Why is the answer C and how do we name benzene rings like what are ALL the rules and why do we start from that specific substituent. Please I need a full explanation
Homework Answers
In this case, there are two substituents on the benzene ring i.e. Bromine and Nitro group. while giving the numbering, the carbon which contains highest atomic number atom among the substituent will be considered 1, then other substituent will be numbered relative to this carbon.
In the given molecule, Bromine has the highest atomic number than nitrogen, therefore the carbon attached to bromine get priority and considered as 1. relative to this carbon Nitro group comes at 4th position.
Therefore, the name of the compound is,
C) 1-Bromo-4-Nitrobenzene
Add Answer to:
Why is the answer C and how do we name benzene rings like what
are ALL...
help Question 30 3 pts ON What is the IUPAC name for this compound? a. 4-bromo-3-nitrophenyl...
help
Question 30 3 pts ON What is the IUPAC name for this compound? a. 4-bromo-3-nitrophenyl b. 1-bromo-4-ethyl-2-nitrobenzene c. 4-bromo-3-nitrostyrene d. 1-bromo-2-nitrostyrene tra OB oc OD
26,30.Explain why. 31,32. Explain why. 26. What is the IUPAC name of the following compound? A...
26,30.Explain why.
31,32. Explain why.
26. What is the IUPAC name of the following compound? A 2-Nitro-5-carboxychlorobenzene B. 2-Chloro-4-carboxynitrobenzene 099 2-Chloro-1-nitro-4-benzoic acid D. 3-Chloro-4-nitrobenzoic acid 27. What is the correct structure for para-bromotoluene? Be Meo BE Br Br WI B II C. IL DIV 28. Why is the following compound not aromatic? A It has 4n -electrons. It is not cyclic C. It has 4n+ 2 -electrons D. The p electron orbitals are not continuous 29. What is the hybridization...
What is the IUPAC name for this compound? A. 3-bromo-5-methylcyclopentanone B. 4-bromo-2-methylcyclopentanone C. 4-bromo-1-methyl-2-cyclopentanone D. 1-bromo-3-methyl-4-cyclopentanone...
What is the IUPAC name for this compound? A. 3-bromo-5-methylcyclopentanone B. 4-bromo-2-methylcyclopentanone C. 4-bromo-1-methyl-2-cyclopentanone D. 1-bromo-3-methyl-4-cyclopentanone What is the IUPAC name for this compound? A. ethyl 4-ethyl-3-methylhexanoate B. O, 3-diethyl-4-methylhexanoate C. ethyl 3-ethyl-4-methylhexane ester D. ethyl 3-ethyl-4-methylhexanoate
Liy myas iw nolt yd fuods Name: anibia blsu base loro o done Part I: single substituents Lab report for lab the we...
Liy myas iw nolt yd fuods Name: anibia blsu base loro o done Part I: single substituents Lab report for lab the week of October 22 1. What is the name of the compound with the formula CsHsBr? What is the special name of the compound with the formula CeHsCH3?- 2. 3. What is the special name for benzene with an amino group attached to the ring? 4. What is the special name for the benzene derivative with an alcohol...
What is the IUPAC name of the following compound? Select one: a. 3-bromo-4-hexanone b. 2-bromo-1-ethyl-1-butanone c....
What is the IUPAC name of the following compound? Select one: a. 3-bromo-4-hexanone b. 2-bromo-1-ethyl-1-butanone c. 3-bromo-4-hexanal d. 4-bromo-3-hexanone
please answer all 40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c)...
please answer all
40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c) 2-butanol b) 2-methyl-1-propanol d)2-methyl-2-propanol e) none of these 41. In a phenol, which group is the substituent on the benzene ring? a) fluoro b) hydroxyl c) sulfhydryl d) carbonyl e ) carboxyl H,C-CH2OH 42. Which is the correct IUPAC name for this compound? HyC-CH-CH2-CH-CH, a) 2-ethyl-4-pentanol c) 4-ethyl-2-pentanol b) 3-methyl-5-hexanol d) 4-methyl-2-hexanol 43. Identify the electron group geometry at each of the carbon atoms...
PLEASE ANSWER ALL QUESTIONS 23) How many distinct trichlorobenzene isomers are possible? A) 2 B) 3...
PLEASE ANSWER ALL QUESTIONS
23) How many distinct trichlorobenzene isomers are possible? A) 2 B) 3 C) 4 D) 5 E) 6 24) Which of the following is another accepted name for methylphenylketone? A) anisole B) cresol C) acetophenone D) benzophenone E) cresone 25) Provide the name of the compound shown below. 26) Provide an acceptable name for the compound below. NO, NO 27) Provide an acceptable name for PhSO3H. 28) Provide an acceptable name for the compound below. A)...
9. What is the IUPAC name of the product obtained by hydration reaction of the following...
9. What is the IUPAC name of the product obtained by hydration reaction of the following alkene: Name Date tert two Husein ?? A. 2,3-Dimethyl-3-hexanol B. 2,3-Dimethyl-4-sulfatehexene C. 2,3-Dimethi-4-hydroxyhexane D. 2,3-Dimethyl-4-hexanol E. Alkenes do not show hydration reaction revious 7. Write the IUPAC name of following alkane. 8. What is the IUPAC name of the compound below? ce fach OH A. 2-Chloro-6-methylphenol B. 2-Chloro-6-methyl-1-phenol C. 3-Chloro-2-hydroxy-1-toluene D. 1-Chloro-5-methyl-1-hydroxybenzene E. Ortho-Chloro hydroxymethyl benzene
HELP Other Nether What is the TUPAC name of the following compound? -CH3 a) 3-Bromo-2-methylcyclohexene 2-Bromo-1-methylcyclohexene...
HELP
Other Nether What is the TUPAC name of the following compound? -CH3 a) 3-Bromo-2-methylcyclohexene 2-Bromo-1-methylcyclohexene b) 1-Bromo-2-methyl-2-cyclohexene d) 6-Bromo-1-methylcyclohexene 9. Carbon-carbon double bonds do not freely rotate like carbon-carbon single bonds. Why? a) The double bond is much stronger and thus more difficult to rotate b) Overlap of the two 2p orbitals of the pi bond would be lost c) The shorter bond length makes it difficult for the attached groups to rotate past each other. d) Overlap of...
answer the all question 3. The foliowing IUPAC names are incorrect. State what is wrong in...
answer the all question
3. The foliowing IUPAC names are incorrect. State what is wrong in each case and provide the correct IUPAC name for the compound. dshic: Write the line-bond structure corresponding to given name t name it by IUPAC rules to obtain the correct name. (e) 2-Ethyl-2-methyylpropane (0 3-Methyl-4-ethylhexane (g) 2-Methyl-4-methylhexane (h) 5-Methyl -1-ethyleyclohexane (a) 2-Ethyl pentane (b) 3,3,4-Trimethylpentane (c) 4-Ethyl-3-methylhexane (d) 2,3.3-Trimethylbutane
help
Question 30 3 pts ON What is the IUPAC name for this compound? a. 4-bromo-3-nitrophenyl b. 1-bromo-4-ethyl-2-nitrobenzene c. 4-bromo-3-nitrostyrene d. 1-bromo-2-nitrostyrene tra OB oc OD
26,30.Explain why.
31,32. Explain why.
26. What is the IUPAC name of the following compound? A 2-Nitro-5-carboxychlorobenzene B. 2-Chloro-4-carboxynitrobenzene 099 2-Chloro-1-nitro-4-benzoic acid D. 3-Chloro-4-nitrobenzoic acid 27. What is the correct structure for para-bromotoluene? Be Meo BE Br Br WI B II C. IL DIV 28. Why is the following compound not aromatic? A It has 4n -electrons. It is not cyclic C. It has 4n+ 2 -electrons D. The p electron orbitals are not continuous 29. What is the hybridization...
What is the IUPAC name for this compound? A. 3-bromo-5-methylcyclopentanone B. 4-bromo-2-methylcyclopentanone C. 4-bromo-1-methyl-2-cyclopentanone D. 1-bromo-3-methyl-4-cyclopentanone What is the IUPAC name for this compound? A. ethyl 4-ethyl-3-methylhexanoate B. O, 3-diethyl-4-methylhexanoate C. ethyl 3-ethyl-4-methylhexane ester D. ethyl 3-ethyl-4-methylhexanoate
Liy myas iw nolt yd fuods Name: anibia blsu base loro o done Part I: single substituents Lab report for lab the week of October 22 1. What is the name of the compound with the formula CsHsBr? What is the special name of the compound with the formula CeHsCH3?- 2. 3. What is the special name for benzene with an amino group attached to the ring? 4. What is the special name for the benzene derivative with an alcohol...
What is the IUPAC name of the following compound? Select one: a. 3-bromo-4-hexanone b. 2-bromo-1-ethyl-1-butanone c. 3-bromo-4-hexanal d. 4-bromo-3-hexanone
please answer all
40. Which is the correct IUPAC name for "isobutyl alcohol?" a) 1-butanol c) 2-butanol b) 2-methyl-1-propanol d)2-methyl-2-propanol e) none of these 41. In a phenol, which group is the substituent on the benzene ring? a) fluoro b) hydroxyl c) sulfhydryl d) carbonyl e ) carboxyl H,C-CH2OH 42. Which is the correct IUPAC name for this compound? HyC-CH-CH2-CH-CH, a) 2-ethyl-4-pentanol c) 4-ethyl-2-pentanol b) 3-methyl-5-hexanol d) 4-methyl-2-hexanol 43. Identify the electron group geometry at each of the carbon atoms...
PLEASE ANSWER ALL QUESTIONS
23) How many distinct trichlorobenzene isomers are possible? A) 2 B) 3 C) 4 D) 5 E) 6 24) Which of the following is another accepted name for methylphenylketone? A) anisole B) cresol C) acetophenone D) benzophenone E) cresone 25) Provide the name of the compound shown below. 26) Provide an acceptable name for the compound below. NO, NO 27) Provide an acceptable name for PhSO3H. 28) Provide an acceptable name for the compound below. A)...
9. What is the IUPAC name of the product obtained by hydration reaction of the following alkene: Name Date tert two Husein ?? A. 2,3-Dimethyl-3-hexanol B. 2,3-Dimethyl-4-sulfatehexene C. 2,3-Dimethi-4-hydroxyhexane D. 2,3-Dimethyl-4-hexanol E. Alkenes do not show hydration reaction revious 7. Write the IUPAC name of following alkane. 8. What is the IUPAC name of the compound below? ce fach OH A. 2-Chloro-6-methylphenol B. 2-Chloro-6-methyl-1-phenol C. 3-Chloro-2-hydroxy-1-toluene D. 1-Chloro-5-methyl-1-hydroxybenzene E. Ortho-Chloro hydroxymethyl benzene
HELP
Other Nether What is the TUPAC name of the following compound? -CH3 a) 3-Bromo-2-methylcyclohexene 2-Bromo-1-methylcyclohexene b) 1-Bromo-2-methyl-2-cyclohexene d) 6-Bromo-1-methylcyclohexene 9. Carbon-carbon double bonds do not freely rotate like carbon-carbon single bonds. Why? a) The double bond is much stronger and thus more difficult to rotate b) Overlap of the two 2p orbitals of the pi bond would be lost c) The shorter bond length makes it difficult for the attached groups to rotate past each other. d) Overlap of...
answer the all question
3. The foliowing IUPAC names are incorrect. State what is wrong in each case and provide the correct IUPAC name for the compound. dshic: Write the line-bond structure corresponding to given name t name it by IUPAC rules to obtain the correct name. (e) 2-Ethyl-2-methyylpropane (0 3-Methyl-4-ethylhexane (g) 2-Methyl-4-methylhexane (h) 5-Methyl -1-ethyleyclohexane (a) 2-Ethyl pentane (b) 3,3,4-Trimethylpentane (c) 4-Ethyl-3-methylhexane (d) 2,3.3-Trimethylbutane
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 4 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 22 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 22 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 36 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 6 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago