______________________________________________________________________
Homework Answers
![جمعيG Initially [NOBY)= 0.697M . [no] = 4.22x10-2M = 0.0422 . Br₂ = 6.50810- 2M = 0.0650m Ke= 5.48810-4. 2 No Bolo) 200 (g) +](http://img.homeworklib.com/questions/7a1db3c0-73d7-11ea-8f8d-275d37aad80b.png?x-oss-process=image/resize,w_560)
Please
give a thumbs-up.
Do comment if any doubt occurs
Thank you
Best of luck
Add Answer to:
______________________________________________________________________
Methanol, CH, OH, formerly known as wood alcohol, is manufactured commercially by the following reaction:...
A mixture of carbon monoxide, hydrogen, and methanol, CH, OH, is at equilibrium according to the...
A mixture of carbon monoxide, hydrogen, and methanol, CH, OH, is at equilibrium according to the equation CO(g) + 2H2 (9) = CH3OH(9) At 270°C, the mixture is 5.0 x 10-2 M CO.0.760 M H2, and 9.8 x 10-3 M CH3OH What is Ke for this reaction at 270°C? Ke= When 0.125 mol of NO and 18.50 g of bromine are placed in a 1.00-L reaction vessel and sealed, the mixture is heated to 350 K and the following equilibrium...
[Review Topics) [References) At a particular temperature, K = 6.8 x 10-7 for the following balanced...
[Review Topics) [References) At a particular temperature, K = 6.8 x 10-7 for the following balanced reaction: 2NOBr(g) → 2NO(g) + Br2(g) In an experiment in which 1.0 mol of NOBr is placed in a 2.0-L vessel, what are the equilibrium concentrations of all gases? NOBr] M [NO] = M ET [Br2] M Submit Answer Retry Entire Group 9 more group attempts remaining
5-10 The data below refer to the following reaction: 2NO(g) + Brz(g) 2NOBr(g) [NO] 2.5 [Brz] Concentration (M) Initial...
5-10 The data below refer to the following reaction: 2NO(g) + Brz(g) 2NOBr(g) [NO] 2.5 [Brz] Concentration (M) Initial Equilibrium [NOBr] 5.0 1.0 2.0 Calculate Kc Ans: 0.12 5-11 The AG of atomic oxygen is 230.1 kJ/mol. Determine the equilibrium constant for the following reaction at standard thermodynamic conditions: O2(g) 52 0(g). A) 4.7 x 10-41 B) 2.3 x 10-61 C) 2.1 x 10-81 D) 2.1 x 1040 E) 4.5 x 1080
I need help with all three please and thank you! 1. In the following reaction at...
I need help with all three please and thank you!
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COC12(g) CO(g) + Cl2(g) A) reaction will shift to the right B) reaction will shift to the left C) nothing will happen D) the equilibrium constant will change E) not enough information given to predict 2. The following reaction is exothermic (with A and B reactants) and at equilibrium. What will happen if heat is...
For the following reaction, 0.500 M of COCl2 is placed in a reaction vessel. Calculate the...
For the following reaction, 0.500 M of COCl2 is placed in a reaction vessel. Calculate the equilibrium concentrations of all gases at equilibrium. COCl2(g) 2 CO(g) + Cl2(g) Kc = 1.70 x 10-4 4 NH3(g) + 3 O2(g) = 2 N2(g) + 6 H2O(g) When 0.256 g of NH3 and 0.480 g if O2 are initially placed in a 1.00 L container at a certain temperature, the N2 concentration at equilibrium is 1.96 x 10 M. Calculate K, for the...
2. For the reaction: A(g) +B(g) = 2C(g) K = 1.0 x 10-5 at 25°C When...
2. For the reaction: A(g) +B(g) = 2C(g) K = 1.0 x 10-5 at 25°C When equilibrium was reached at 25°C, the equilibrium concentrations of the reactant gases were: [A] = 2.5 x10-2M [B] = 2.0 x 10- M Calculate the equilibrium concentration of the product gas C? 3. At a certain temperature the reaction has an equilibrium constant of 0.400. CO(g) + H2O(g) = CO2(g) + H2(g) When 1.50 mol of carbon dioxide gas and 1.50 mol of hydrogen...
At a particular temperature, K = 6.8 x 10-7 for the following balanced reaction: 2503 (9)...
At a particular temperature, K = 6.8 x 10-7 for the following balanced reaction: 2503 (9) ► 2002 (9) + O2(9) In an experiment in which 2.5 mol of SO3 is placed in a 4.0-L vessel, what are the equilibrium concentrations of all gases? [SO3) = M [SO2) = м (O2) = M
(Review Toples) [References At a particular temperature, K = 2.1 x 10-7 for the following balanced...
(Review Toples) [References At a particular temperature, K = 2.1 x 10-7 for the following balanced reaction: 200,(g) 200(9) + O2(g) In an experiment in which 2.0 mol of CO, is placed in a 3.0-L vessel, what are the equilibrium concentrations of all gases? (CO2) M (CO) = M 103) - M Submit Answer Retry Entire Group 9 more group attempts remaining
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u...
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u IIULS reaction: CÓ (g) + 3 H (g) + CH4 (g) + H2O (G) 1. At 25°C, Keq=4.0. What must be the Co] at equilibrium If the equilibrium concentrations of [H.]= 2.0M. (CH) = 5.0M, and (HO) = 3.OM? Answer: 0.469 M The ICE table is a way to keep track of what is happening in the reaction vessel. The initial concentrations if given...
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COCI:(9)...
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COCI:(9) CO(g) + Cl (9) A) reaction will shift to the right B) reaction will shift to the left C) nothing will happen D) the equilibrium constant will change E) not enough information given to predict 2. The following reaction is exothermic (with A and B reactants) and at equilibrium. What will happen if heat is added? A+B 2 C + D A) more C...
A mixture of carbon monoxide, hydrogen, and methanol, CH, OH, is at equilibrium according to the equation CO(g) + 2H2 (9) = CH3OH(9) At 270°C, the mixture is 5.0 x 10-2 M CO.0.760 M H2, and 9.8 x 10-3 M CH3OH What is Ke for this reaction at 270°C? Ke= When 0.125 mol of NO and 18.50 g of bromine are placed in a 1.00-L reaction vessel and sealed, the mixture is heated to 350 K and the following equilibrium...
[Review Topics) [References) At a particular temperature, K = 6.8 x 10-7 for the following balanced reaction: 2NOBr(g) → 2NO(g) + Br2(g) In an experiment in which 1.0 mol of NOBr is placed in a 2.0-L vessel, what are the equilibrium concentrations of all gases? NOBr] M [NO] = M ET [Br2] M Submit Answer Retry Entire Group 9 more group attempts remaining
5-10 The data below refer to the following reaction: 2NO(g) + Brz(g) 2NOBr(g) [NO] 2.5 [Brz] Concentration (M) Initial Equilibrium [NOBr] 5.0 1.0 2.0 Calculate Kc Ans: 0.12 5-11 The AG of atomic oxygen is 230.1 kJ/mol. Determine the equilibrium constant for the following reaction at standard thermodynamic conditions: O2(g) 52 0(g). A) 4.7 x 10-41 B) 2.3 x 10-61 C) 2.1 x 10-81 D) 2.1 x 1040 E) 4.5 x 1080
I need help with all three please and thank you!
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COC12(g) CO(g) + Cl2(g) A) reaction will shift to the right B) reaction will shift to the left C) nothing will happen D) the equilibrium constant will change E) not enough information given to predict 2. The following reaction is exothermic (with A and B reactants) and at equilibrium. What will happen if heat is...
For the following reaction, 0.500 M of COCl2 is placed in a reaction vessel. Calculate the equilibrium concentrations of all gases at equilibrium. COCl2(g) 2 CO(g) + Cl2(g) Kc = 1.70 x 10-4 4 NH3(g) + 3 O2(g) = 2 N2(g) + 6 H2O(g) When 0.256 g of NH3 and 0.480 g if O2 are initially placed in a 1.00 L container at a certain temperature, the N2 concentration at equilibrium is 1.96 x 10 M. Calculate K, for the...
2. For the reaction: A(g) +B(g) = 2C(g) K = 1.0 x 10-5 at 25°C When equilibrium was reached at 25°C, the equilibrium concentrations of the reactant gases were: [A] = 2.5 x10-2M [B] = 2.0 x 10- M Calculate the equilibrium concentration of the product gas C? 3. At a certain temperature the reaction has an equilibrium constant of 0.400. CO(g) + H2O(g) = CO2(g) + H2(g) When 1.50 mol of carbon dioxide gas and 1.50 mol of hydrogen...
At a particular temperature, K = 6.8 x 10-7 for the following balanced reaction: 2503 (9) ► 2002 (9) + O2(9) In an experiment in which 2.5 mol of SO3 is placed in a 4.0-L vessel, what are the equilibrium concentrations of all gases? [SO3) = M [SO2) = м (O2) = M
(Review Toples) [References At a particular temperature, K = 2.1 x 10-7 for the following balanced reaction: 200,(g) 200(9) + O2(g) In an experiment in which 2.0 mol of CO, is placed in a 3.0-L vessel, what are the equilibrium concentrations of all gases? (CO2) M (CO) = M 103) - M Submit Answer Retry Entire Group 9 more group attempts remaining
Consider the following reaction for Questions 1.3 and answer the questions based upon this GU u IIULS reaction: CÓ (g) + 3 H (g) + CH4 (g) + H2O (G) 1. At 25°C, Keq=4.0. What must be the Co] at equilibrium If the equilibrium concentrations of [H.]= 2.0M. (CH) = 5.0M, and (HO) = 3.OM? Answer: 0.469 M The ICE table is a way to keep track of what is happening in the reaction vessel. The initial concentrations if given...
1. In the following reaction at equilibrium, what will happen if more CO(g) is added? COCI:(9) CO(g) + Cl (9) A) reaction will shift to the right B) reaction will shift to the left C) nothing will happen D) the equilibrium constant will change E) not enough information given to predict 2. The following reaction is exothermic (with A and B reactants) and at equilibrium. What will happen if heat is added? A+B 2 C + D A) more C...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 56 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago