assign common and IUPAC names for the following ethers Chia. Cft3 CH₃ -CH₂-CH-O-CH-CH₂CH₃ CH3 CH3 CH3CH2CH-0—CHCH2CH3
4. assign common and IUPAC names for the following ethers 5. answer the following questions using complete sentences 6. assign IUPAC names to the following aldehydes and keytones *ketones CH,CH,CH- 0- CHCH,CH, 5. Answer the following questions using complete sentences: a. Why does hydrogen bonding not take place between molecule of aldehydes or ketones b. The boiling point of propanal is 49°C, whereas the boiling point of propanol is 97 °C. Explain this difference in boiling points. 6. Assign IUPAC...
Section 13.2 Ethers Give the IUPAC AND 'common names (when it exists) for the following: HOMHED IUPAC COMMON 13. CH3CH2CH OCH CH3CH2O 14. CH2 CHCH2CH2CH3 14.
CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C H2CH2CH3 CH3-CH2-CH2-C-CH2-CH2-C-CH3 H2 CH₂ CH₂ H CH2CH3
Be sure to answer all parts. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3
Provide IUPAC or IUPAC accepted (common) names to the following alaalala CH3 CH3COH on tam HOCH2CH2OH wie gen om waaropuerto CH3 HOCH2CHCH2OH OH он CH₃ OH CH3CHycнснаснсня CHCH3 CH OH
Give both IUPAC names and common names for the following compounds. (a) PhCH,CH,COOH (b) PCO,K (c) (CH3),CHCHBCOOH (d) HOOCCH,CH(CH3)CO,H (e) (CH3)2CHCH,COONa (f) CHCH(NH4)CH-COOH COOH Br in Loo Me" COOH 0) "CHOV COOH
8. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH,COOLI Enter your answer here
Assign IUPAC names for each of the following compounds: НН CH3 2 CH3 (b) H H CH3 CH3 CH3
write the common and systematic (IUPAC) names of the ether that has the following structure CH3---O---CH2CH3 Common name: Systematic name:
Name the following cycloalkenes using IUPAC (systematic) names CH3 Нас, CH3 CH Нас