Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form...
Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form of heat accoarding to the reaction below. CH2CO(g)+2O2(g)=2CO2+H2O(g) Delta H=-981.1 KJ
Homework Answers
Add Answer to:
Determine the mass of carbon doixide produced when 1500KJ of
energy is released in the form...
Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to...
Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 450 kJ of heat. C(s)+O2(g)→CO2(g)ΔH∘rxn=−393.5kJ
Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to...
Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 4.50×10^2 kJ of heat. C(s)+O2(g)→CO2(g) ΔrH∘= −393.5kJ mol−1
Calculate the mass of CO2 produced (in grams) when 575 kJ of thermal energy are released....
Calculate the mass of CO2 produced (in grams) when 575 kJ of thermal energy are released. Be sure to indicate the proper algebraic sign. 4CO(g) + 2NO2(g) → 4CO2(g) + N2(g) ∆H°= -1198.2 kJ
Energy 4. (3 points) How much heat is released when 150.0 g of copper cool down...
Energy 4. (3 points) How much heat is released when 150.0 g of copper cool down from 70.1°C to 22.3"C7 Specific hest capacity of copper is 0.385 g"C. 5. (3 points) During combustion of acetylene, CHą, according to the reaction below 1299 kJ are released: C Hz + 5/20, 200, + H2O AH = -1299 kJ How much energy is liberated when 100.0 of acetylene combust? 6.3 points) Given the following equations and AH values, determine the heat of reaction...
someone please answer these questions :) c) Calculate the amount of heat released when 15.5g of...
someone please answer these questions :)
c) Calculate the amount of heat released when 15.5g of carbon reacts d) What mass of carbon must react to produce 1575 kJ of heat? 3) For the reaction: 2 Li + F2 → 2 LiF a) What mass of LiF will be formed is 10.5 g of Li reacts with 37.2 g of F2? b) What is the limiting reactant? c) If 21.0g of LiF is actually produced, what is the percent yield?...
Calculate the mass of CO2 produced in grams) when 575 kJ of thermal energy are released....
Calculate the mass of CO2 produced in grams) when 575 kJ of thermal energy are released. Be sure to indicate the proper algebraic sign. 4CO(g) + 2NO2(8) 4CO2(g) + N2(8) AHⓇ=-1198.2 kJ
When wine goes bad, the ethanol (C2H5OH) is converted to acetic acid (HC2H3O2) in the following...
When wine goes bad, the ethanol (C2H5OH) is converted to acetic acid (HC2H3O2) in the following reaction: C2H5OH(l)+O2(g)→HC2H3O2(l)+H2O(l) However, this is usually a slow reaction, and when doing it in a calorimeter, the reaction goes to complete oxidation, giving the heats of reaction listed below: C2H5OH(l)+3O2(g)→2CO2(g)+3H2O(l),HC2H3O2(l)+2O2(g)→2CO2(g)+2H2O(l),ΔH∘=1410 kJ/molΔH∘=874 kJ/mol Part B Determine the heat of the reaction (ΔH) for the conversion of ethanol to acetic acid.
The following thermochemical equation is for the reaction of carbon monoxide(g) with water(l) to form carbon...
The following thermochemical equation is for the reaction of carbon monoxide(g) with water(l) to form carbon dioxide(g) and hydrogen(g). CO(g) + H2O(l) CO2(g) + H2(g) H = 2.80 kJ When 9.83 grams of carbon monoxide(g) react with excess water(l),_______________ kJ of energy are___________ ( absorbed or evolved ) .
Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon to produce 5.00 x 102 kJ of...
Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon to produce 5.00 x 102 kJ of heat. C(s) + O2(g) = CO2(g) DH = -393.5 kJ
Calculate the heat of reaction at constant pressure for the reaction of carbon with hydrogen gas...
Calculate the heat of reaction at constant pressure for the reaction of carbon with hydrogen gas and oxygen gas that produces acetic acid, CH3COOH. The following values may prove helpful: CH3COOH(l) + 2O2 (g) → 2CO2 (g) + 2H2O(l) ∆H = -871kJ C(graphite) + O2 (g) → CO2 (g) ∆H = -394kJ H2 (g) + 1/2 O2 (g) → H2O (l) ∆H = -286kJ
Energy 4. (3 points) How much heat is released when 150.0 g of copper cool down from 70.1°C to 22.3"C7 Specific hest capacity of copper is 0.385 g"C. 5. (3 points) During combustion of acetylene, CHą, according to the reaction below 1299 kJ are released: C Hz + 5/20, 200, + H2O AH = -1299 kJ How much energy is liberated when 100.0 of acetylene combust? 6.3 points) Given the following equations and AH values, determine the heat of reaction...
someone please answer these questions :)
c) Calculate the amount of heat released when 15.5g of carbon reacts d) What mass of carbon must react to produce 1575 kJ of heat? 3) For the reaction: 2 Li + F2 → 2 LiF a) What mass of LiF will be formed is 10.5 g of Li reacts with 37.2 g of F2? b) What is the limiting reactant? c) If 21.0g of LiF is actually produced, what is the percent yield?...
Calculate the mass of CO2 produced in grams) when 575 kJ of thermal energy are released. Be sure to indicate the proper algebraic sign. 4CO(g) + 2NO2(8) 4CO2(g) + N2(8) AHⓇ=-1198.2 kJ
Most questions answered within 3 hours.
-
A uniform magnetic field is perpendicular to the plane of a wire
loop. If the loop...
asked 4 minutes ago -
Preparation of Benzoic Acid using a Grignard Reagent URGENT
1. During your Grignard formation, a small...
asked 5 minutes ago -
At the peak of your career, your were earning $120,000 and
holding a top level position....
asked 7 minutes ago -
. A permanent magnet is dropped south-end-down through a horizontal
circular coil with a radius of...
asked 9 minutes ago -
Bernie's Beverages purchased some fixed assets classified as
5-year property for MACRS. The assets cost $28,000....
asked 23 minutes ago -
How many ATPs are produced from the catabolism of a 10-C
molecule of fatty acid under...
asked 28 minutes ago -
Before practicing a routine on the rings, a 64.8 kg gymnast
hangs motionless, with one hand...
asked 29 minutes ago -
If the K b of a weak base is 6.3 × 10 − 6 , what...
asked 36 minutes ago -
Which of the following is the minimum amount of moles of NaOH
that must be added...
asked 39 minutes ago -
Stories about organizational ________ provide important clues
about cultural values and norms.
a. myths
b. heroes...
asked 41 minutes ago -
Explain the criteria used in selecting a target market
BUS220 Retail Management, thank you!
asked 43 minutes ago -
Convert/Calculate the following:
Determine the identity of an elemental gas if 4.55 L weighing
35.4g, under...
asked 46 minutes ago