Homework Answers
Add Answer to:
can someone explain why this is the answer??
9. (2 pts) Circle the compound most likely...
please explain/walkthrough! Problem 1 (30 pts) a) Circle the radical that is most stable. b) Order...
please explain/walkthrough!
Problem 1 (30 pts) a) Circle the radical that is most stable. b) Order the compounds in terms of increasing oxidation state (1 highest, 3- lowest) он c) The reaction below is an example of.... heat 2 b) substitution a) addition d) heterolytic cleavage c) homolytic cleavage d) Circle the compound with the most acidic protons. H H c=C CHз CH3CH2CH3 Нас-СЕС-н H
1) Examine the structures below. Circle the compound(s) that would be most likely to yield a...
1) Examine the structures below. Circle the compound(s) that would be most likely to yield a positive ferric chloride test. СНа OH H3C CH2 CH3 CH3-CH-CH2 | HO -CH он он CH (C) (D) (A) HzĆ CH3 (B) 2) What is the IUPAC name of molecule (D) in question number one? YOH CH3
please explain in details why each one of these is the right answer? 9 pts). Circle...
please explain in details why each one of these is the
right answer?
9 pts). Circle the expected major PRODUCT for each of the following sequence of reactions. 1) BH 2) HO PCC OL Hc A dation PRODUCT CH, HOS CH H, CH он 1 BUNA Hạ – =C=CH- BC PRODUCT er CH, . CH H. " ci H. нс нас" Br/ BB BC ang fra H cocitts HỌC-C=c- NaNH, A 5 , B HO, PRODUCT CH - C HAC-C=C...
organic chemistry answer is D. Can someone please explain why? 3. Which reaction would proceed the...
organic chemistry
answer is D.
Can someone please explain why?
3. Which reaction would proceed the fastest? (A) CH3CH2OCH2 + OH → CH3CH2OH + COCH3 (B) CH2CH2SCHz + OH → CH3CH2OH + SCH; (C) CH3CH2N(CH3)2 + OH -- CH3CH2OH + "N(CH3)2 (D) O CH3CH2OSC6H.CH3 + OH - © CHỊCH,OH + OSCH,CH
vmerize to form very large molecules by itself? 21. Which compound is MOST LIKELY to be...
vmerize to form very large molecules by itself? 21. Which compound is MOST LIKELY to be able to polymerize OH A. CH3-C B. CH2=CHCI C. CH3—0-CH3 E. C2H5NH2 D. CH 3 CH 2 OH
please explain how i know which is faster I. (15 pts) A. (9 pts) In each...
please explain how i know which is faster
I. (15 pts) A. (9 pts) In each of the following pairs, circle the compound, which reacts faster or has the larger (more favorable) equilibrium constant for the indicated reaction H. OCH20% CH3 H CH C cid-catalyzed hydrolysis H ocH2CH3 23 why?? equilibrium constant 3 CH3 r hydration 3 aceto 3,3-dimethyl-2 butanone
2). Consider the following intramolecular S2 reaction. no ♡ + HI A) (5 pts) Use the...
2). Consider the following intramolecular S2 reaction. no ♡ + HI A) (5 pts) Use the table of Bond Dissociation Enthalpies (at the back of the exam) to calculate the approximate ΔΗπη. B) (3 pts) Is the reaction endothermic or exothermic? Why? C) (6 pts) Draw the Reaction Energy Coordinate Diagram. Label the axes, reactant(s), product(s), transition state(s), intermediate(s), activation energy, and reaction enthalpy. D) (3 pts) In regards to entropy, would you expect the reaction to be favorable, or...
Can someone explain this please? I got completely the opposite answer Stereolengo The following reactions were...
Can someone explain this please? I got completely the opposite
answer
Stereolengo The following reactions were taken from thesywhesis of TTN. нсон, CH₃ : Ph O ОН о Pho OH 0 Compound H Me Me Me Me Compound G 2) BF3 Et,0 no Stereocenter Me Me Compound I = Compound J A asymmet!! Which compounds in this reaction are chiral? (Circle all that apply.) 2pt Compound G Compound H Compound Compound J How are Compounds I and J related to...
Can you please explain why For each compound below, circle the letter which corresponds to the...
Can
you please explain why
For each compound below, circle the letter which corresponds to the best description of its reactivity in electrophilic aromatic substitution (a) More reactive than Ph-OMe (b) More reactive than Ph-O-CO-Me but less than PhoMe (c) More reactive than Ph-H but less than PhO-CO-Me (d) Less reactive than Ph-H but more than Ph-CO2H (e) Less reactive than Ph-CO2H a a b b c c d d e e 16. 17. 18. 19. Ph-NH2 is Ph-N"Mez is...
& PREDICT Product b) state whether (Sni, Sn 2, E, Ez) is Most likely c) EXPLAIN...
& PREDICT Product b) state whether (Sni, Sn 2, E, Ez) is Most likely c) EXPLAIN WHY 'Br NaOH Water Heat B (CH₂), CHBr + CH₃ CH₂OH © von Br NCN ethanol, Water 3) ₂ C Br CH₂ CH₃ + Kt-OC (CH₂)₂ CH3)3 COH
please explain/walkthrough!
Problem 1 (30 pts) a) Circle the radical that is most stable. b) Order the compounds in terms of increasing oxidation state (1 highest, 3- lowest) он c) The reaction below is an example of.... heat 2 b) substitution a) addition d) heterolytic cleavage c) homolytic cleavage d) Circle the compound with the most acidic protons. H H c=C CHз CH3CH2CH3 Нас-СЕС-н H
1) Examine the structures below. Circle the compound(s) that would be most likely to yield a positive ferric chloride test. СНа OH H3C CH2 CH3 CH3-CH-CH2 | HO -CH он он CH (C) (D) (A) HzĆ CH3 (B) 2) What is the IUPAC name of molecule (D) in question number one? YOH CH3
please explain in details why each one of these is the
right answer?
9 pts). Circle the expected major PRODUCT for each of the following sequence of reactions. 1) BH 2) HO PCC OL Hc A dation PRODUCT CH, HOS CH H, CH он 1 BUNA Hạ – =C=CH- BC PRODUCT er CH, . CH H. " ci H. нс нас" Br/ BB BC ang fra H cocitts HỌC-C=c- NaNH, A 5 , B HO, PRODUCT CH - C HAC-C=C...
organic chemistry
answer is D.
Can someone please explain why?
3. Which reaction would proceed the fastest? (A) CH3CH2OCH2 + OH → CH3CH2OH + COCH3 (B) CH2CH2SCHz + OH → CH3CH2OH + SCH; (C) CH3CH2N(CH3)2 + OH -- CH3CH2OH + "N(CH3)2 (D) O CH3CH2OSC6H.CH3 + OH - © CHỊCH,OH + OSCH,CH
vmerize to form very large molecules by itself? 21. Which compound is MOST LIKELY to be able to polymerize OH A. CH3-C B. CH2=CHCI C. CH3—0-CH3 E. C2H5NH2 D. CH 3 CH 2 OH
please explain how i know which is faster
I. (15 pts) A. (9 pts) In each of the following pairs, circle the compound, which reacts faster or has the larger (more favorable) equilibrium constant for the indicated reaction H. OCH20% CH3 H CH C cid-catalyzed hydrolysis H ocH2CH3 23 why?? equilibrium constant 3 CH3 r hydration 3 aceto 3,3-dimethyl-2 butanone
2). Consider the following intramolecular S2 reaction. no ♡ + HI A) (5 pts) Use the table of Bond Dissociation Enthalpies (at the back of the exam) to calculate the approximate ΔΗπη. B) (3 pts) Is the reaction endothermic or exothermic? Why? C) (6 pts) Draw the Reaction Energy Coordinate Diagram. Label the axes, reactant(s), product(s), transition state(s), intermediate(s), activation energy, and reaction enthalpy. D) (3 pts) In regards to entropy, would you expect the reaction to be favorable, or...
Can someone explain this please? I got completely the opposite
answer
Stereolengo The following reactions were taken from thesywhesis of TTN. нсон, CH₃ : Ph O ОН о Pho OH 0 Compound H Me Me Me Me Compound G 2) BF3 Et,0 no Stereocenter Me Me Compound I = Compound J A asymmet!! Which compounds in this reaction are chiral? (Circle all that apply.) 2pt Compound G Compound H Compound Compound J How are Compounds I and J related to...
Can
you please explain why
For each compound below, circle the letter which corresponds to the best description of its reactivity in electrophilic aromatic substitution (a) More reactive than Ph-OMe (b) More reactive than Ph-O-CO-Me but less than PhoMe (c) More reactive than Ph-H but less than PhO-CO-Me (d) Less reactive than Ph-H but more than Ph-CO2H (e) Less reactive than Ph-CO2H a a b b c c d d e e 16. 17. 18. 19. Ph-NH2 is Ph-N"Mez is...
& PREDICT Product b) state whether (Sni, Sn 2, E, Ez) is Most likely c) EXPLAIN WHY 'Br NaOH Water Heat B (CH₂), CHBr + CH₃ CH₂OH © von Br NCN ethanol, Water 3) ₂ C Br CH₂ CH₃ + Kt-OC (CH₂)₂ CH3)3 COH
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 39 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago