What is the activity coefficient of Ht in a solution containing 0.073 M HCl and 0.0090...

Question

Question

Answer 1

Answer #1

Ans :-

Activity coefficient of H⁺ = 0.825 and

pH = 1.22

Sol onic strength 2 of solution CA +Cceoc Co.073M).CI) +C0-073 M)CI)+lo .0090m)CH) C2x0.0090 M)C O 2 Also, 30 S 0SICt) C 30S

Answer 2

Similar Homework Help Questions

What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090...

What is the activity coefficient of H in a solution containing 0.073 M HCI and 0.0090 M Ca(CIO,)? Activity coefficients at various ionic strengths can be found in this table. Y = What is the pH of this solution? pH Charge +/-1 H* Activity coefficient (y) 900 (CaH5i2CHCO2, (C3H7)4N* (02N)3CH20",(C3H7) NH*, CH3OgH4Co2 0.967 0.933 0.914 0.96 800 0.966 0.931 0.83 0.912 0.85 0.82 700 0.965 0.930 0.909 0.845 0.81 L CeHsCO2, HOC H4CO, CICeH4CO, CsHgCH2C02 CH2-CHCH2CO2(CH3)2CHCH2CO2, (CH3CH2)4N, (C3H7)2NH2+ 600 0.965...
Question 9 of 11 > Determine the pH of a solution containing 0.050 M NaOH and...

Question 9 of 11 > Determine the pH of a solution containing 0.050 M NaOH and 0.025 M KI neglecting activities. pH = Determine the pH of the same solution including activities. Activity coefficients at various ionic strengths can be found in this table. pH =
What is the activity coefficient for each ion at the given ionic strength at 25 °C?...

What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various ionic strengths can be found in this table. Cro-(0.005 M) y Sc3+ (u0.001 M) y= Dy3 ( 0.001 M) (CH,CHNH (u= 0.001 M) y=

Determine the pH of a solution containing 0.050 M NaOH and 0.025 M KI neglecting activities....

Determine the pH of a solution containing 0.050 M NaOH and 0.025 M KI neglecting activities. pH= Determine the pH of the same solution including activities. Activity coefficients at various ionic strengths can be found in this table, pH= contact u help terms of use privacy policy about us careers MacBook Pro DIl FB en F7 8
What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various io...

What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various ionic strengths can be found in this table. Hgzł (u = 0.1M) y = Y3+ (u = 0.001 M) y = Pr3+ (u = 0.01 M) y = (CH, CH2)2NH+ (u = 0.01 M) y =
What is the activity coefficient for each ion at the given ionic strength at 25 °C?...

What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various ionic strengths can be found in this table. Hg2+ (u = 0.005 M) y= Sc3+ (u = 0.01 M) y= Eu3+ (u = 0.1 M) y= (CH, CH,),NH" u = 0.005 M) x= |

What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at variou...

What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various ionic strengths can be found in this table. Soz - (u = 0.005 M) y = 0.7333 A1+ (4 = 0.05 M) Y= 0.1449 Pr3+ (u = 0.1 M) Y = 0.07892 (CH,CH, NH" (k = 0.005 M) Y = 0,9254
what is the activity coefficient of each? use the table provided below: What is the activity...

what is the activity coefficient of each? use the table provided below: What is the activity coefficient for each ion at the given ionic strength at 25 °C? Activity coefficients at various ionic strengths can be found in this table. = 0.05 M) Number 0.25 COA A0.001 M) Number 0.00022 Eu3+ ( 0.1 M) Number 0.022 (CH3CH2)3NH+ (μ = 0.05 M) Number Incorrect. 0.10
What is the activity coefficient for each ion at the given ionic strength at 25 "C?...

What is the activity coefficient for each ion at the given ionic strength at 25 "C? Activity coefficients at various ionic strengths can be found in this table. HPO- (x = 0.1 M) = 0.23 A1+ (x = 0.01 M) Y = 0.35 Eu ( = 0.001 M) = 0.71 (CH, CH , NH" (H = 0,1 M) m 0.69

Please help. i will rate What is the activity coefficient for each ion at the given ionic strength at 25°C? Activi...

Please help. i will rate What is the activity coefficient for each ion at the given ionic strength at 25°C? Activity coefficients at various ionic strengths can be found in this table. so - (x = 0.1 M) Y = .476 AP (4 = 0.01 M) y = .348 Dy! (u = 0.05 M) = 0,0941 (CH,CH), NH* (4 m (0.001 M) ¥m (0,9635 Ion Use the Debye-Hückel equation to calculate the activity coefficient of each ion at the given...