please explain thanksHomework Answers
Add Answer to:
please explain thanks
For the chemical equilibrium aA +bB 5 C , the value of the...
For the chemical equilibrium aA + bB doubleheadarrow cC, the value of the equilibrium constant, K,...
For the chemical equilibrium aA + bB doubleheadarrow cC, the value of the equilibrium constant, K, is 10 What is the value of the equilibrium constant for the following reaction? cC doubleheadarrow aA + bB 1 0.10 100 10 - 10
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g), Kc = 3.2 Find the equilibrium concentrations...
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g), Kc = 3.2 Find the equilibrium concentrations of A and B for a = 2 and b = 1. Assume that the initial concentration of A is 1.0 M and that no B is present at the beginning of the reaction. Express your answers using two significant figures separated by a comma.
Learning Goal: To understand how to calculate the equilibrium constants for chemical equations that can be...
Learning Goal: To understand how to calculate the equilibrium constants for chemical equations that can be produced by the addition of other chemical equations with known equilibrium constants. For a chemical reaction equation with the general form aA+bB⇌cC+dD the equilibrium equation is given by K1=[C]c[D]d[A]a[B]b Thus, for a chemical reaction equation with the general form cC+dD⇌eE+fF the equilibrium equation is given by K2=[E]e[F]f[C]c[D]d If the first two equations are added together such that aA+bB⇌eE+fF then the equilibrium equation is given...
please explain, thanks. Consider the following mechanism. A+Br- C equilibrium step 2: C+A→ D slow overall:...
please explain, thanks.
Consider the following mechanism. A+Br- C equilibrium step 2: C+A→ D slow overall: 2A B Determine te rate law for the overall reaction (where the overall rate constant is represented as k). rate =
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g), Kc = 3.7 A) Find the equilibrium...
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g), Kc = 3.7 A) Find the equilibrium concentrations of A and B for a=1 and b=1. Assume that the initial concentration of A is 1.0 M and that no B is present at the beginning of the reaction. B) Find the equilibrium concentrations of A and B for a=2 and b=2. Assume that the initial concentration of A is 1.0 M and that no B is present at the beginning of...
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g), Kc = 1.1 Find the equilibrium concentrations...
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g), Kc = 1.1 Find the equilibrium concentrations of A and B for a = 1 and b = 2. Assume that the initial concentration of A is 1.0 M and that no B is present at the beginning of the reaction. Express your answers using two significant figures separated by a comma.
At equilibrium, the concentrations of reactants and products can be predicted using the equilibrium constant, KcKcK_c,...
At equilibrium, the concentrations of reactants and products can be predicted using the equilibrium constant, KcKcK_c, which is a mathematical expression based on the chemical equation. For example, in the reaction aA+bB⇌cC+dDaA+bB⇌cC+dD where aaa, bbb, ccc, and ddd are the stoichiometric coefficients, the equilibrium constant is Kc=[C]c[D]d[A]a[B]bKc=[C]c[D]d[A]a[B]b where [A][A], [B][B], [C][C], and [D][D] are the equilibrium concentrations. If the reaction is not at equilibrium, the quantity can still be calculated, but it is called the reaction quotient, QcQcQ_c, instead of...
The general form of a chemical reaction is aA + bB = cC +dD Where A...
The general form of a chemical reaction is aA + bB = cC +dD Where A and B are reactants in the forward direction and C and D are products in the forward direction. The lower case letters are the stoichiometric coefficients for the balanced equation. The general form of the equilibrium constant equation is then: Keq = [C]c[D]d/[A]a[B]b Part I: Q vs. K Q: reaction quotient can be calculated for a reaction at any concentration values of reactants and...
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g) , Kc = 2.3 Part B Find...
Consider the following reaction and associated equilibrium constant: aA(g)⇌bB(g) , Kc = 2.3 Part B Find the equilibrium concentrations of A and B for a=2 and b=2 . Assume that the initial concentration of A is 1.0 M and that no B is present at the beginning of the reaction. Part C Find the equilibrium concentrations of A and B for a a = 2 and b = 1. Assume that the initial concentration of A is 1.0 M and...
5) For a particular chemical reaction it is found that the value for the equilibrium constant...
5) For a particular chemical reaction it is found that the value for the equilibrium constant for the reaction decreases as temperature increases. Based on this we can conclude a) AH> 0 b) AH 0 c) ASºren > 0 d) AS p < 0 e) AGO
For the chemical equilibrium aA + bB doubleheadarrow cC, the value of the equilibrium constant, K, is 10 What is the value of the equilibrium constant for the following reaction? cC doubleheadarrow aA + bB 1 0.10 100 10 - 10
please explain, thanks.
Consider the following mechanism. A+Br- C equilibrium step 2: C+A→ D slow overall: 2A B Determine te rate law for the overall reaction (where the overall rate constant is represented as k). rate =
5) For a particular chemical reaction it is found that the value for the equilibrium constant for the reaction decreases as temperature increases. Based on this we can conclude a) AH> 0 b) AH 0 c) ASºren > 0 d) AS p < 0 e) AGO
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 3 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago