Homework Answers
Add Answer to:
When a 7.50 g sample of hydrated LiClO, is heated to drive off all the water,...
4. When a 7.50 g sample of hydrated LiClo, is heated to drive off all the...
4. When a 7.50 g sample of hydrated LiClo, is heated to drive off all the water, the anhydrous residue that remains has a mass of 4.97 g. What is the mass percent of water in the hydrate?
A hydrated form of copper sulfate (CuSO4⋅?H2O) is heated to drive off all of the water....
A hydrated form of copper sulfate (CuSO4⋅?H2O) is heated to drive off all of the water. If there is initially 7.28 g of hydrated salt and there is 4.07 g of anhydrous CuSO4 after heating, find the number of water molecules associated with each CuSO4 formula unit. x = ?
5. A 1.547 g sample of CuSO, XH,O is heated to drive off the water leaving...
5. A 1.547 g sample of CuSO, XH,O is heated to drive off the water leaving behind 0.989 g of anhydrous Cuso, What is the value of x for this hydrate?
A hydrated form of copper sulfate (CuSO4 xH,O) is heated to drive off all of the...
A hydrated form of copper sulfate (CuSO4 xH,O) is heated to drive off all of the water. If there is initially 9.22 g of hydrated salt and there is 5.89 g of anhydrous CuSo, after heating, find the number of water molecules associated with each CUSO4 formula unit.
An experiment was performed to determine the percentage water content in a hydrated compound. A 15.67...
An experiment was performed to determine the percentage water content in a hydrated compound. A 15.67 g sample of a hydrate, magnesium carbonate was heated, without decomposing the carbonate, to drive off the water. The mass was reduced to 7.58 g. What is the percent water content?
15.67 g sample of a hydrate of magnesium carbonate was heated, without decomposing the carbonate, to drive off the water. The mass was reduced to 7.58 g. What is the formula of the hydrate? Name the hydrate
15.67 g sample of a hydrate of magnesium carbonate was heated, without decomposing the carbonate, to drive off the water. The mass was reduced to 7.58 g. What is the formula of the hydrate? Name the hydrate
A student heated a sample of a hydrated salt and obtained the following data: Grams of...
A student heated a sample of a hydrated salt and obtained the following data: Grams of hydrated salt used: 1.0000 gram Grams of anhydrous salt (147 g/mole) recovered: 0.8033 grams Grams of water vapour (18 g/mole) lost: 0.1967 grams Determine the percentage by mass of water in this hydrate. (1) How many water molecules, "X", are bonded to this hydrated salt, salt. X H20? (2)
A 1.803-g sample of gypsum, a hydrated salt of calciumsulfate, CaSO4, is heated in a crucible until a constantmass is...
A 1.803-g sample of gypsum, a hydrated salt of calciumsulfate, CaSO4, is heated in a crucible until a constantmass is reached. The mass of the anhydrous CaSO4 salt is1.426-g. Calculate the percent by mass of water in the hydratedcalcium sulfate salt. Also, calculate the moles of water removedand the moles of anhydrous CaSO4 remaining in thecrucible. And, finally, What is the formula of the hydrated calciumsulfate; that is, what is the whole-number mole ratio of calciumsulfate to water? Please show...
Question five A 15.67 g sample of a hydrate of magnesium carbonate ( MOONH:O) was heated without decomposite the car...
Question five A 15.67 g sample of a hydrate of magnesium carbonate ( MOONH:O) was heated without decomposite the carbonate, to drive off the water. The mass was reduced to 7.58 g (Molar mass of MgCO: - 84313 Smol) (5 mark) A. What is the formula of the hydrate? B. Determine the percentate in the hydrated sit
1. How would you determine if you have heated the sample long enough to drive off...
1. How would you determine if you have heated the sample long enough to drive off all the water from the hydrate? 2. A compound is made of 30.9% of Cu, 13.6 % Si, and 55.5% F. a. What is the empirical formula of the anhydrous salt? b. 1.00 gram of this compound is subject to high moisture environment. The resulting hydrate weighs 1.53 grams. What is the formula of the hydrate?
4. When a 7.50 g sample of hydrated LiClo, is heated to drive off all the water, the anhydrous residue that remains has a mass of 4.97 g. What is the mass percent of water in the hydrate?
5. A 1.547 g sample of CuSO, XH,O is heated to drive off the water leaving behind 0.989 g of anhydrous Cuso, What is the value of x for this hydrate?
A hydrated form of copper sulfate (CuSO4 xH,O) is heated to drive off all of the water. If there is initially 9.22 g of hydrated salt and there is 5.89 g of anhydrous CuSo, after heating, find the number of water molecules associated with each CUSO4 formula unit.
A student heated a sample of a hydrated salt and obtained the following data: Grams of hydrated salt used: 1.0000 gram Grams of anhydrous salt (147 g/mole) recovered: 0.8033 grams Grams of water vapour (18 g/mole) lost: 0.1967 grams Determine the percentage by mass of water in this hydrate. (1) How many water molecules, "X", are bonded to this hydrated salt, salt. X H20? (2)
Question five A 15.67 g sample of a hydrate of magnesium carbonate ( MOONH:O) was heated without decomposite the carbonate, to drive off the water. The mass was reduced to 7.58 g (Molar mass of MgCO: - 84313 Smol) (5 mark) A. What is the formula of the hydrate? B. Determine the percentate in the hydrated sit
1. How would you determine if you have heated the sample long enough to drive off all the water from the hydrate? 2. A compound is made of 30.9% of Cu, 13.6 % Si, and 55.5% F. a. What is the empirical formula of the anhydrous salt? b. 1.00 gram of this compound is subject to high moisture environment. The resulting hydrate weighs 1.53 grams. What is the formula of the hydrate?
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 56 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago