Homework Answers
according to balanced reaction
70.906 g Cl2 reacts with 2 x 22.990 g Na
53.2 g Cl2 reacts with 53.2 x 2 x 22.990 / 70.906 = 34.498 g Na
but we have 84.9 g Na.
so Na present in excess
limiting reagent = Cl2.
now
70.906 g Cl2 gives 2 x 55.441 g NaCl
53.2 g Cl2 gives 53.2 x 2 x 55.441 / 70.906 = 83.193 g NaCl
theoretical yield of NaCl = 83.193 g
Add Answer to:
2. ( pls.) Limiting Reactant and Theoretical Yield (7 pts.) 2Na (s) + Cl2 (g) →...
2. (7 pts.) Limiting Reactant and Theoretical Yield (7 pts.) 2Na (s) + Cl2 (g) -...
2. (7 pts.) Limiting Reactant and Theoretical Yield (7 pts.) 2Na (s) + Cl2 (g) - 2NaCl (s) You are given 84.9 g Na and 53.2 g Cl2. Find the limiting reactant, and calculate the theoretical yield in grams from the reaction shown above. (Box your answers!) Na = 22.990 g/mol; CI = 35.453 g/mol 22.990 mo lng & Appoy angl nach 229909x imoina Trimorol mol Nad mol 8Hana 2 molNG =0.265 35.453 g/mol x Imola x 2 mol Nach...
NAME 1) For the reaction shown, find the limiting reactant and the theoretical yield in moles...
NAME 1) For the reaction shown, find the limiting reactant and the theoretical yield in moles of potassium chloride (CI) with the following initial quantities of reactants: 14.6 mol K, 7.8 mol Cla 2 K{s} + Cla(g) – 2 KCl(s) 2) For the reaction shown, find the limiting reactant and the theoretical yield of the product (LiF) in grams for the following initial quantities of reactants: 10.5g Li and 37.2g F2 2 Li(s) + F2(g) → 2 Lif(s) 3) Consider...
s References] TUTOR Limiting Reactants: Compare Reactant Moles The theoretical yield of a reaction is the...
s References] TUTOR Limiting Reactants: Compare Reactant Moles The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is completely converted to product Consider the reaction: 2 Fe(s) +3 Cl2(g) 2 FeCl3(s) If 19.85 g Fe is mixed with 14.22 g Cl2, calculate the theoretical yield (g) of FeCl3 produced by the reaction g Show Approach Show Tutor Steps Submit
A chemist measures the enthalpy change ΔH during the following reaction: 2Na (s) + Cl2 (g)...
A chemist measures the enthalpy change
ΔH
during the following reaction:
2Na
(s)
+
Cl2
(g)
→
2NaCl
(s)
=ΔH−822.kJ
Use this information to complete the table below. Round each of
your answers to the nearest
/kJmol
.
A chemist measures the enthalpy change AH during the following reaction: 2Na(s) + Cl2(g)→2 NaCl(s) NH=-822. kJ Use this information to complete the table below. Round each of your answers to the nearest kJ/mol reaction △H kJ NaCl(s) → Na(s) + Cl2(g)...
Given the reaction, find the limiting reactant if 358 g CO and 62 g H2 are used? What is the theoretical yield? 2. Given...
Given the reaction, find the
limiting reactant if 358 g CO and 62 g H2 are used?
What is the theoretical yield?
2. Given the reaction, CO (g) + 2 H2(g) → CH3OH (/), find the limiting reactant if 358,0 g CO and 62.0 g of H2 are used (2 pts). 358gco Imolco I mol CH₃ alt - 11.18 a CH ₂ OH | HR is the Imolco Imol CH₃OH 329 CH₃OH limiting 629 H2 2 2. mol H₂ 1...
4. Consider the chemical equation for the synthesis of sodium chloride. (0.5 points per blank) 2Na...
4. Consider the chemical equation for the synthesis of sodium chloride. (0.5 points per blank) 2Na (s) + Cl2 (g) -----> 2NaCl(g) How many moles of NaCl can be formed from 2 moles of Na and 1 mole of Cl2? ______mol NaCl If you have 8 moles of Na and 5 moles of Cl2, how many moles of NaCl could be produced? Which reactant limits the amount of product? ________ mol NaCl __________ is the limiting reactant. How many moles...
Limiting Reactant, Theoretical Yield and Percent Yield 2. Pentane combusts with en to form carbon dioxide...
Limiting Reactant, Theoretical Yield and Percent Yield 2. Pentane combusts with en to form carbon dioxide and water by the following reaction: CsHız(1) + 8 O2(g) → 5 CO2(g) + 6H2O(g) a. If 8.00 g of pentane is mixed with 10.0 g of oxy compare it to either of the products). he is mixed with 10.0 g of oxygen, which is the limiting reactant? (Hint: b. What is the theoretical yield (in grams) of carbon dioxide and water for this...
Consider the following UNBALANCED equation: Na(s) + Cl2(g) -> NaCl(s). a.) Calculate the limiting reagent when...
Consider the following UNBALANCED equation: Na(s) + Cl2(g) -> NaCl(s). a.) Calculate the limiting reagent when 55.0 g of react with 67.2 g of Cl2. (Show all work, and clearly state which is the limiting reagent.) b.) What is the theoretical yield, in grams, of NaCl? c.) If 105g of NaCl is produced from the reaction, what is the percent yield of NaCl?
The theoretical yield of a reaction is the amount of product obtained if the limiting reactant...
The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is completely converted to product. Consider the reaction: 4 Fe(s) + 3 O2(g) → 2 Fe2O3(s) If 16.98 g Fe is mixed with 7.740 g O2, calculate the theoretical yield (g) of Fe2O3 produced by the reaction.
B. Calculate the standard entropy change for the reaction 2Na(s)+Cl2(g)?2NaCl(s) using the data from the following t...
B. Calculate the standard entropy change for the reaction
2Na(s)+Cl2(g)?2NaCl(s)
using the data from the following table:
Substance
?H?f (kJ/mol)
?G?f (kJ/mol)
S? [J/(K?mol)]
Na(s)
0.00
0.00
51.30
Cl2(g)
0.00
0.00
223.1
NaCl(s)
-411.0
-384.0
72.10
Express your answer to four significant figures and include the
appropriate units.
Part A Predict the sign of the entropy change, AS°,for each of the reaction displayed. Drag the appropriate items to their respective bins. Ag+(aq) + Cl-(aq) → AgCl(s) | | Ca(OH)2(s) →...
2. (7 pts.) Limiting Reactant and Theoretical Yield (7 pts.) 2Na (s) + Cl2 (g) - 2NaCl (s) You are given 84.9 g Na and 53.2 g Cl2. Find the limiting reactant, and calculate the theoretical yield in grams from the reaction shown above. (Box your answers!) Na = 22.990 g/mol; CI = 35.453 g/mol 22.990 mo lng & Appoy angl nach 229909x imoina Trimorol mol Nad mol 8Hana 2 molNG =0.265 35.453 g/mol x Imola x 2 mol Nach...
NAME 1) For the reaction shown, find the limiting reactant and the theoretical yield in moles of potassium chloride (CI) with the following initial quantities of reactants: 14.6 mol K, 7.8 mol Cla 2 K{s} + Cla(g) – 2 KCl(s) 2) For the reaction shown, find the limiting reactant and the theoretical yield of the product (LiF) in grams for the following initial quantities of reactants: 10.5g Li and 37.2g F2 2 Li(s) + F2(g) → 2 Lif(s) 3) Consider...
s References] TUTOR Limiting Reactants: Compare Reactant Moles The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is completely converted to product Consider the reaction: 2 Fe(s) +3 Cl2(g) 2 FeCl3(s) If 19.85 g Fe is mixed with 14.22 g Cl2, calculate the theoretical yield (g) of FeCl3 produced by the reaction g Show Approach Show Tutor Steps Submit
A chemist measures the enthalpy change
ΔH
during the following reaction:
2Na
(s)
+
Cl2
(g)
→
2NaCl
(s)
=ΔH−822.kJ
Use this information to complete the table below. Round each of
your answers to the nearest
/kJmol
.
A chemist measures the enthalpy change AH during the following reaction: 2Na(s) + Cl2(g)→2 NaCl(s) NH=-822. kJ Use this information to complete the table below. Round each of your answers to the nearest kJ/mol reaction △H kJ NaCl(s) → Na(s) + Cl2(g)...
Given the reaction, find the
limiting reactant if 358 g CO and 62 g H2 are used?
What is the theoretical yield?
2. Given the reaction, CO (g) + 2 H2(g) → CH3OH (/), find the limiting reactant if 358,0 g CO and 62.0 g of H2 are used (2 pts). 358gco Imolco I mol CH₃ alt - 11.18 a CH ₂ OH | HR is the Imolco Imol CH₃OH 329 CH₃OH limiting 629 H2 2 2. mol H₂ 1...
Limiting Reactant, Theoretical Yield and Percent Yield 2. Pentane combusts with en to form carbon dioxide and water by the following reaction: CsHız(1) + 8 O2(g) → 5 CO2(g) + 6H2O(g) a. If 8.00 g of pentane is mixed with 10.0 g of oxy compare it to either of the products). he is mixed with 10.0 g of oxygen, which is the limiting reactant? (Hint: b. What is the theoretical yield (in grams) of carbon dioxide and water for this...
B. Calculate the standard entropy change for the reaction
2Na(s)+Cl2(g)?2NaCl(s)
using the data from the following table:
Substance
?H?f (kJ/mol)
?G?f (kJ/mol)
S? [J/(K?mol)]
Na(s)
0.00
0.00
51.30
Cl2(g)
0.00
0.00
223.1
NaCl(s)
-411.0
-384.0
72.10
Express your answer to four significant figures and include the
appropriate units.
Part A Predict the sign of the entropy change, AS°,for each of the reaction displayed. Drag the appropriate items to their respective bins. Ag+(aq) + Cl-(aq) → AgCl(s) | | Ca(OH)2(s) →...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 52 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago