Determine how many electrons there are in total in your body and what is the total...
Determine how many electrons there are in total in your body and what is the total electrical charge of these electrons. Keep in mind that most of the atoms in your body have the same number of electrons, protons and neutrons. Consider the average composition of the human body of 75 kilograms mass as: 65% Oxygen, 19% Carbon, 10% Hydrogen, 3% Nitrogen, 2% Calcium and 1% Phosphorus. The atomic number of Oxygen is 8 and its atomic mass is 16 g / Mol, of Carbon 6 and 12 g / Mol, of Hydrogen 1 and 1 g / Mol, of Nitrogen 7 and 14 g / Mol, of Calcium 20 and 40 g / Mol, from Phosphorus 15 and 31 g / Mol. Tip: Calculate the mass in grams of each element that your body contains. Then calculate the number of moles contained in each element and finally calculate the number of atoms and electrons of each element that your body has.
Homework Answers
Add Answer to:
Determine how many electrons there are in total in your body and
what is the total...
B) Theories must be testable; hypotheses do not need to be testable. CHypotheses are educated guesses,...
B) Theories must be testable; hypotheses do not need to be testable. CHypotheses are educated guesses, and theories are tentative explanations. D) Hypotheses are derived from experimentation, whereas theories are derived from observation. 12) A) Water is an example of an element. B Nitrogen C) Glucose D) Salt 13) What are the four most common elements found in living organisms? A) nitrogen, oxygen, phosphorus, and carbon carbon, oxygen, nitrogen, and hydrogen C) carbon, oxygen, potassium, and calcium D) oxygen, calcium,...
These questions are to guide your studying. They do not cover all of the topics that...
These questions are to guide your studying. They do not cover all of the topics that may be on exams. Using the Internet, find out how many isotopes of Carbon exist in nature. Which are the three most abundant? Consult a periodic table. Determine the atomic numbers and mass numbers for: An atom of oxygen with 8 neutrons. An atom of Phosphorus with two more neutrons than protons. An atom of Aluminum with 14 neutrons.^32P is an unstable isotope of...
Atoms and Isotopes 1 Activity: Atoms and Isotopes Why? Atoms and isotopes are identified by the...
Atoms and Isotopes 1 Activity: Atoms and Isotopes Why? Atoms and isotopes are identified by the numbers of protons, electrons, and neutrons that they contain The number of protons, electrons, and neutrons in atoms determines the chemical properties of the elements .A knowledge of the number of protons and electrons in an atom will help you understand how atoms combine to form molecules Identify the composition of atoms in terms of protons, neutrons, and electrons Use atomic symbols to represent...
64Chapter 7 Atomic Number and Atomie Mass The Periodie Table of Elements contains th and atomie...
64Chapter 7 Atomic Number and Atomie Mass The Periodie Table of Elements contains th and atomie wumber of protons, e atomic m number of each element. These numbbers indicate the neutrons, and electrons in each element's basic wtructure Each aquare in the Periodic Table represents an element There are two numbers in each square 3 Alomic Number The smaller number at the top of the box is the atomic number The number at the bottom of the box is the...
1. what is the name of element, for this symbol Fe, the atomic number, mass number, protons,neutrons, electrons 2. what...
1. what is the name of element, for this symbol Fe, the atomic number, mass number, protons,neutrons, electrons 2. what is the name of element, symbol, atomic number, when mass number is 27,electrons 13, complete for protons, neutrons. 3. what is the name of elements, symbols, atomic number, mass number, when protons is 19, neutrons 20, find the electrons. 4. what is the symbol for Bromine, what is atomic number, protons, neutrons, electrons when the mass number is 80. 5....
17. Identify the elements that have the following electron arrangements: b. 2,8,6 а. 2,4 c. 2,8,8...
17. Identify the elements that have the following electron arrangements: b. 2,8,6 а. 2,4 c. 2,8,8 d. 2,1 f. 2,8, е. 2,8 g. 2,8,8,2 18. Write the group number and draw the electron-dot symbol for each of the following elements: a. sulfur b. nitrogen c. calcium d. sodium 19. The atomic number of an atom is equal to the number of A) neutrons plus protons B) nuclei C) electrons plus protons E) neutrons D) protons 20. The number of neutrons...
20) Which statement is NOT true about ionic bonds? A) An ionic bond occurs between positive...
20) Which statement is NOT true about ionic bonds? A) An ionic bond occurs between positive ions and negative ions. B) Electrons are completely lost or gained in ion formation An ion has the same number of electrons as a nonionic atom of the same element. D) A salt such as NaCl is formed by an ionic reaction. 21) Which of the following would be a proposed mechanism by which stomach antacids work? A) Antacids are bases and by definition...
1- an atom has the following chemical symbol: 114Cd a- how many protons does this atom...
1- an atom has the following chemical symbol: 114Cd a- how many protons does this atom have? b- how many neutrons does this atom have? c- how many electrons does this atom have? 2- an ion has 33 protons, 41 neutrons, and 36 electrons a- what is the mass number of this atom? b- what is the symbol for this ion? enter both mass and the atomic number 3- which of these ions has the same number of electrons as...
II. Isotopes Atoms of a given element all have the same number of protons and electrons,...
II. Isotopes Atoms of a given element all have the same number of protons and electrons, but can have different numbers of neutrons. Versions of the same element with differing numbers of neutrons are call isotopes. The symbol for an isotope is AX Where: A is the mass number (number of protons plus neutrons) Z is the atomic number (number of protons) X is the symbol for the element 2. Show the isotope symbol for the isotope of Fe with...
Ø Atte How many valence electrons do atoms of each of the elements have? Na: 1...
Ø Atte How many valence electrons do atoms of each of the elements have? Na: 1 Hint Check Answ Determine the number of valence electrons in each of the neutral atoms. carbon: nitrogen: oxygen: iodine: phosphorus:
B) Theories must be testable; hypotheses do not need to be testable. CHypotheses are educated guesses, and theories are tentative explanations. D) Hypotheses are derived from experimentation, whereas theories are derived from observation. 12) A) Water is an example of an element. B Nitrogen C) Glucose D) Salt 13) What are the four most common elements found in living organisms? A) nitrogen, oxygen, phosphorus, and carbon carbon, oxygen, nitrogen, and hydrogen C) carbon, oxygen, potassium, and calcium D) oxygen, calcium,...
These questions are to guide your studying. They do not cover all of the topics that may be on exams. Using the Internet, find out how many isotopes of Carbon exist in nature. Which are the three most abundant? Consult a periodic table. Determine the atomic numbers and mass numbers for: An atom of oxygen with 8 neutrons. An atom of Phosphorus with two more neutrons than protons. An atom of Aluminum with 14 neutrons.^32P is an unstable isotope of...
Atoms and Isotopes 1 Activity: Atoms and Isotopes Why? Atoms and isotopes are identified by the numbers of protons, electrons, and neutrons that they contain The number of protons, electrons, and neutrons in atoms determines the chemical properties of the elements .A knowledge of the number of protons and electrons in an atom will help you understand how atoms combine to form molecules Identify the composition of atoms in terms of protons, neutrons, and electrons Use atomic symbols to represent...
64Chapter 7 Atomic Number and Atomie Mass The Periodie Table of Elements contains th and atomie wumber of protons, e atomic m number of each element. These numbbers indicate the neutrons, and electrons in each element's basic wtructure Each aquare in the Periodic Table represents an element There are two numbers in each square 3 Alomic Number The smaller number at the top of the box is the atomic number The number at the bottom of the box is the...
17. Identify the elements that have the following electron arrangements: b. 2,8,6 а. 2,4 c. 2,8,8 d. 2,1 f. 2,8, е. 2,8 g. 2,8,8,2 18. Write the group number and draw the electron-dot symbol for each of the following elements: a. sulfur b. nitrogen c. calcium d. sodium 19. The atomic number of an atom is equal to the number of A) neutrons plus protons B) nuclei C) electrons plus protons E) neutrons D) protons 20. The number of neutrons...
20) Which statement is NOT true about ionic bonds? A) An ionic bond occurs between positive ions and negative ions. B) Electrons are completely lost or gained in ion formation An ion has the same number of electrons as a nonionic atom of the same element. D) A salt such as NaCl is formed by an ionic reaction. 21) Which of the following would be a proposed mechanism by which stomach antacids work? A) Antacids are bases and by definition...
II. Isotopes Atoms of a given element all have the same number of protons and electrons, but can have different numbers of neutrons. Versions of the same element with differing numbers of neutrons are call isotopes. The symbol for an isotope is AX Where: A is the mass number (number of protons plus neutrons) Z is the atomic number (number of protons) X is the symbol for the element 2. Show the isotope symbol for the isotope of Fe with...
Ø Atte How many valence electrons do atoms of each of the elements have? Na: 1 Hint Check Answ Determine the number of valence electrons in each of the neutral atoms. carbon: nitrogen: oxygen: iodine: phosphorus:
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 26 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 57 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago