what will be happened to the resisitivity if the doped impurities in the non magnetic metal...
what will be happened to the resisitivity if the doped impurities in the non magnetic metal is magnetic ions
Homework Answers
Conductivity in metals depends upon presence of unpaired electrons in their valence shell per atom.
If we do the doping of magnetic ions then number of unpaired electron will increase but they are anti parallel to each other so net magnetic moment will decrease so Conductivity will decrease.
Hence Resistivity is Increase.
Add Answer to:
what will be happened to the resisitivity if the doped
impurities in the non magnetic metal...
(a) please write down the resistivity as a function of temperature for a metal. please separate...
(a) please write down the resistivity as a function of temperature for a metal. please separate it into four regions such as resistivity is proportional to T, proportional to T^5,proportional to T^2 and proportional to T^0. Please also explain why is that ? (b) what will happened if the doped impurities in the non-magnetic metal is magnetic ions? (c) what is the resistivity as a function of temperature for an instrinsic semiconductor ? (d) how about the resistivity change as...
Please write down the resistivity as a function of temperature for a metal. Please separate it...
Please write down the resistivity as a function of temperature for a metal. Please separate it into four regions, such as resistivity is proportional to T, proportion to proportional to and proportional to . Please also explain why is that? What will be happened if the doped impurities in the non-magnetic metal is magnetic ions? What is the resistivity as a function of temperature for an intrinsic semiconductor? How about the resistivity charge as function of temperature in a insulator?...
Semiconductor is doped with donor impurities and has the resistivity 0.03 Ohm*cm. The donor concentration ND...
Semiconductor is doped with donor impurities and has the resistivity 0.03 Ohm*cm. The donor concentration ND = 7.5 E16 cm^-3. What is the electron mobility in the material? [unit:m*m/(V*s)]
Semiconductor is doped with donor impurities and has the resistivity 0.03 Ohm*cm. The donor concentration ND...
Semiconductor is doped with donor impurities and has the resistivity 0.03 Ohm*cm. The donor concentration ND = 7.5 E16 cm^-3. What is the electron mobility in the material? [unit:m*m/(V*s)]
q2a5 The final step in the refinement of copper involves: title pyrometallurgic removal of impurities by...
q2a5 The final step in the refinement of copper involves: title pyrometallurgic removal of impurities by reaction with molecular oxygen hydrometallurgic formation of a complex ion between copper ions and cyanide ions selective plating of copper from a mixture of copper and other metal ions at the anode in an electrolytic cell selective plating of copper from a mixture of copper and other metal ions at the cathode in an electrolytic cell
1) Draw simple band structure diagrams for: a. Acceptor-doped semiconductor b. Donor-doped semiconductor c. Potassium metal...
1) Draw simple band structure diagrams for: a. Acceptor-doped semiconductor b. Donor-doped semiconductor c. Potassium metal d. Magnesium oxide an insulator
What would have happened to a calculation of the specific heat of your metal in the...
What would have happened to a calculation of the specific heat of your metal in the second trial if you had not carefully dried the metal before reuse? Clearly explain your reasoning. NG 3 3. What would have been the effect on your calculation of the specific heat of the metal had you forgotten to add the correction for your calorimeter constant? Explain. 4. How would your data have been affected if you had failed to dry your calorimeter between...
A non-magnetic metal ring is suspended from a thread. It is spinning. You bring a strong...
A non-magnetic metal ring is suspended from a thread. It is spinning. You bring a strong magnet near the ring but not touching it and the ring stops rotating. What is happening? A. The ring is being repelled by the magnet. B. The ring is being attracted to the magnet. C. The part of the ring approaching the magnet is repelled from the magnet and the part of the ring moving away from the magnet is attracted to the magnet....
What are soluble impurities. (b) Do soluble impurities in solids effect the melting point of the...
What are soluble impurities. (b) Do soluble impurities in solids effect the melting point of the sample? if so, what are the effects?(c) What are insoluble impurities? (d) Do insoluble impurities in solids effect the melting point of the sample? if so , what are the effects?
What were the mechanics of Subprime Mortgage crisis? Why it happened Consider me a non financial...
What were the mechanics of Subprime Mortgage crisis? Why it happened Consider me a non financial person and make sure that I get it early. Subprime mortgage crisis 2008 Housing bubble in USA
q2a5 The final step in the refinement of copper involves: title pyrometallurgic removal of impurities by reaction with molecular oxygen hydrometallurgic formation of a complex ion between copper ions and cyanide ions selective plating of copper from a mixture of copper and other metal ions at the anode in an electrolytic cell selective plating of copper from a mixture of copper and other metal ions at the cathode in an electrolytic cell
1) Draw simple band structure diagrams for: a. Acceptor-doped semiconductor b. Donor-doped semiconductor c. Potassium metal d. Magnesium oxide an insulator
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 48 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago