(6) 11. (R)-20bromobutane is reacted with NaCN in DMF. What is (are) the products? Include the...
(6) 11. (R)-20bromobutane is reacted with NaCN in DMF. What is (are) the products? Include the name(s) with R, S configuration if necessary.
what products will the following reactions form? F3C-S 1. Nal, Acetone 2. NaCN, DMF 1. Nal, Acetone 2. CH3CO2Na, CH3CO2H a. NaH, THF OH b. O=SHO
Based on the reaction ( salicylic acid reacted with R-(+)-a-Methylbenzylamine) and EDCl, with Catalyst DMAP and DMF) and basic condition, list at least two other products that may be formed in addition to the desired product.
3. The reaction of A with NaCN in ethanol to form B and C is shown below. The rate of reaction with either 0.1 M or 0.2 M NaCN is the same. NaCN IN, 11 EtOH H CN 0) What's the name of the mechanism for this reaction? (b) (Circle the correct answer) The reaction of the R isomer of A would give: (1) the R isomer of B; (2) the S isomer of B; (3) a racemic mixture of...
Predict and draw the major product of the following reaction. Question 6 CH3 Br NaCN H3CV CH3 DMF Create OscerSketch Answer 6 Select the major product of the following reaction. Question 7 CH3CH20 CH,CH,OH ♡ ♡ ♡ ♡ Lecce OCH CH3 Enter Your Answer: OA OB Oc OD OE
What are the possible products for (R)-4-bromo-1-hexene when reacted with a) Br2 in DCM and b) NBS in water and DMSO. Assign the stereochemistry and if there is more than one product, describe their relationship.
Draw the products of the reactions 1-6 CH3COOK attfort Br NASH CH3 DMF 7 H2O THE CH3 CH3 4) • BV Na3 > DMF CH2 CH3 (CH3)3 COK 5. ) CL 6. ) H₂ CC=C: Na THE
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
When aqueous solutions of NaCl (aq) and AgCN (aq) are mixed, the products are NaCN (aq) and AgCl (s). What is the net ionic equation for this reaction?
5. (6 pts) Predict the SN2 substitution products, indicate stereochemistry as appropriate. NaCN +CHy __KSH acetonitrile KSH KSH acetonitrile NaN, CH3O^Na CH, OH