what products will the following reactions form? F3C-S 1. Nal, Acetone 2. NaCN, DMF 1. Nal, Acetone 2. CH3CO2Na, C...
vero (S)-2-iodobutane NaSCH DMF -OH BIOCH3 Nal acetone NaCN acetone enou CH3OH for CH2OH CHCH
(S)-2-iodobutane NaSCH3 DMF For – Br OCH3 Nal acetone NaCN acetone CH2OH _com CHIOH
Predict the product for the following reaction. 1. Nal/acetone 2. NaCN/DMF لي لي لي رٹہ سٹہ
2. (16 pts) Reactions Provide reagents, products or starting materials for the following reactions. Show stereochemistry when relevant (or loss thereof). If a reaction produces no significant products, write "NR". If you have a question about an abbreviation, just ask. NaBr OH 1. TsCI 2. Nal, DMF CI DMSO OH 1. PBrg NaCN 2. KOC(CH3)3 Ether LDA НОН THE NaH NaH PO Acetone Heat, water
Predict the product for the following reaction. OTS 1. Nal/acetone 2 - 2. NaCN/DMF OCN س رير ملي رٹہ سٹہ O 0 0 O O
Draw the major products for the following reactions Nah DMF Br NaNHCH3 Br acetone
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п
What is the major product in each of the S 2 reactions below? For each product, label all stereocentres as R or S as appropriate. [8 Marks] CH3CH2SNA acetone Он 1. NaH in THF 2. 1. NaH in THE HS 2. CI сH, NaCN H Br H CH3 acetone CH2CH3
1. Predict the products of the following reactions. CH3 TsCl Pyridine NaCN CH3 PBr3 Pyridine NaCN (1) BH3:THF (2) H2O2,OH H2SO4(cat.) H2O (1) Hg(OAc)2 (2) NaBH/OH 2. Write the mechanism of the following reactions он но он Ph BF3 Ph
Conditions Starting Material Major Product(s) OH PBrg Et20 NaCN DMF OMs NaNH2 DMSO, 20'C 8 hr 1) NaH, DMF, -78°C 2) A ci NaOH Br OH