Homework Answers
![2 Noch 9.348 103 Ź 200 tela 3.47 2.548 10-29 x 10-200 Na keq = [NO] [ch ] 2 (3.44) 2 x 18 x 2.574 102 [no] (9.34) 2 x 10 K =](http://img.homeworklib.com/questions/d3a12e10-756f-11ea-b2e4-d7f728240969.png?x-oss-process=image/resize,w_560)
Please like this answer. All
the best for your future endeavors. If you have any doubts please
let me know in the comments section. THANK YOU.
Add Answer to:
Consider the following equilibrium system at 821 K. 2NOCI(g) 2NO(g) + Cl2 (g) If an equilibrium...
14. For the reaction: 2NOCI(g) 2NO(g) + Club), K = 1.6 x 10. What are the...
14. For the reaction: 2NOCI(g) 2NO(g) + Club), K = 1.6 x 10. What are the equilibrium concentrations of each species it tions of each species if 1.0 mole of NOCI is initially placed in an empty 2.0 L flask? 14. For the reaction: 2NOCI(B) = 2NO(g) + Cl2(g), K = X 1.6*10 What are the equilibrium concentrations of each species if 1.0 mole of NOCI is initially placed in an empty 2.0 L flask?
10. Examine the reaction: 2NOCI(g) 2NO (g) + Cl2(g) When the above reaction reaches equilibrium the...
10. Examine the reaction: 2NOCI(g) 2NO (g) + Cl2(g) When the above reaction reaches equilibrium the concentration of each component is [NOCI] = 2.9 M. [NO] =1.1 Mand [Cl2] = 0.65 M. What is the equilibrium constant, K for this reaction? Does the equilibrium lie on the left side or the right side of the equilibrium? 9. The following equilibrium is endothermic. In the box below, show how the reaction will shift response to the indicated stress by writing,, or...
Consider the following reactions at some temperature: 2NOCI(g) � 2NO(g) + Cl2 (g) K = 1.6...
Consider the following reactions at some temperature: 2NOCI(g) � 2NO(g) + Cl2 (g) K = 1.6 X 10-5 2NO(g) � N2 (g) + 02 (g) K = 1 X 1031 For each reaction, assume some quantities of the reactants were placed in separate containers and allowed to come to equilibrium. Describe the relative amounts of reactants and products that would be present at equilibrium. At equilibrium, which is faster, the forward or reverse reaction in each case?
63. At 35°C, K = 1.6 x 10-6 for the reaction 2NOCI(9) = 2NO(g) + Cl2...
63. At 35°C, K = 1.6 x 10-6 for the reaction 2NOCI(9) = 2NO(g) + Cl2 (9) Calculate the concentrations of all species at equilibrium for each of the following original mixtures. a. 2.0 moles of pure NOCI in a 2.0-L flask Answer b. 1.0 mole of NOCI and 1.0 mole of NO in a 1.0-L flask Answer c. 2.0 moles of NOCI and 1.0 mole of Cl, in a 1.0-L flask
Part A Consider the reaction between NO and Cl2 to form NOCI: 2NO (9) + Cl2...
Part A Consider the reaction between NO and Cl2 to form NOCI: 2NO (9) + Cl2 (9)=2NOCI (9) A reaction mixture at a certain temperature initially contains only (NO) = 0.60 M and (Cl) = 0.63 M. After the reaction comes to equilibrium, the concentration of NOCI is 0.22 M. You may want to reference (Page 688) Section 15.6 while completing this problem. Find the value of the equilibrium constant (K) at this temperature. Express your answer using two significant...
The equilibrium constant, K, for the formation of nitrosyl chloride from nitric oxide and chlorine. 2NO(g)...
The equilibrium constant, K, for the formation of nitrosyl chloride from nitric oxide and chlorine. 2NO(g) + Cl2(8) = 2NOCI(g) is 6.5 x 104 at 35°C. In which direction will the reaction proceed to reach equilibrium if the starting concentrations of NO, Cl., and NOCI are 2.6 x 10-3 M, 7.4 x 10-M, and 5.8 M respectively? o o O shift right shift lent neither
At 500.0 K, gaseous NOCl decomposed to NO and Cl2 according the following reaction: 2NOCl(g) ⇌...
At 500.0 K, gaseous NOCl decomposed to NO and Cl2 according the
following reaction:
2NOCl(g) ⇌ 2NO(g) + Cl2(g)
If 1.00 mole of NOCl is placed in a 1.00 liter contained, and at
equilibrium, the
concentration is 0.91M, what is the equilibrium constant,
Kc?
4. At 500.0 K, gaseous NOCI decomposed to NO and Cl2 according the following reaction: 2NOCI(g) = 2NO(g) + Cl2(g) If 1.00 mole of NOCI is placed in a 1.00 liter contained, and at equilibrium, the...
Constants 1 Pe Consider the reaction between NO and Cl2 to form NOCI: 2NO (g) +...
Constants 1 Pe Consider the reaction between NO and Cl2 to form NOCI: 2NO (g) + Cl2 (g) = 2NOCl (9) A reaction mixture at a certain temperature initially contains only (NO) = 0.67 Mand (Cl2] = 0.55 M . After the reaction comes to equilibrium, the concentration of NOCI is 0.34 M. Part A You may want to reference (Page 688) Section 15.6 while completing this problem. Find the value of the equilibrium constant (Kc) at this temperature. Express...
The equilibrium constant, K, for the following reaction is 5.10x10-6 at 548 K. NH4CI(s)H3(g +HCI(g) An...
The equilibrium constant, K, for the following reaction is 5.10x10-6 at 548 K. NH4CI(s)H3(g +HCI(g) An equilibrium mixture of the solid and the two gases in a 1.00 L flask at 548 K contains 0.200 mol NH4CI, 2.26x10-3M NH3 and 2.26x103 M HCI. If the concentration of NH3(g) is suddenly increased to 3.76x10-3 M, what will be the concentrations of the two gases once equilibrium has been reestablished? [NH3] [HCI] The equilibrium constant, K, for the following reaction is 10.5...
Consider the slowing equilibrium: 2NOC(g) =2NO(g) + Cl2(g) with K = 1.6 x 10 Segiment 100...
Consider the slowing equilibrium: 2NOC(g) =2NO(g) + Cl2(g) with K = 1.6 x 10 Segiment 100 mole of pure NOCI and 1.00 mole of pure Cly are placed in 100.container Reference: Ref 13-6 Tundles of NO react, what is the equilibrium concentration of Cl2? 01-2
14. For the reaction: 2NOCI(g) 2NO(g) + Club), K = 1.6 x 10. What are the equilibrium concentrations of each species it tions of each species if 1.0 mole of NOCI is initially placed in an empty 2.0 L flask? 14. For the reaction: 2NOCI(B) = 2NO(g) + Cl2(g), K = X 1.6*10 What are the equilibrium concentrations of each species if 1.0 mole of NOCI is initially placed in an empty 2.0 L flask?
10. Examine the reaction: 2NOCI(g) 2NO (g) + Cl2(g) When the above reaction reaches equilibrium the concentration of each component is [NOCI] = 2.9 M. [NO] =1.1 Mand [Cl2] = 0.65 M. What is the equilibrium constant, K for this reaction? Does the equilibrium lie on the left side or the right side of the equilibrium? 9. The following equilibrium is endothermic. In the box below, show how the reaction will shift response to the indicated stress by writing,, or...
63. At 35°C, K = 1.6 x 10-6 for the reaction 2NOCI(9) = 2NO(g) + Cl2 (9) Calculate the concentrations of all species at equilibrium for each of the following original mixtures. a. 2.0 moles of pure NOCI in a 2.0-L flask Answer b. 1.0 mole of NOCI and 1.0 mole of NO in a 1.0-L flask Answer c. 2.0 moles of NOCI and 1.0 mole of Cl, in a 1.0-L flask
Part A Consider the reaction between NO and Cl2 to form NOCI: 2NO (9) + Cl2 (9)=2NOCI (9) A reaction mixture at a certain temperature initially contains only (NO) = 0.60 M and (Cl) = 0.63 M. After the reaction comes to equilibrium, the concentration of NOCI is 0.22 M. You may want to reference (Page 688) Section 15.6 while completing this problem. Find the value of the equilibrium constant (K) at this temperature. Express your answer using two significant...
The equilibrium constant, K, for the formation of nitrosyl chloride from nitric oxide and chlorine. 2NO(g) + Cl2(8) = 2NOCI(g) is 6.5 x 104 at 35°C. In which direction will the reaction proceed to reach equilibrium if the starting concentrations of NO, Cl., and NOCI are 2.6 x 10-3 M, 7.4 x 10-M, and 5.8 M respectively? o o O shift right shift lent neither
At 500.0 K, gaseous NOCl decomposed to NO and Cl2 according the
following reaction:
2NOCl(g) ⇌ 2NO(g) + Cl2(g)
If 1.00 mole of NOCl is placed in a 1.00 liter contained, and at
equilibrium, the
concentration is 0.91M, what is the equilibrium constant,
Kc?
4. At 500.0 K, gaseous NOCI decomposed to NO and Cl2 according the following reaction: 2NOCI(g) = 2NO(g) + Cl2(g) If 1.00 mole of NOCI is placed in a 1.00 liter contained, and at equilibrium, the...
Constants 1 Pe Consider the reaction between NO and Cl2 to form NOCI: 2NO (g) + Cl2 (g) = 2NOCl (9) A reaction mixture at a certain temperature initially contains only (NO) = 0.67 Mand (Cl2] = 0.55 M . After the reaction comes to equilibrium, the concentration of NOCI is 0.34 M. Part A You may want to reference (Page 688) Section 15.6 while completing this problem. Find the value of the equilibrium constant (Kc) at this temperature. Express...
The equilibrium constant, K, for the following reaction is 5.10x10-6 at 548 K. NH4CI(s)H3(g +HCI(g) An equilibrium mixture of the solid and the two gases in a 1.00 L flask at 548 K contains 0.200 mol NH4CI, 2.26x10-3M NH3 and 2.26x103 M HCI. If the concentration of NH3(g) is suddenly increased to 3.76x10-3 M, what will be the concentrations of the two gases once equilibrium has been reestablished? [NH3] [HCI] The equilibrium constant, K, for the following reaction is 10.5...
Consider the slowing equilibrium: 2NOC(g) =2NO(g) + Cl2(g) with K = 1.6 x 10 Segiment 100 mole of pure NOCI and 1.00 mole of pure Cly are placed in 100.container Reference: Ref 13-6 Tundles of NO react, what is the equilibrium concentration of Cl2? 01-2
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 36 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago