Homework Answers
IUPAC NOMENCLATURE of organic compounds.
Add Answer to:
3. (8 pts) Assign unambiguous syste structures. unambiguous systematic names to each of the following parent:...
1. (9 pts) Assign a systematic name for each of the following compounds:
1. (9 pts) Assign a systematic name for each of the following compounds:
Give IUPAC names for the following compounds: Draw structures corresponding to each of the given names....
Give IUPAC names for the following compounds: Draw structures corresponding to each of the given names. A. 2-phenyl-2-propanol B. 2, 3-diphenyl-2-hexene C. 2-hydroxyacetophenone D. 5, 5-dimcthyl-l, 3, 6-cycloheptatriene-l-carboxylicacid E. Acetic anhydride
(3 pts) Provide 2 acceptable names for the molecule below. If you provide a systematic name,...
(3 pts) Provide 2 acceptable names for the molecule below. If you provide a systematic name, include the appropriate R or S designation in the name. (2 pts) Provide a systematic name for the molecule below. (2 pts) Indicate whether the listed solvent is protic or aprotic. a. tert-butanol [(CH3)3COH] b. formamide (HCONH2]
Provide IUPAC names for each of the following structures: Draw structures corresponding to each of the...
Provide IUPAC names for each of the following structures: Draw structures corresponding to each of the following names: 6. 2-propenamide 7. 3,4,5-trimethoxybenzoyl chloride 8. acetic formic anhydride 9. N,N-dimethylformamide 10. methyl cis-3-ethylcyclobutanecarboxylate 11. (E)-2,4-dimethyl-2-hexenoyl chloride
please help 3. Please draw the structures for the major product(s) from each of the following...
please help
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2 pts for each) (a) O2N NH2 NO2 (b) NAOCH3 OCH3 CHон (c) pyridine -NH2 + S-Cl (d) HOH CHO Br2 HO H Нао H OH H-OH CH2OH (e) Hао* Ph H (f) N2HA H (hint: cyclization)
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2...
3. Give good systematic names of the following. Include E,Z nomenclature if necessary. Parts A-C 4....
3. Give good systematic names of the following. Include E,Z
nomenclature if necessary. Parts A-C
4. Identify the following as nucleophiles (Nu) or
electrophiles (E). Figures 1-5
bve good systematic names for the following. Include E,Z nomenclature if necessary. a. b. C. Cl 4. Identify the following as nucleophiles (Nu) or electrophiles (E) Ho (CHa) C H20 BF3
1. Name the following or Draw the Structure (2 x 3 pts each) a. N-methyl-3-phenylpentan-2-amine OH...
1. Name the following or Draw the Structure (2 x 3 pts each) a. N-methyl-3-phenylpentan-2-amine OH b. OH NH2O 2. Draw the starting materials for the following hydrolysis reactions. (3 pts each) 1. NaOH, H2O a. 3-or 2. HCI, H2O OH OH Ph 1. NaOH, H2O b. HO Н. CH3 OH HPh 2. HCI, H2O 3. Of the following, which form would actually exist at: (5 points) a) pH = 2 (acidic) b) pH = 7 (neutral) c) pH =...
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
write condensed structures fore each of the following compounds Homework Problems 7.1 Write condensed structures for...
write condensed structures fore each of the following
compounds
Homework Problems 7.1 Write condensed structures for each of the following compounds: a. 2,2,4-trimethylpentane b. 5-isopropyl-2-methyloctane c. 1,1,3,3-tetrabromopropane d. 1,1-dichlorocyclopentane e. 1,4-diethylcyclohexane f. 1-bromo-2-methylcyclobutane What are the IUPAC names of the following compounds? 7.2 CH2CH, CH3 a) CH, C CH, CH, CH СH,CH, сн, CH2CH, b) CH2CH d) (CH),CCH2CH e) F Br Br Write the structural formulas and names for FOUR isomers of cycloalkane, CSH10. 7.3 7.4 Propose structures for molecules...
4) The following compounds are incorrectly named. Provide correct systematic names for each a. 2-methyl-2-ethylpropane b....
4) The following compounds are incorrectly named. Provide correct systematic names for each a. 2-methyl-2-ethylpropane b. 2,6-diethylcyclohexane c. 1-bromo-3-isopropylpentane d. 5-fluoro-8-methyl-3-tert-butylnonane
1. (9 pts) Assign a systematic name for each of the following compounds:
Give IUPAC names for the following compounds: Draw structures corresponding to each of the given names. A. 2-phenyl-2-propanol B. 2, 3-diphenyl-2-hexene C. 2-hydroxyacetophenone D. 5, 5-dimcthyl-l, 3, 6-cycloheptatriene-l-carboxylicacid E. Acetic anhydride
(3 pts) Provide 2 acceptable names for the molecule below. If you provide a systematic name, include the appropriate R or S designation in the name. (2 pts) Provide a systematic name for the molecule below. (2 pts) Indicate whether the listed solvent is protic or aprotic. a. tert-butanol [(CH3)3COH] b. formamide (HCONH2]
Provide IUPAC names for each of the following structures: Draw structures corresponding to each of the following names: 6. 2-propenamide 7. 3,4,5-trimethoxybenzoyl chloride 8. acetic formic anhydride 9. N,N-dimethylformamide 10. methyl cis-3-ethylcyclobutanecarboxylate 11. (E)-2,4-dimethyl-2-hexenoyl chloride
please help
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2 pts for each) (a) O2N NH2 NO2 (b) NAOCH3 OCH3 CHон (c) pyridine -NH2 + S-Cl (d) HOH CHO Br2 HO H Нао H OH H-OH CH2OH (e) Hао* Ph H (f) N2HA H (hint: cyclization)
3. Please draw the structures for the major product(s) from each of the following reactions and include stereochemistry where appropriate. (2...
3. Give good systematic names of the following. Include E,Z
nomenclature if necessary. Parts A-C
4. Identify the following as nucleophiles (Nu) or
electrophiles (E). Figures 1-5
bve good systematic names for the following. Include E,Z nomenclature if necessary. a. b. C. Cl 4. Identify the following as nucleophiles (Nu) or electrophiles (E) Ho (CHa) C H20 BF3
1. Name the following or Draw the Structure (2 x 3 pts each) a. N-methyl-3-phenylpentan-2-amine OH b. OH NH2O 2. Draw the starting materials for the following hydrolysis reactions. (3 pts each) 1. NaOH, H2O a. 3-or 2. HCI, H2O OH OH Ph 1. NaOH, H2O b. HO Н. CH3 OH HPh 2. HCI, H2O 3. Of the following, which form would actually exist at: (5 points) a) pH = 2 (acidic) b) pH = 7 (neutral) c) pH =...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
write condensed structures fore each of the following
compounds
Homework Problems 7.1 Write condensed structures for each of the following compounds: a. 2,2,4-trimethylpentane b. 5-isopropyl-2-methyloctane c. 1,1,3,3-tetrabromopropane d. 1,1-dichlorocyclopentane e. 1,4-diethylcyclohexane f. 1-bromo-2-methylcyclobutane What are the IUPAC names of the following compounds? 7.2 CH2CH, CH3 a) CH, C CH, CH, CH СH,CH, сн, CH2CH, b) CH2CH d) (CH),CCH2CH e) F Br Br Write the structural formulas and names for FOUR isomers of cycloalkane, CSH10. 7.3 7.4 Propose structures for molecules...
4) The following compounds are incorrectly named. Provide correct systematic names for each a. 2-methyl-2-ethylpropane b. 2,6-diethylcyclohexane c. 1-bromo-3-isopropylpentane d. 5-fluoro-8-methyl-3-tert-butylnonane
Most questions answered within 3 hours.
-
Humans have used horses for transportation for millions of
years. Therefore, they will use horses for...
asked 1 hour ago -
The following are the Jensen Corporation's unit costs of making
and selling an item at a...
asked 2 hours ago -
Does direct Medicare reimbursement of Advanced practice nurses
increase access to their services?
asked 2 hours ago -
List and explain why a company would choose to use a
published
compensation survey vs. creating...
asked 3 hours ago -
A discrete random variable X can take values from 1 to 10. Find
the variance of...
asked 3 hours ago -
The primary financial goal of a corporation is to maximize:
shareholders wealth.
earnings per share.
stock...
asked 3 hours ago -
determine whether the vectors u=(1,2,3,), v=(-2,1,0) and
w=(1,0,1) are linearly dependent or independent.
asked 3 hours ago -
python
Define a function called print_values which takes a dictionary
object as a parameter. The function...
asked 4 hours ago -
In Chapter 1 you created a program named Triangle in
which you displayed a seven-line triangle...
asked 4 hours ago -
Research question: What are the differences between separately
stated and non separately stated transactions in an...
asked 4 hours ago -
By using Arduino write a code that connects two LEDs to two
push-buttons. Each button controls...
asked 5 hours ago -
Bank of America has bonds that pay a coupon interest rate of 5.5
percent and mature...
asked 6 hours ago