assuming the same pressure and temperature, which has a greater number of gas molecules: 5 liters...
Homework Answers
Add Answer to:
assuming the same pressure and temperature, which has a greater
number of gas molecules: 5 liters...
b. How many liters of oxygen gas must react with 0.800kg of Fesmo" atm? CHEAP 01 8. When ammonia gas, NH, reacts wi...
b. How many liters of oxygen gas must react with 0.800kg of Fesmo" atm? CHEAP 01 8. When ammonia gas, NH, reacts with oxyoen, gaseous nitric Oxide (NO) and water vapor are collected. How many liters of NO can be made from 12L of oxygen and 10.0 of ammonia at constant pressure and temperature? 9. If a 1.0L container is filled with 1.00g of hydrogen gas and another 1.00L container is filled with 1.00g of nitrogen gas. Both containers are...
1. If nitrogen gas has a density of 1.14 g/L, and an unknown gas has a...
1. If nitrogen gas has a density of 1.14 g/L, and an unknown gas
has a density of 4.2 g/L at the same temperature and pressure, what
is the ratio of the rate of effusion of the known gas to the rate
of effusion of nitrogen?
2. The combustion reaction for octane burning in oxygen is:
2 C8H18 (l) + 25 O2(g)
→ 16 CO2(g) +18 H2O(g)
∆H = -10869 kJ .
Suppose an oxygen bomb calorimeter is loaded with oxygen...
19. At atmospheric pressure, a sample of oxygen gas has a volume of 1.5 liters at...
19. At atmospheric pressure, a sample of oxygen gas has a volume of 1.5 liters at 20°C. What volume, in liters will this gas occupy if the temperature is raised to 80 C? Assume ideal gas behavior a. 1.8 t b. 2.7L c. 3.9 L d. 6.0L e. 9.0L 20. How many grams of hydrogen, H2, are present in a 10.0 L gas cylinder at 25 C when the H2 pressure is 4.0 atm? Assume ideal gas behavior. a. 1.7...
A mixture of methane gas, CH4(g), and pentane gas, C5H12(g), has a pressure of 0.5427 atm...
A mixture of methane gas, CH4(g), and pentane gas, C5H12(g), has a pressure of 0.5427 atm when placed in a sealed container. The complete combustion of the mixture to carbon dioxide gas, CO2(g), and water vapor, H2O(g), was achieved by adding exactly enough oxygen gas, O2(g), to the container. The pressure of the product mixture in the sealed container is 2.417 atm. Calculate the mole fraction of methane in the initial mixture assuming the temperature and volume remain constant.
5) Oxygen gas is collected over water. The total pressure (the O2 pressure + the water...
5) Oxygen gas is collected over water. The total pressure (the O2 pressure + the water vapor pressure) is 765 torr. The temperature of the water is such that the water vapor pressure is 38 torr. What is the partial pressure of the oxygen gas in torr?
A sample of oxygen gas collected at a pressure of 1.46 atm and a temperature of...
A sample of oxygen gas collected at a pressure of 1.46 atm and a temperature of 14.0 °C is found to occupy a volume of 22.8 liters. How many moles of O2 gas are in the sample? mol
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K and P = 1 atm B) T=0°C and P 760 atm C) T= 273 K and P = 0 atm D) T-273 K and P-1 atm E) T = 1 K and P = 1 atm 25) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the jar can only...
34) Which of the followine represent STP Standard Temperature and Pressure) conditions A) TOK and Plam BT-0"C and P...
34) Which of the followine represent STP Standard Temperature and Pressure) conditions A) TOK and Plam BT-0"C and P760 atm CT-273 K and P-0 atm D) T-273 K and P lam ETIK and Patm 25) 23) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the car can only occur once all of the liquid molecules are in the vapor for gaseous) state. B) A set...
Assuming gas molecules in a container with a movable end (a piston), what effect will each...
Assuming gas molecules in a container with a movable end (a piston), what effect will each of following changes have on the specified variable? 1-The effect on pressure when more gas molecules are added with the volume and temperature held constant. 2-The effect on pressure when the temperature is increased with the volume and number of molecules of gas held constant. 3- The effect on pressure when the volume is increased with the temperature and number of molecules of gas...
7) A gas has a pressure of 2.5 atm and a volume of 300 Liters is...
7) A gas has a pressure of 2.5 atm and a volume of 300 Liters is compressed so it has a pressure of 5 atm, what is the compressed volume? A gas has a volume of 152 Liters in a helium balloon at 25 degrees Celsius. as the balloon rises in the atmosphere the temperature drops to 18 degrees Celsius, what is the volume of the gas at the cooler temperature? Explain in detail
b. How many liters of oxygen gas must react with 0.800kg of Fesmo" atm? CHEAP 01 8. When ammonia gas, NH, reacts with oxyoen, gaseous nitric Oxide (NO) and water vapor are collected. How many liters of NO can be made from 12L of oxygen and 10.0 of ammonia at constant pressure and temperature? 9. If a 1.0L container is filled with 1.00g of hydrogen gas and another 1.00L container is filled with 1.00g of nitrogen gas. Both containers are...
1. If nitrogen gas has a density of 1.14 g/L, and an unknown gas
has a density of 4.2 g/L at the same temperature and pressure, what
is the ratio of the rate of effusion of the known gas to the rate
of effusion of nitrogen?
2. The combustion reaction for octane burning in oxygen is:
2 C8H18 (l) + 25 O2(g)
→ 16 CO2(g) +18 H2O(g)
∆H = -10869 kJ .
Suppose an oxygen bomb calorimeter is loaded with oxygen...
19. At atmospheric pressure, a sample of oxygen gas has a volume of 1.5 liters at 20°C. What volume, in liters will this gas occupy if the temperature is raised to 80 C? Assume ideal gas behavior a. 1.8 t b. 2.7L c. 3.9 L d. 6.0L e. 9.0L 20. How many grams of hydrogen, H2, are present in a 10.0 L gas cylinder at 25 C when the H2 pressure is 4.0 atm? Assume ideal gas behavior. a. 1.7...
24) Which of the following represent STP (Standard Temperature and Pressure) conditions? A) T -0 K and P = 1 atm B) T=0°C and P 760 atm C) T= 273 K and P = 0 atm D) T-273 K and P-1 atm E) T = 1 K and P = 1 atm 25) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the jar can only...
34) Which of the followine represent STP Standard Temperature and Pressure) conditions A) TOK and Plam BT-0"C and P760 atm CT-273 K and P-0 atm D) T-273 K and P lam ETIK and Patm 25) 23) Which of the following is TRUE for a liquid that is placed in a sealed container? A) Condensation of the evaporated molecules in the car can only occur once all of the liquid molecules are in the vapor for gaseous) state. B) A set...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 54 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago