Homework Answers
first identify the structure here the structure is
acetal and it undergoes the hydrolysis and forms the aldehyde and
the alcohols and they are as follows
Add Answer to:
What are the primary organic products of hydrolysis of the following molecule? Select one: O a....
Predict the product for the following reaction. 1-hexanol PCC CH2Cl2 A hexanal B) 2-chlorohexane C hexanoic...
Predict the product for the following reaction. 1-hexanol PCC CH2Cl2 A hexanal B) 2-chlorohexane C hexanoic acid D 1-hexanol E 2-hexanone
3. Classify each of the following alcohols as primary, secondary, or tertiary. a. 3-pentanol SELECT ONE...
3. Classify each of the following alcohols as primary, secondary, or tertiary. a. 3-pentanol SELECT ONE SELECT ONE b. 2-methyl-2-butanol c. 1-propanol SELECT ONE 4. If you add chromate, an oxidizing agent, to each of the following would a green Cr solution be formed? SELECT ONE a. 3-pentanol b. 2-methyl-2-butanol SELECT ONE c. 1-propanol SELECT ONE
Explain why the IR corresponds to a particular compound of those that are possible based on BP and why it couldn't be...
Explain why the
IR corresponds to a particular compound of those that are possible
based on BP and why it couldn't be any of the others -mention at
least 3 IR peaks that are present that correspond to functional
groups in your molecule, and discuss specific peaks that were
either present or absent that allowed you to rule out the other
compounds possible based on the boiling point. Reference your IR
spectra as figures.
the boiling
point for unkown 2:...
What alcohol IR spectrum is that when reacted with acetic acid UNKNOWN D PPM 112 1-butanol...
What alcohol IR spectrum is that when reacted with acetic
acid
UNKNOWN D PPM 112 1-butanol (n-butyl alcohol) 2-butanol (sec-butyl alcohol) 2-methyl-1-propanol (isobutyl alcohol) 3-methyl-1-butanol (isopentyl alcohol) 1-pentanol (n-pentyl alcohol) 2-pentanol 3-pentanol cyclopentanol
How many of the following molecules would you expect to be polar? 2-hexene 2-hexanol hexanal hexanoic...
How many of the following molecules would you expect to be polar? 2-hexene 2-hexanol hexanal hexanoic acid ethyl pentanoate Select one: a. O b.3 c. 2 d. 4 e. 5 O f. 1
How many of the following molecules would you expect to be polar? 2-hexene 2-hexanol hexanal hexanoic...
How many of the following molecules would you expect to be polar? 2-hexene 2-hexanol hexanal hexanoic acid ethyl pentanoate Select one: a. 4 b. 2 O c. 5 O d. 3 e. 1 f.o
EXPERIMENT 4 Organic Families - Reactions and Identification of Functional Groups PART A. Reactions of Alkanes and Alkenes 1. Action of Bromine Water Observation Organic Compound cyclohexene c...
EXPERIMENT 4 Organic Families - Reactions and Identification of Functional Groups PART A. Reactions of Alkanes and Alkenes 1. Action of Bromine Water Observation Organic Compound cyclohexene cyclohexane Equations: Write an equation for the above compounds which caused a decolourisation of bromine water. Name and draw all reactants and products. Distinguishing Test for Primary, Secondary and Tertiary Alcohols PART B. 1. Lucas Test for Alcohols Organic Compound tert-pentanol (2-methyl 2-butanol) 2-pentanol Observation 1-pentanol Equations: Write an equation for the above...
i need more information about those picture. the pre-lab report thanks. Organic Chemistry Esperimeats Laberalor...
i
need more information about those picture. the pre-lab report
thanks.
Organic Chemistry Esperimeats Laberalory Masuals (CHM 221et and 2211i EXPERIMENT 3: Report and Worksheet BOILING POINT/REFRACTIVE INDEX student Name: Day: Student Nuaber Date: DATA UNKNOWN NUMBER: L. COMPOUND Obs Ref Obs. Ref 1.3791 80.C butanone 1.3793 83 C 2-propanol 1.3950 929 98-C 2-butanol 1.5463 178 °C benzaldehyde UNKNOWN COMPOUND IDENTITY OF UNKNOWN Lab-Form for Pre-lab Assignment (in a composition Notebook) Date of the experiment: Experiment #: Experiment Title: Purpose...
classify each of the following as a primary CH-CHE The compound CH -CH-CH-CH-COOH is called a...
classify each of the following as a primary
CH-CHE The compound CH -CH-CH-CH-COOH is called a 3-hexanoic acid b. 2-ethyl pentancate C. 2-ethyl pentanoic acid d. 3-heptanoic acid e 4 -heptanoic acid (ioni 2 Fien) 5. Which equation correctly represents the dissociation of a carbovie acid? CH - -OH a CH-COOH + HO-CHY-COOH, OH b. CHY-COOH-CH.COO + H,0 c CH-COOH + H2O - CH-COO + H,09 d. CHỊ-COOH + HBO - CH2-COOH + MO e CH-COOH +24,0 - CH-C00+ 2H,0*...
What is the major organic product obtained from the following reaction? O 1. NaBHA 2. H20...
What is the major organic product obtained from the following reaction? O 1. NaBHA 2. H20 a. 4-hydroxy-2-pentanone b.2-pentanone c. (E)-3-penten-2-ol d.2-pentanol
Predict the product for the following reaction. 1-hexanol PCC CH2Cl2 A hexanal B) 2-chlorohexane C hexanoic acid D 1-hexanol E 2-hexanone
3. Classify each of the following alcohols as primary, secondary, or tertiary. a. 3-pentanol SELECT ONE SELECT ONE b. 2-methyl-2-butanol c. 1-propanol SELECT ONE 4. If you add chromate, an oxidizing agent, to each of the following would a green Cr solution be formed? SELECT ONE a. 3-pentanol b. 2-methyl-2-butanol SELECT ONE c. 1-propanol SELECT ONE
Explain why the
IR corresponds to a particular compound of those that are possible
based on BP and why it couldn't be any of the others -mention at
least 3 IR peaks that are present that correspond to functional
groups in your molecule, and discuss specific peaks that were
either present or absent that allowed you to rule out the other
compounds possible based on the boiling point. Reference your IR
spectra as figures.
the boiling
point for unkown 2:...
What alcohol IR spectrum is that when reacted with acetic
acid
UNKNOWN D PPM 112 1-butanol (n-butyl alcohol) 2-butanol (sec-butyl alcohol) 2-methyl-1-propanol (isobutyl alcohol) 3-methyl-1-butanol (isopentyl alcohol) 1-pentanol (n-pentyl alcohol) 2-pentanol 3-pentanol cyclopentanol
How many of the following molecules would you expect to be polar? 2-hexene 2-hexanol hexanal hexanoic acid ethyl pentanoate Select one: a. O b.3 c. 2 d. 4 e. 5 O f. 1
How many of the following molecules would you expect to be polar? 2-hexene 2-hexanol hexanal hexanoic acid ethyl pentanoate Select one: a. 4 b. 2 O c. 5 O d. 3 e. 1 f.o
EXPERIMENT 4 Organic Families - Reactions and Identification of Functional Groups PART A. Reactions of Alkanes and Alkenes 1. Action of Bromine Water Observation Organic Compound cyclohexene cyclohexane Equations: Write an equation for the above compounds which caused a decolourisation of bromine water. Name and draw all reactants and products. Distinguishing Test for Primary, Secondary and Tertiary Alcohols PART B. 1. Lucas Test for Alcohols Organic Compound tert-pentanol (2-methyl 2-butanol) 2-pentanol Observation 1-pentanol Equations: Write an equation for the above...
i
need more information about those picture. the pre-lab report
thanks.
Organic Chemistry Esperimeats Laberalory Masuals (CHM 221et and 2211i EXPERIMENT 3: Report and Worksheet BOILING POINT/REFRACTIVE INDEX student Name: Day: Student Nuaber Date: DATA UNKNOWN NUMBER: L. COMPOUND Obs Ref Obs. Ref 1.3791 80.C butanone 1.3793 83 C 2-propanol 1.3950 929 98-C 2-butanol 1.5463 178 °C benzaldehyde UNKNOWN COMPOUND IDENTITY OF UNKNOWN Lab-Form for Pre-lab Assignment (in a composition Notebook) Date of the experiment: Experiment #: Experiment Title: Purpose...
classify each of the following as a primary
CH-CHE The compound CH -CH-CH-CH-COOH is called a 3-hexanoic acid b. 2-ethyl pentancate C. 2-ethyl pentanoic acid d. 3-heptanoic acid e 4 -heptanoic acid (ioni 2 Fien) 5. Which equation correctly represents the dissociation of a carbovie acid? CH - -OH a CH-COOH + HO-CHY-COOH, OH b. CHY-COOH-CH.COO + H,0 c CH-COOH + H2O - CH-COO + H,09 d. CHỊ-COOH + HBO - CH2-COOH + MO e CH-COOH +24,0 - CH-C00+ 2H,0*...
What is the major organic product obtained from the following reaction? O 1. NaBHA 2. H20 a. 4-hydroxy-2-pentanone b.2-pentanone c. (E)-3-penten-2-ol d.2-pentanol
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 56 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago