dDetermine E∘E∘, ΔG∘ΔG∘, and KK for the overall reaction from
the balanced half-reactions and their standard reduction
potentials.4Fe3++2H2O −⇀↽− 4Fe2++O2+4H+
Homework Answers
Add Answer to:
dDetermine E∘E∘, ΔG∘ΔG∘, and KK for the overall reaction from
the balanced half-reactions and their standard...
For the following reactions, determine E°, ΔG°, and K, given the balanced half reactions and the...
For the following reactions, determine E°, ΔG°, and K, given the balanced half reactions and the standard reduction potentials. Also, determine if the reaction is spontaneous as written. A) 2 Co3++ H3AsO3+ H2O 2 Co2++ H3AsO4+ 2H+ Co3++ e- Co2+ E°= 1.920 V H3AsO4+ 2H++ 2 e-H3AsO3+ H2O E°= 0.575 V Answer: (E° = 1.345 V; K = 2.95 x 1045; ΔG° = -2.60 x 105J; spontaneous) B) 4 Fe3++ 2 H2O 4Fe2++ O2+ 4 H+ Fe3++ e- Fe2+ E°= 0.771 V ½ O2+ 2...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red = +0.96 V red0.763 v NO, (ag)+4H(a)+3eNoo)+2 H,Ow Zan2+ (aq)+2e- → Zn(s) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written. Do...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential =...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential = +0.771 V Fe'+ (aq)+e — Fe2+(aq) N2(9)+4 H20(1)+44 → N2H4(aq)+4 OH(aq) Eed=-1.16 V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written....
Question 2 (1 point) Given the following half reactions with their corresponding standard reduction potentials, which...
Question 2 (1 point) Given the following half reactions with their corresponding standard reduction potentials, which of the following is/are true for the overall reaction happening under standard conditions? S+ 2H+ + 2e + H2S E' = -0.243 V Fe3+ + e + Fe2+ E'' - 0.771 V (CHECK THE ONE(S) THAT IS/ARE CORRECT) 1) Fe3+ has a greater affinity for electrons than S. 2) AE'O = 1.014 V for the spontaneous reaction. 3) Fe2+ is the reducing agent. 4)...
The following two half-reactions are found in a table of standard reduction potentials: Half-Reaction E cytochrome...
The following two half-reactions are found in a table of standard reduction potentials: Half-Reaction E cytochrome c1(Fe3+) +e- → cytochrome c1 (Fe2+) 0.22 V lipoic acid + 2 H+ + 2 e- → dihydrolipoic acid -0.29 V + What is value of Eº for the reaction that will occur involving these two half-reactions that will be spontaneous under standard conditions? 0 0.73 V 0 0.07 V O 0.51 V -0.07 V
A chem igns a galvanic cell that uses these two half reactions: standard reduction potential half-reaction...
A chem igns a galvanic cell that uses these two half reactions: standard reduction potential half-reaction (aq)+4 H,0(1)+3e" → Cr(OH)2(3)+50H (aq) cro Ered=-0.13 V Fe?+ (aq)+e → Fe2+ (aq) E = +0.771 V Answer the following questions about this cell. 0-0 0 Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. X 5 Write a balanced equation for the overall reaction that powers the cell....
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction cof(aq)+4H2O()+3e_ → Cr(OH)3(s)+50H-(aq)| Fe...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction cof(aq)+4H2O()+3e_ → Cr(OH)3(s)+50H-(aq)| Fe (a)teFe() standard reduction potential E d=-0.13 V E01" +0.771 V 2 + Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written Check...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential E+0.771 V...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential E+0.771 V red =-0.13 V half-reaction Fe3+(aq)+e- → Fe2+(aq) CrO-(aq) +4 H.,0@t 3e-→ Cr(OH) 3(s)+5 OHJaq) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as...
Write a balanced overall reaction from these unbalanced half-reactions Sn and Ag
Write a balanced overall reaction from these unbalanced half-reactions. Sn --> Sn^2+ Ag+ -->Ag
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential MnO2...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential MnO2 (s) + 4H+ (aq) +2e−→ Mn+2 ( aq) +2H2O(l) =E0red+1.23V Cl2 (g) +2e−→ 2Cl− (aq) =E0red+1.359V Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as...
A chemist designs a galvanic cell that uses these two half-reactions half-reaction standard reduction potential red = +0.96 V red0.763 v NO, (ag)+4H(a)+3eNoo)+2 H,Ow Zan2+ (aq)+2e- → Zn(s) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written. Do...
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction standard reduction potential = +0.771 V Fe'+ (aq)+e — Fe2+(aq) N2(9)+4 H20(1)+44 → N2H4(aq)+4 OH(aq) Eed=-1.16 V Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written....
Question 2 (1 point) Given the following half reactions with their corresponding standard reduction potentials, which of the following is/are true for the overall reaction happening under standard conditions? S+ 2H+ + 2e + H2S E' = -0.243 V Fe3+ + e + Fe2+ E'' - 0.771 V (CHECK THE ONE(S) THAT IS/ARE CORRECT) 1) Fe3+ has a greater affinity for electrons than S. 2) AE'O = 1.014 V for the spontaneous reaction. 3) Fe2+ is the reducing agent. 4)...
The following two half-reactions are found in a table of standard reduction potentials: Half-Reaction E cytochrome c1(Fe3+) +e- → cytochrome c1 (Fe2+) 0.22 V lipoic acid + 2 H+ + 2 e- → dihydrolipoic acid -0.29 V + What is value of Eº for the reaction that will occur involving these two half-reactions that will be spontaneous under standard conditions? 0 0.73 V 0 0.07 V O 0.51 V -0.07 V
A chem igns a galvanic cell that uses these two half reactions: standard reduction potential half-reaction (aq)+4 H,0(1)+3e" → Cr(OH)2(3)+50H (aq) cro Ered=-0.13 V Fe?+ (aq)+e → Fe2+ (aq) E = +0.771 V Answer the following questions about this cell. 0-0 0 Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. X 5 Write a balanced equation for the overall reaction that powers the cell....
A chemist designs a galvanic cell that uses these two half-reactions: half-reaction cof(aq)+4H2O()+3e_ → Cr(OH)3(s)+50H-(aq)| Fe (a)teFe() standard reduction potential E d=-0.13 V E01" +0.771 V 2 + Answer the following questions about this cell. Write a balanced equation for the half-reaction that happens at the cathode. Write a balanced equation for the half-reaction that happens at the anode. Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as written Check...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential E+0.771 V red =-0.13 V half-reaction Fe3+(aq)+e- → Fe2+(aq) CrO-(aq) +4 H.,0@t 3e-→ Cr(OH) 3(s)+5 OHJaq) Answer the following questions about this cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous as...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 14 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago