Homework Answers
Option A is correct. The process is called fluorescence, in which the molecule has absorbed a photon of energy in the visible range and could move from the excited electronic state S1 to a highly excited vibrational level of the ground state.
Option D is wrong, Intersystem crossing takes place when molecule moved from S1 to an excited triplet state T1.
Option C is wrong, in vibrational relaxation during electronic excitation molecule promote to any of the vibrational states and then return to lower vibrational states.
Option B is wrong , internal conversion is the process in which molecule return to a lower ebergy states without emission of radiation.
Add Answer to:
A molecule which has absorbed a photon of energy in the visible range could move from...
true/false 1. Energy of absorbed photon equals energy of emitted photon. 2. Following emission, molecule returns...
true/false 1. Energy of absorbed photon equals energy of emitted photon. 2. Following emission, molecule returns to its lowest energy state by a series of rapid vibrational relaxations. 3. The lifetime of the excited vibrational states is about a femtosecond; the lifetime of the excited electronic state is generally longer than a nanosecond. 4. Photon absorption usually occurs when a molecule is in its ground electronic state.
(10 points) Draw a molecular energy diagram of the ground electronic state (S) and the first...
(10 points) Draw a molecular energy diagram of the ground electronic state (S) and the first excited state (Si) including some vibrational levels (V) in each electronic state. Show the following transitions on the diagram and briefly explain each transition (a) (b) @a resonant absorption fluorescence phosphorescence intersystem crossing non-radiative decay
multiple choice An electron in a certain atom could move from the ground state (E=E_O) 10...
multiple choice
An electron in a certain atom could move from the ground state (E=E_O) 10 points to the first excited state (E=E_1) inside an infinite well by absorbing photon with wavelength 1. If while in this excited state a photon the wavelength N2 is sent to the electron to be absorbed, to which energy state will the electron move? (Hint: energy of a photon is given by E=hf=hd where c is the speed of light) O E 2 O...
What is the energy of the photon that, when absorbed by a hydrogen atom, could cause...
What is the energy of the photon that, when absorbed by a hydrogen atom, could cause an electronic transition from the n = 1 state to the n = 4 state? What energy could cause an electronic transition from the n = 4 state to the n = 8 state?
What is the energy of the photon that, when absorbed by a hydrogen atom, could cause...
What is the energy of the photon that, when absorbed by a hydrogen atom, could cause the following? (a) an electronic transition from the n = 2 state to the n = 5 state eV (b) an electronic transition from the n = 3 state to the n = 8 state eV
1. Luminescence is because of Photons emitted while excited electrons drop down I Knocking out of...
1. Luminescence is because of Photons emitted while excited electrons drop down I Knocking out of electrons by photons Photons stimulated by photons O All 2. Internal conversion is where... The spin of an excited electron reverses, changing the state of the molecule (from singlet state to triplet state or vice versa) A molecule converts its excess energy to light, and emits a photon A molecule converts excess electronic energy to vibrational energy 3. Fluorescence typically occurs within 1055 10-5...
Identify the highest energy molecular process that occurs when a molecule absorbs a microwave photon. Identify...
Identify the highest energy molecular process that occurs when a molecule absorbs a microwave photon. Identify the highest energy molecular process that occurs when a molecule absorbs an infrared photon. O molecular rotation O bond breakage O molecular vibration O electronic excitation O molecular vibration O bond breakage O electronic excitation O molecular rotation Identify the highest energy molecular process that occurs when a molecule absorbs a visible photon. Identify the highest energy molecular process that occurs when a molecule...
Which of the following best explains what happens as photons of visible light are absorbed by...
Which of the following best explains what happens as photons of visible light are absorbed by dye molecules? Certain electrons in the dye molecule move to a higher energy level, with the difference in energy between the lower and higher energy levels being the same as the energy of the absorbed photons Certain chemical bonds in the dye molecules begin to bend and stretch with the difference in energy between the lower and higher vibrational states being the same as...
1. Riboflavin is an important nutrient required for a number of biochemical processes that produce energy...
1. Riboflavin is an important nutrient required for a number of biochemical processes that produce energy in our bodies. Which of the following statements about riboflavin is NOT true the yellow color of a riboflavin containing solution is due to the absorption of light by the sugar component of the molecule it name is derived from the two principal compounds that make up the molecule we know as riboflavin the heterocycering component is a type of avonoid vering component is...
could you please help me solving this. like and comment are rewarded. 1. A vacuum bubble...
could you please help me
solving this. like and comment are rewarded.
1. A vacuum bubble forms in a liquid and subsequently collapses. The liquid has density 1g em 3 and pressure equal to 1 standard atmosphere. The initial radius of the bubble is 2 mm. Using dimensional analysis, estimate the duration of the collapse. 2. An astronaut throws a small rock whilst standing on an open plain on Mars. Their hand is moving at approximately 60 km h -...
(10 points) Draw a molecular energy diagram of the ground electronic state (S) and the first excited state (Si) including some vibrational levels (V) in each electronic state. Show the following transitions on the diagram and briefly explain each transition (a) (b) @a resonant absorption fluorescence phosphorescence intersystem crossing non-radiative decay
multiple choice
An electron in a certain atom could move from the ground state (E=E_O) 10 points to the first excited state (E=E_1) inside an infinite well by absorbing photon with wavelength 1. If while in this excited state a photon the wavelength N2 is sent to the electron to be absorbed, to which energy state will the electron move? (Hint: energy of a photon is given by E=hf=hd where c is the speed of light) O E 2 O...
What is the energy of the photon that, when absorbed by a hydrogen atom, could cause an electronic transition from the n = 1 state to the n = 4 state? What energy could cause an electronic transition from the n = 4 state to the n = 8 state?
1. Luminescence is because of Photons emitted while excited electrons drop down I Knocking out of electrons by photons Photons stimulated by photons O All 2. Internal conversion is where... The spin of an excited electron reverses, changing the state of the molecule (from singlet state to triplet state or vice versa) A molecule converts its excess energy to light, and emits a photon A molecule converts excess electronic energy to vibrational energy 3. Fluorescence typically occurs within 1055 10-5...
Identify the highest energy molecular process that occurs when a molecule absorbs a microwave photon. Identify the highest energy molecular process that occurs when a molecule absorbs an infrared photon. O molecular rotation O bond breakage O molecular vibration O electronic excitation O molecular vibration O bond breakage O electronic excitation O molecular rotation Identify the highest energy molecular process that occurs when a molecule absorbs a visible photon. Identify the highest energy molecular process that occurs when a molecule...
Which of the following best explains what happens as photons of visible light are absorbed by dye molecules? Certain electrons in the dye molecule move to a higher energy level, with the difference in energy between the lower and higher energy levels being the same as the energy of the absorbed photons Certain chemical bonds in the dye molecules begin to bend and stretch with the difference in energy between the lower and higher vibrational states being the same as...
1. Riboflavin is an important nutrient required for a number of biochemical processes that produce energy in our bodies. Which of the following statements about riboflavin is NOT true the yellow color of a riboflavin containing solution is due to the absorption of light by the sugar component of the molecule it name is derived from the two principal compounds that make up the molecule we know as riboflavin the heterocycering component is a type of avonoid vering component is...
could you please help me
solving this. like and comment are rewarded.
1. A vacuum bubble forms in a liquid and subsequently collapses. The liquid has density 1g em 3 and pressure equal to 1 standard atmosphere. The initial radius of the bubble is 2 mm. Using dimensional analysis, estimate the duration of the collapse. 2. An astronaut throws a small rock whilst standing on an open plain on Mars. Their hand is moving at approximately 60 km h -...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 3 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 53 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago