Homework Answers
Add Answer to:
EXPERIMENT 10 DATE NAME POSTLABORATORY ASSIGNMENT 1. What is the density of xenon gas at standard...
step by step please EXPERIMENT 10 DATE y lonelisto TODPNAME SECTION OEM omdat POSTLABORATORY ASSIGNMENT 1....
step by step please
EXPERIMENT 10 DATE y lonelisto TODPNAME SECTION OEM omdat POSTLABORATORY ASSIGNMENT 1. What is the density of xenon gas at standard conditions? 2. What is the volume that is occupied by 0.819 g of helium at standard conditions? Robin 3. Ozone, a component of smog, is a toxic substance that consists of only oxygen atoms. If ozone has a density of 2.1 g/L at standard conditions, then what is the chemical formula of ozone? Hint: Determine...
Analysis of Vinegar EXPERIMENT NAME SECTION DATE POSTLABORATORY ASSIGNMENT 1. A standard nitric acid solution is...
Analysis of Vinegar EXPERIMENT NAME SECTION DATE POSTLABORATORY ASSIGNMENT 1. A standard nitric acid solution is prepared using 0.425 g of sodium carbonate, NaCO3. Find the molarity of the acid if 33.25 mL are required to reach a permanent endpoint. 2 HNO, (aq) + Na2CO3(s) + 2 NaNO3(aq) + H2O(l) + CO2(g) 2 H OT 2. A 10.0-ml sample of household ammonia solution required 27.50 mL of 0.241 M HNO3 for neutralization. Calculate (a) the molar concentration of the ammonia...
name Prelaboratory Assignment: Gas Laws Technical objective: A flask with a sample of gas at room...
name Prelaboratory Assignment: Gas Laws Technical objective: A flask with a sample of gas at room temperature and pressure weighs 97.4842 g. The same flask with air (density 1.17 g/L) weighs 96.8848 g. The same flask filled with water ( 0.998 g/mL) weighs 345.86 g. The pressure in the room is 0.989 atm and the temperature is 22.2°C. 1. Calculate the volume of the flask. 2. Calculate the mass of the air that the flask can hold. 3. Calculate the...
Name: Section: Gas Law Practice (IC-6) 1. At what temperature will 5.00 g of Cl, exert...
Name: Section: Gas Law Practice (IC-6) 1. At what temperature will 5.00 g of Cl, exert a pressure of 900. torrat a volume of 750 ml? 2. What pressure will be exerted by 25 g of CO, at a temperature of 25 "C and a volume of 500 mL? 3. Find the number of grams of CO, that exert a pressure of 785 torrs at a volume of 32.5 L and a temperature of 32°C 4. An elemental gas has...
Part 1. The air in a bicycle tire is bubbled through water and collected at 25∘C. If the total volume of gas collected i...
Part 1. The air in a bicycle tire is bubbled through water and collected at 25∘C. If the total volume of gas collected is 5.60 L at a temperature of 25∘C and a pressure of 760 torr, how many moles of gas were in the bicycle tire? - Part 2. A 295-mL flask contains pure helium at a pressure of 755 torr . A second flask with a volume of 480 mL contains pure argon at a pressure of 714...
1. What is the unit usually used for expressing the density of a gas? 2. Under...
1. What is the unit usually used for expressing the
density of a gas?
2. Under normal conditions of temperature and pressure, what is the
density of water? Show units.
3. If a substance has a mass of 75g and a volume of 250ml, what is
it's density? Show all work and include units.
4. Define temperature. What instrument do we use to measure
temperature?
5.
b. Under normal conditions of temperature and pressure rations of temperature and pressure, what...
Problems Section 1. A 0.678 gram sample of gas occupies 0.214 L at standard conditions, what...
Problems Section 1. A 0.678 gram sample of gas occupies 0.214 L at standard conditions, what is the molar mass of the gas? PronRT 1 (0,214) = NA 273.15 n = R-273.15 n=104,684 -:675 X=18 2. A sample of gas occupies 250 mL at 37°C and 730. torr, what volume would the gas occupy at standard conditions? ,250L 310k 730 + 20.5 10.0206-310 .216L n=0.0094396539 V nr. 273.15 = 2115 3. A 5.00 mL sample of an unknown liquid is...
1.) A gas is found to have a density of 3.165 g/L at STP. What is...
1.) A gas is found to have a density of 3.165 g/L at STP. What is its molar mass? Which of the following gases is it most likely to be? Molar Mass: _________ a. NH3 b. O2 c. Cl2 d. SF6 2.) Calculate the pressure exerted by 5.05 moles of NCl3 gas in a 20.00-L container at -205°C for a real gas. (for xenon: a= 42.63 atm·L2/mol2 and b= 0.2450 L/mol) 3.) Which of the following is NOT true in...
DISCUSSION QUESTIONS 1. If the liquid did not completely vaporize in the experiment, would the ap-...
DISCUSSION QUESTIONS 1. If the liquid did not completely vaporize in the experiment, would the ap- parent molecular weight be larger, smaller, or unchanged compared to that determined if the experiment had been properly performed? Would the error in part (1) have a larger, smaller, or the same effect as the errors that might be made in measuring the temperature of the water in the flask, the barometric pressure, or the volume of the flask? Explain your answer. 2. What...
1. At standard temperature and pressure, carbon dioxide has a density of 1.98 kg/m^3. What volume...
1. At standard temperature and pressure, carbon dioxide has a density of 1.98 kg/m^3. What volume (m3 ) does 1.75 kg of carbon dioxide occupy at standard temperature and pressure? 2.What mass of water (in kg) can be contained in a box whose dimensions are 225 mm by 225 mm by 401 mm? (Density of water = 1000 kg/m^3) 3.How much force (N) does the atmosphere exert on one side of a vertical wall 1.22 m high and 2.44 m...
step by step please
EXPERIMENT 10 DATE y lonelisto TODPNAME SECTION OEM omdat POSTLABORATORY ASSIGNMENT 1. What is the density of xenon gas at standard conditions? 2. What is the volume that is occupied by 0.819 g of helium at standard conditions? Robin 3. Ozone, a component of smog, is a toxic substance that consists of only oxygen atoms. If ozone has a density of 2.1 g/L at standard conditions, then what is the chemical formula of ozone? Hint: Determine...
Analysis of Vinegar EXPERIMENT NAME SECTION DATE POSTLABORATORY ASSIGNMENT 1. A standard nitric acid solution is prepared using 0.425 g of sodium carbonate, NaCO3. Find the molarity of the acid if 33.25 mL are required to reach a permanent endpoint. 2 HNO, (aq) + Na2CO3(s) + 2 NaNO3(aq) + H2O(l) + CO2(g) 2 H OT 2. A 10.0-ml sample of household ammonia solution required 27.50 mL of 0.241 M HNO3 for neutralization. Calculate (a) the molar concentration of the ammonia...
name Prelaboratory Assignment: Gas Laws Technical objective: A flask with a sample of gas at room temperature and pressure weighs 97.4842 g. The same flask with air (density 1.17 g/L) weighs 96.8848 g. The same flask filled with water ( 0.998 g/mL) weighs 345.86 g. The pressure in the room is 0.989 atm and the temperature is 22.2°C. 1. Calculate the volume of the flask. 2. Calculate the mass of the air that the flask can hold. 3. Calculate the...
Name: Section: Gas Law Practice (IC-6) 1. At what temperature will 5.00 g of Cl, exert a pressure of 900. torrat a volume of 750 ml? 2. What pressure will be exerted by 25 g of CO, at a temperature of 25 "C and a volume of 500 mL? 3. Find the number of grams of CO, that exert a pressure of 785 torrs at a volume of 32.5 L and a temperature of 32°C 4. An elemental gas has...
1. What is the unit usually used for expressing the
density of a gas?
2. Under normal conditions of temperature and pressure, what is the
density of water? Show units.
3. If a substance has a mass of 75g and a volume of 250ml, what is
it's density? Show all work and include units.
4. Define temperature. What instrument do we use to measure
temperature?
5.
b. Under normal conditions of temperature and pressure rations of temperature and pressure, what...
Problems Section 1. A 0.678 gram sample of gas occupies 0.214 L at standard conditions, what is the molar mass of the gas? PronRT 1 (0,214) = NA 273.15 n = R-273.15 n=104,684 -:675 X=18 2. A sample of gas occupies 250 mL at 37°C and 730. torr, what volume would the gas occupy at standard conditions? ,250L 310k 730 + 20.5 10.0206-310 .216L n=0.0094396539 V nr. 273.15 = 2115 3. A 5.00 mL sample of an unknown liquid is...
DISCUSSION QUESTIONS 1. If the liquid did not completely vaporize in the experiment, would the ap- parent molecular weight be larger, smaller, or unchanged compared to that determined if the experiment had been properly performed? Would the error in part (1) have a larger, smaller, or the same effect as the errors that might be made in measuring the temperature of the water in the flask, the barometric pressure, or the volume of the flask? Explain your answer. 2. What...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 36 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago