vero (S)-2-iodobutane NaSCH DMF -OH BIOCH3 Nal acetone NaCN acetone enou CH3OH for CH2OH CHCH

Question

Question

Answer 1

Answer #1

ScHe NascHs DMF BY Nai Acctone SN2 +en CL CH CN

Sn2 reaction gives inversion of configuration and SN1 reaction gives racemic mixture.

Answer 2

Similar Homework Help Questions

(S)-2-iodobutane NaSCH3 DMF For – Br OCH3 Nal acetone NaCN acetone CH2OH _com CHIOH

(S)-2-iodobutane NaSCH3 DMF For – Br OCH3 Nal acetone NaCN acetone CH2OH _com CHIOH
what products will the following reactions form? F3C-S 1. Nal, Acetone 2. NaCN, DMF 1. Nal, Acetone 2. CH3CO2Na, C...

what products will the following reactions form? F3C-S 1. Nal, Acetone 2. NaCN, DMF 1. Nal, Acetone 2. CH3CO2Na, CH3CO2H a. NaH, THF OH b. O=SHO
Predict the product for the following reaction. 1. Nal/acetone 2. NaCN/DMF لي لي لي رٹہ سٹہ

Predict the product for the following reaction. 1. Nal/acetone 2. NaCN/DMF لي لي لي رٹہ سٹہ

4. Determine if Syl or Sn2 and the product formed. CH3OH CH3OH CH,OH CH3OH өОН DMF өОН 1112 DMSO NaCN DMSO

4. Determine if Syl or Sn2 and the product formed. CH3OH CH3OH CH,OH CH3OH өОН DMF өОН 1112 DMSO NaCN DMSO
Predict the product for the following reaction. OTS 1. Nal/acetone 2 - 2. NaCN/DMF OCN س رير ملي رٹہ سٹہ O 0 0 O O

Predict the product for the following reaction. OTS 1. Nal/acetone 2 - 2. NaCN/DMF OCN س رير ملي رٹہ سٹہ O 0 0 O O
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the foll...

9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п

Conditions Starting Material Major Product(s) OH PBrg Et20 NaCN DMF OMs NaNH2 DMSO, 20'C 8 hr...

Conditions Starting Material Major Product(s) OH PBrg Et20 NaCN DMF OMs NaNH2 DMSO, 20'C 8 hr 1) NaH, DMF, -78°C 2) A ci NaOH Br OH
on (R)-1-bromo-2-methylbutane undergoes substitution when reacted with sodium iodide (Nal) in acetone. Choose the major product...

on (R)-1-bromo-2-methylbutane undergoes substitution when reacted with sodium iodide (Nal) in acetone. Choose the major product obtained from this reaction. A (R)-1-iodo-2-methylbutane B (S)-1-iodo-2-methylbutane C racemic 1-iodo-2-methylbuta D (R)-1-bromo-2-iodobutane E (S)-1-bromo-2-iodobutane F (S)-1-sodium-2-methylbutane Enter Your Answer: OA OB OC OD OE OF B Incorrect
RCES Testbank, Question 194 Predict the product for the following reaction. DI 012 1. Nal/acetone 052...

RCES Testbank, Question 194 Predict the product for the following reaction. DI 012 1. Nal/acetone 052 | 055 2. NaCN/DMF 059 | 61 | 09 | 0122 مرمي لي لي * 075 T 10H n 115 123 « 139 * 155 n 16 172 ح OV on 20D - 25 اد : By accessing this Question Assistance, you will learn while you earn points based on the Point Potential Policy set by your instructor.

the weakest base: CH3 HO HS the fastest in an Syl reaction: (CE)_CACHOSCH (CH3CB (CH.) CHCH(Br)CH, (CH),C(Br)CH (CH...

the weakest base: CH3 HO HS the fastest in an Syl reaction: (CE)_CACHOSCH (CH3CB (CH.) CHCH(Br)CH, (CH),C(Br)CH (CH3)2CHCH Br 2. For each pair of reactions given below indicate which is faster and explain your reasoning. + CHỊ N + C CH3Cl + N CH3 + Ng CH₃N₂ + i CHg. + NaCN CH, CN + Nal DMSO CH3-1 + NaCN C H, CN + Nal Cho (c) CH,0 + CH,CH,Br - HƠ + CHỊCH,Br CH,CH,OCH, + Bril CH,CH,OH + Br...