Workshop Quiz 10-Substitution and elimination 1. Choose the reaction that is least likely to undergo an...
Choose the reaction that is least likely to undergo an Sn2 reaction pathway. Question 1 A to anyone tool CH3OH OCH NaN3 CH2CN C HC- NaCN → HC-CN DMF NaSCH OTS S-CHE acetone Enter Your Answer: OA OBOCODE
Q1. Identify the reaction mechanism most likely to take place (E1, SN1, E2, SN2 or a combination of these) in each of the following cases. Draw the major product(s), include stereochemistry when relevant. Br -OtBu Br NaCN, DMF → CI Носна 1. Nal/acetone 2. NaCN/DMF NaoMe H2SO4 OH Lyon CN (CH3)2CO CI NaOH →
3. Shown below are a series of reactions. Predict the major product for each of them. Remember, you will need to first decide whether the reaction occurs by an SN2, SN1, E2, or E1 before you can determine what the product will be. Label each as SN2, SN1, E2, or E1. Hint: First decide whether S2/E2 or S1/E1 is favored, and then decide whether the reaction pathway goes by a substitution or elimination reaction. SN2 / SN1 E2/E1 Na DMSO,rt...
Choose the reaction that is least likely to undergo an E2 reaction pathway. Question 2 NaOCH3 CH,он Br O он В кос(сH,) нос(CH,) Br D NaC CH CH2CN кос(CH) C НОС(CH,)з D O C O E Enter Your Answer: OA (R)-1-bromo-2-methylbutane undergoes substitution when reacted with sodium iodide (NaI) in acetone. Choose the major product obtained from this reaction. Question 3 A (R)-1-iodo-2-methyl butane B (S)-1-iodo-2-methylbutane C racemic 1-iodo-2- methylbutane D (R)-1-bromo-2-iodobutane E (S)-1-bromo-2-iodobutane F (S)-1-sodium-2-methylbutane A B F F...
9. Predict the product for the following reaction. OTS 1. Nal/acetone 2. NaCN/DMF CN II II IV 10. Which of the following methods would be expected to efficiently produce cis-2-butene as the major organic product? a. CH3C CCH3 + H2, Pt b. CH3CHBrCH2CH3+(CHs)3COK/(CH3); COH c. CH3C CCH +H2, Ni2B (P-2) d. CH3C CCH +Na, NH3() 11. Which of the following is the structure for (2E,4E)-octa-2,4-dien-6-yne? IV ш п