Homework Answers
Add Answer to:
82, 41,42 ans 68
рессt уоu roduct for a particular reaction ent obtained only 19.21 g...
Question 4 1 pts Which of the following mole ratios CANNOT be derived from the reaction 2 502 (g) + O2 (g) + 2 H2...
Question 4 1 pts Which of the following mole ratios CANNOT be derived from the reaction 2 502 (g) + O2 (g) + 2 H20 (1) --> 2 H2SO4 (aq) ? 02 mol SO2 2 mol H2SO4 2 mol H2SO4 2 mol O2 0 1 mol O2 2 mol H20 O 2 mol O2 1 mol O2 2 mol H20 2 mol SO2 Question 1 1 pts What do the coefficients in a balanced equation tell us? Mark ALL that...
6. 48.6 mL of a 0.100 M NaOH solution is needed to react with 20.0 mL...
6. 48.6 mL of a 0.100 M NaOH solution is needed to react with 20.0 mL of an unknown concentration of HCl solution. What is the concentration of the HCl solution? 7. A colorless liquid has a composition of 84.1% carbon and 15.9% hydrogen by mass. Determine the empirical formula. Also, assuming the molar mass of this compound is 114.2 g/mol, determine the molecular formula of this compound. 8. What is the concentration of HCl in the final solution when...
2C +02 2Pb + O2 → 2CO) → 2P50) Eqs. 7.1 reactants products CH, + 2O...
2C +02 2Pb + O2 → 2CO) → 2P50) Eqs. 7.1 reactants products CH, + 2O + co, + 2H2O methane oxygen water C: carbon dioxide C: H: 2 x 2 O: 2 + 2 H: 4 4 1 = 4 = 4 O: 2 x 2 = Figure 7.4. A balanced chemical reaction with stoichiometric conventions noted. Question 7.4. Balance the following chemical reactions: a) CH4 +_2_02 _CO2 + 2 H20 b) CH-OH + 02 → CO2 + H2O...
GENERAL CHEMISTRY I Stoichiometry and Reactions NAME: ux 1.hat are the reactants in the chemical equation...
GENERAL CHEMISTRY I Stoichiometry and Reactions NAME: ux 1.hat are the reactants in the chemical equation below ? Grade Agts) AuNO, (aq) ANO, (aq) Au(s) a, Silver &Gold Nitrate . Silver& Gold b. Gold&Silver Nitrate d. Gold Nitrate & Silver Nitrate 2. Report the molar mass of Auso 3. How many hydrogen molecules are contained in 4.0 grams of H ? a. o.4M b. 12.0x10 c. 4.Omol d. 2.0g 4 What is the mass of 1.00 mole of calcium fluoride,...
POGIL-Stoichiometry How do chemists use balanced chemical equations? got bit D 23 mosquitoes? 10 He got...
POGIL-Stoichiometry How do chemists use balanced chemical equations? got bit D 23 mosquitoes? 10 He got Mol-aria Why? Chemists use balanced chemical equations as a basis to calculate how much reactant is needed or product is formed in a reaction. This is called Stoichiometry- (stoi-key-ah-meh-tree) Another way of looking at it is using the mole ratio from the balanced equation and information about one compound in the reaction to determine information about another compound in the equation. A mole ratio...
Date: Period: Name: You Try... 4. Given the following chemical equation 4P + 50; → 2...
Date: Period: Name: You Try... 4. Given the following chemical equation 4P + 50; → 2 PO (a) How many moles of P,0, are formed from 3.4 moles of O,? SHOW the math below (b) How many moles of P are needed to react with 30,1 moles of O,? SHOW the math below. 5. Aluminum reacts with copper(ll) chloride to make aluminum chloride and copper (a) Write the balanced equation (b) Given 6 moles of Cuch, how many moles of...
Homework #7A Name: Due date: 3-16-20 1. How many moles of water, H20, contain 9.03 *...
Homework #7A Name: Due date: 3-16-20 1. How many moles of water, H20, contain 9.03 * 10molecules of water? 2. How many molecules are present in 4.9 moles of L,CO3. 3. How many moles of oxygen are present in 4.9 moles of L.COM 4. How many Li atoms are in 4.5 moles of Li? 5. Calculate the mass, in grams, for 3.75 10 molecules of C2Hs. 6. Calculate the mass, in grams, for 3.5 moles of CHO. 7. Calculate the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
rele the best answer and mark on the Scantron card.- Four points each. 100 ponts 1)...
rele the best answer and mark on the Scantron card.- Four points each. 100 ponts 1) Determine the percent yield of a reaction that produces 28.65 g of Fe when 50.00 g of Fez03 react 1) with excess Al according to the following reaction. FezO3(s)+2 Al(s) - Al2O3(s)+2 Fe(s) A) 81.93 % B) 57.30 % C) 20.02 % D) 28.65 % E) 61.03 % 2) Sodium metal reacts with water to produce hydrogen gas and sodium hydroxide according to the...
Report Sheet-Lab 13 Report Sheet-Lab 12 A8 Moles of O Show A.9 mole Mg mole O : smaller value mol...
Report Sheet-Lab 13 Report Sheet-Lab 12 A8 Moles of O Show A.9 mole Mg mole O : smaller value moles Mgmoles Mg (rounded) moles。 moles O (rounded vele A.10 Formala: Mg subscripts Questions and Problems Q1 Using the rules for writing the formulas of ionic compounds, write the ions and the correct formula for magnesium oxide. 02 Write a balanced equation for the reaction of the magnesium and the oxygen. How many grams are needed to obtain 1.5 moles of...
Question 4 1 pts Which of the following mole ratios CANNOT be derived from the reaction 2 502 (g) + O2 (g) + 2 H20 (1) --> 2 H2SO4 (aq) ? 02 mol SO2 2 mol H2SO4 2 mol H2SO4 2 mol O2 0 1 mol O2 2 mol H20 O 2 mol O2 1 mol O2 2 mol H20 2 mol SO2 Question 1 1 pts What do the coefficients in a balanced equation tell us? Mark ALL that...
6. 48.6 mL of a 0.100 M NaOH solution is needed to react with 20.0 mL of an unknown concentration of HCl solution. What is the concentration of the HCl solution? 7. A colorless liquid has a composition of 84.1% carbon and 15.9% hydrogen by mass. Determine the empirical formula. Also, assuming the molar mass of this compound is 114.2 g/mol, determine the molecular formula of this compound. 8. What is the concentration of HCl in the final solution when...
2C +02 2Pb + O2 → 2CO) → 2P50) Eqs. 7.1 reactants products CH, + 2O + co, + 2H2O methane oxygen water C: carbon dioxide C: H: 2 x 2 O: 2 + 2 H: 4 4 1 = 4 = 4 O: 2 x 2 = Figure 7.4. A balanced chemical reaction with stoichiometric conventions noted. Question 7.4. Balance the following chemical reactions: a) CH4 +_2_02 _CO2 + 2 H20 b) CH-OH + 02 → CO2 + H2O...
GENERAL CHEMISTRY I Stoichiometry and Reactions NAME: ux 1.hat are the reactants in the chemical equation below ? Grade Agts) AuNO, (aq) ANO, (aq) Au(s) a, Silver &Gold Nitrate . Silver& Gold b. Gold&Silver Nitrate d. Gold Nitrate & Silver Nitrate 2. Report the molar mass of Auso 3. How many hydrogen molecules are contained in 4.0 grams of H ? a. o.4M b. 12.0x10 c. 4.Omol d. 2.0g 4 What is the mass of 1.00 mole of calcium fluoride,...
POGIL-Stoichiometry How do chemists use balanced chemical equations? got bit D 23 mosquitoes? 10 He got Mol-aria Why? Chemists use balanced chemical equations as a basis to calculate how much reactant is needed or product is formed in a reaction. This is called Stoichiometry- (stoi-key-ah-meh-tree) Another way of looking at it is using the mole ratio from the balanced equation and information about one compound in the reaction to determine information about another compound in the equation. A mole ratio...
Date: Period: Name: You Try... 4. Given the following chemical equation 4P + 50; → 2 PO (a) How many moles of P,0, are formed from 3.4 moles of O,? SHOW the math below (b) How many moles of P are needed to react with 30,1 moles of O,? SHOW the math below. 5. Aluminum reacts with copper(ll) chloride to make aluminum chloride and copper (a) Write the balanced equation (b) Given 6 moles of Cuch, how many moles of...
Homework #7A Name: Due date: 3-16-20 1. How many moles of water, H20, contain 9.03 * 10molecules of water? 2. How many molecules are present in 4.9 moles of L,CO3. 3. How many moles of oxygen are present in 4.9 moles of L.COM 4. How many Li atoms are in 4.5 moles of Li? 5. Calculate the mass, in grams, for 3.75 10 molecules of C2Hs. 6. Calculate the mass, in grams, for 3.5 moles of CHO. 7. Calculate the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
rele the best answer and mark on the Scantron card.- Four points each. 100 ponts 1) Determine the percent yield of a reaction that produces 28.65 g of Fe when 50.00 g of Fez03 react 1) with excess Al according to the following reaction. FezO3(s)+2 Al(s) - Al2O3(s)+2 Fe(s) A) 81.93 % B) 57.30 % C) 20.02 % D) 28.65 % E) 61.03 % 2) Sodium metal reacts with water to produce hydrogen gas and sodium hydroxide according to the...
Report Sheet-Lab 13 Report Sheet-Lab 12 A8 Moles of O Show A.9 mole Mg mole O : smaller value moles Mgmoles Mg (rounded) moles。 moles O (rounded vele A.10 Formala: Mg subscripts Questions and Problems Q1 Using the rules for writing the formulas of ionic compounds, write the ions and the correct formula for magnesium oxide. 02 Write a balanced equation for the reaction of the magnesium and the oxygen. How many grams are needed to obtain 1.5 moles of...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 39 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago