have no clue where the extra
carbon came in. I know the answer is D, but I was wondering if it
is possible to show the mechanism as well to help me visualize what
exactly is going on. ?...
D)IIs Tastest with tertary nalides 28) What is the major elimination product obtained from the following...
D)IIs Tastest with tertary nalides 28) What is the major elimination product obtained from the following reaction? Br MeOH IV B) II C) III 29) Which of the following is the least reactive substrate in an E2 reaction? Cl Cl Cl CI IV A) I B) II C) III D) IV
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос...
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
What is the major product of the following E2 reaction? Please
explain.
What is the major product of the follow ing E2 reaction? heat > Product (s) но- CН3CHCH2CH3 Br А) Н н CH3CH2CC Н в) С Н3СН2СH-CH2 C) CНЗ CНЗ С-C Н н D) CH 3C CH2 CНЗ E) Н СНЗ CНЗ Н
What major product forms from the following E2
elimination reaction?
Answer options:
Question 4 1.5 pts What major product forms from the following E2 elimination reaction? CH3 Br excess KOH ethanol, heat CH3 Hints: (1) Please be sure you understand where the possible anti-periplanar eliminations can occur for this substituted cyclohexane. Therefore, it is recommended that you convert the starting alkyl halide into its chair structural representation. (2) The ring beta-proton should be trans to the alpha-halogen leaving group in...
What is the major product of the following
reactions?
Question 4 What is the major product of the following reaction? H2CO Br NaOEU/EtOH CHM 2210 Question 5 What is the major product of the following reaction? NaO Me/MeOH Question 6: What is the major product of the following reaction? NaBr, H20 Question 7 What is the major product of the following reaction? NaoMe, MeOH Br
Questions: What is the major product of the following reaction? NaOme/MeOH Question 6: What is the major product of the following reaction? NaBr, H20
Name: 1 What is the major product of the following reaction? (CHдЬсo (CHЊ,сон Br IV A) I B) II C) III D) IV 2. What is the major elimination product obtained from the following reaction? NaOMe MeOH Br IV A) I B) II C) III D) IV 3. Which of the following is the most reactive substrate in an E2 reaction? CHiCH(Br)CH2CHs (CHs)sCBr CH3Br CH3CH2CH2CH2Br п ш IV I B) II С) ш D) IV A) I 4 Which of...
6) Predict the major product in each of the following reactions and indicate if it came from an Sn1, S2, E1, or E2 reaction. H3C Br NaOme CH3 H2O H Br MeOH 'BUOK H Br DMSO H3C Br NaOme CH3 H20 MeOH H OTS ЕКОН
What is the major product of the following reaction sequence
involving glycolic acid (HOCH2COOH) as the starting
material?
I understand why Thionyl chloride gets rid of the hydroxyl group
on the carboxylic acid and substitutes it for the chlorine. But,
I have no clue where the extra
carbon came in. I know the answer is D, but I was wondering if it
is possible to show the mechanism as well to help me visualize what
exactly is going on. ?...
D)IIs Tastest with tertary nalides 28) What is the major elimination product obtained from the following reaction? Br MeOH IV B) II C) III 29) Which of the following is the least reactive substrate in an E2 reaction? Cl Cl Cl CI IV A) I B) II C) III D) IV
What is the major product of the following reaction? Hy(excess) Lindlar's cat. A B D Ос B A D What is the major product of the following reaction? Cl2 Н,0 НО СІ. A \ Он С В с D CI CI ОН ОН Ов ОА D с What is the major product of the following reaction? CH3 нс Н сH,CH, NaNH2 DMSO Br А В CH3 CHCH3 9 CH3 с CH,CH H4C. D нс CH2CH3 CH3 "NH, нс Сн HECH...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 22 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago