Homework Answers
Add Answer to:
he Large Hadron Collider (LHC) smashes protons together. The current is 0.58 A. a) How much...
At the Large Hadron Collider (LHC), protons are accelerated to such high speeds that their size...
At the Large Hadron Collider (LHC), protons are accelerated to such high speeds that their size (along one direction) is contracted by a factor of 7000 as seen in the laboratory (stationary) frame. Calculate the velocity v of the protons. (Express your answer as α 1-c.)
The Large Hadron Collider (LHC) is able to accelerate protons (m = 1.67 x 1027kg, q...
The Large Hadron Collider (LHC) is able to accelerate protons (m = 1.67 x 1027kg, q = 1.60 x 10-19C) to almost the speed of light (c = 3.00 x 108m/s). It consists of a circle of radius R = 12.2km. Neglecting relativistic effects, what is the necessary magnetic field to keep those protons in motion?
The Large Hadron Collider at CERN creates proton beams which collide together resulting in pictures like...
The Large Hadron Collider at CERN creates proton beams which collide together resulting in pictures like the one at the right. Some of these beams can have a radius of 1.1 mm with a current of 1.5 mA. The kinetic energy of each proton in this beam is 2.5 MeV. (a) Calculate the number density of the protons in the beam. (b) If the beam is aimed at a metal target, how many protons would strike the screen in 1...
I need help with this physics problem. The Large Hadron Collider (LHC) is designed to accelerate...
I need help with this physics problem.
The Large Hadron Collider (LHC) is designed to accelerate protons around a ring 27 km in circumference using over 1,600 magnets that produce an 8.3 T field. The mass spectrometer equation cannot be used for this calculation since the protons are highly relativistic (v c). The kinetic energy becomes Ek = pc where p is the momentum, still given by p=qBr. Determine the proton's kinetic energy (in Joules) and convert to units of...
42. (a) The Large Hadron Collider accelerates protons to an energy of 7 TeV (7 *...
42. (a) The Large Hadron Collider accelerates protons to an energy of 7 TeV (7 * 1012 eV). What is the speed of these protons? Express the result as the difference between the proton speed and the speed of light. (b) Suppose this beam were directed against a fixed target of protons to obtain the reaction p+pp+p+ X, where X represents one or more new particles produced in the reaction. What is the maximum amount of energy available to produce...
Was just wondering if someone could help me with this please. The Large Haron Collider (LHC)...
Was just wondering if someone could help me with this
please.
The Large Haron Collider (LHC) is the world's largest particle accelerator. It is circular in formation, with a radius of 4.2429 km. Protons can be made to travel around it in opposite direc tions, and then collide head on. Its operation depends on many individual electromagnets. To help understand the proton motion, you may wish to use this interactive simulation of a charged particle moving in a magnetic field:...
Problem: You are a particle physicist at the Large Hadron Collider who is tasked with designing...
Problem: You are a particle physicist at the Large Hadron Collider who is tasked with designing an apparatus to separate annihilation products (such as pions) from proton-antiproton collisions. Because positive and negative charges deflect differently in a magnetic field, you plan to use a magnetic field to separate these products. As a starting point, in which you ignore interaction effects and assume a known velocity, you decide to explore a beam of coincident positively and negatively charged pions, each of...
2. A large molecule contains a total of 1652 protons and 1871 neutrons. 2. How many...
2. A large molecule contains a total of 1652 protons and 1871 neutrons. 2. How many electrons does the molecule contain if it has a net charge of o C? b. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of 7.2 1050? c. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of +34 * 1050? show 6. An uncharged metal sphere, A,...
2. A large molecule contains a total of 165a protons and 1871 neutrons. a. How many electrons does the molecule con...
2. A large molecule contains a total of 165a protons and 1871 neutrons. a. How many electrons does the molecule contain if it has a net charge of oC? b. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of -7.x 105C? c. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of 2.4 x 105C? le brought close to, but not touching, where...
In comparing wires of identical shape and carrying the same current but made of different metals,...
In comparing wires of identical shape and carrying the same current but made of different metals, is the drift velocity in each wire inversely proportional to the number density of charge carriers? No. The drift velocity is the same for all conductors. Yes. To have the same current from k times as many carriers, it takes k times the drift speed. No. The drift velocity is directly proportional to the number density of carriers. Yes. To have the same current...
At the Large Hadron Collider (LHC), protons are accelerated to such high speeds that their size (along one direction) is contracted by a factor of 7000 as seen in the laboratory (stationary) frame. Calculate the velocity v of the protons. (Express your answer as α 1-c.)
The Large Hadron Collider (LHC) is able to accelerate protons (m = 1.67 x 1027kg, q = 1.60 x 10-19C) to almost the speed of light (c = 3.00 x 108m/s). It consists of a circle of radius R = 12.2km. Neglecting relativistic effects, what is the necessary magnetic field to keep those protons in motion?
I need help with this physics problem.
The Large Hadron Collider (LHC) is designed to accelerate protons around a ring 27 km in circumference using over 1,600 magnets that produce an 8.3 T field. The mass spectrometer equation cannot be used for this calculation since the protons are highly relativistic (v c). The kinetic energy becomes Ek = pc where p is the momentum, still given by p=qBr. Determine the proton's kinetic energy (in Joules) and convert to units of...
42. (a) The Large Hadron Collider accelerates protons to an energy of 7 TeV (7 * 1012 eV). What is the speed of these protons? Express the result as the difference between the proton speed and the speed of light. (b) Suppose this beam were directed against a fixed target of protons to obtain the reaction p+pp+p+ X, where X represents one or more new particles produced in the reaction. What is the maximum amount of energy available to produce...
Was just wondering if someone could help me with this
please.
The Large Haron Collider (LHC) is the world's largest particle accelerator. It is circular in formation, with a radius of 4.2429 km. Protons can be made to travel around it in opposite direc tions, and then collide head on. Its operation depends on many individual electromagnets. To help understand the proton motion, you may wish to use this interactive simulation of a charged particle moving in a magnetic field:...
Problem: You are a particle physicist at the Large Hadron Collider who is tasked with designing an apparatus to separate annihilation products (such as pions) from proton-antiproton collisions. Because positive and negative charges deflect differently in a magnetic field, you plan to use a magnetic field to separate these products. As a starting point, in which you ignore interaction effects and assume a known velocity, you decide to explore a beam of coincident positively and negatively charged pions, each of...
2. A large molecule contains a total of 1652 protons and 1871 neutrons. 2. How many electrons does the molecule contain if it has a net charge of o C? b. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of 7.2 1050? c. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of +34 * 1050? show 6. An uncharged metal sphere, A,...
2. A large molecule contains a total of 165a protons and 1871 neutrons. a. How many electrons does the molecule contain if it has a net charge of oC? b. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of -7.x 105C? c. How many electrons does each molecule contain if 15 000 of these molecules have a total charge of 2.4 x 105C? le brought close to, but not touching, where...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 36 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago