Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 450 kJ of heat. C(s)+O2(g)→CO2(g)ΔH∘rxn=−393.5kJ
C(s) + O2(g) → CO2(g) ΔH∘rxn=−393.5kJ
C(s) + O2(g) → CO2(g)
44 g 393.5 kJ of heat
? 450 kJ of heat
From the above equation, we can say that
44 g of CO2 produced by burning enough carbon (in the form of charcoal) to produce 393.5 kJ of heat.
So, ? g CO2 produced by burning enough carbon (in the form of charcoal) to produce 450 kJ of heat.
? = 44 g of CO2 x (450 kJ of heat / 393.5 kJ of heat)
= 50.31 g of CO2
Therefore,
mass of CO2 produced = 50.31 g
Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to...
Determine the mass of CO2produced by burning enough carbon (in the form of charcoal) to produce 450 kJ of heat. C(s)+O2(g)→CO2(g)ΔH∘rxn=−393.5kJ
Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 4.50×10^2 kJ of heat. C(s)+O2(g)→CO2(g) ΔrH∘= −393.5kJ mol−1
Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 460kJ of heat. C(s)+O2(g)❝CO2(g)ΝH❝rxn=❝393.5kJ
Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon to produce 5.00 x 102 kJ of heat. C(s) + O2(g) = CO2(g) DH = -393.5 kJ
a) Determine the mass of CO2 produced by burning enough of methane to produce 1.50×102kJ of heat. CH4(g)+2O2(g)→CO2(g)+2H2O(g)ΔH∘rxn=−802.3kJ b) Determine the mass of CO2 produced by burning enough of propane to produce 1.50×102kJ of heat. C3H8(g)+5O2(g)→3CO2(g)+4H2O(g)ΔH∘rxn=−2217kJ c) Determine the mass of CO2 produced by burning enough of octane to produce 1.50×102kJ of heat. C8H18(l)+25/2O2(g)→8CO2(g)+9H2O(g)ΔH∘rxn=−5074.1kJ d) Which fuel contributes least to global warming per of heat produced? methane propane octane
A) A silver block, initially at 55.4 ∘C, is submerged into 100.0 g of water at 25.3 ∘C, in an insulated container. The final temperature of the mixture upon reaching thermal equilibrium is 26.8 ∘C. What is the mass of the silver block? B) Charcoal is primarily carbon. What mass of CO2 is produced if you burn enough carbon (in the form of charcoal) to produce 4.50×102kJ of heat? The balanced chemical equation is as follows: C(s)+O2(g)→CO2(g),ΔH∘rxn=−393.5kJ
Given: C(s) + O2(g) ---> CO2(g) ΔH = −393.5 kJ/mol S(s) + O2(g) ---> SO2(g) ΔH = −296.8 kJ/mol C(s) + 2S(s) ---> CS2(ℓ) ΔH = +87.9 kJ/mol A) Calculate the standard enthalpy change for the following reaction CS2(ℓ) + 3O2(g) ---> CO2(g) + 2SO2(g) ΔH° rxn = -1075 kJ/mol B) Using the equation and standard enthalpy change for the reaction (from part A), calculate the amount of heat produced or consumed when 3.2 mol of CS2 reacts with excess...
Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form of heat accoarding to the reaction below. CH2CO(g)+2O2(g)=2CO2+H2O(g) Delta H=-981.1 KJ
Need help solving theses with step by step will be on a test so I really want to know how to them do. Thanks. Part A Determine the mass of CO2 produced by burning enough of methane to produce 2.25 x10 kJ of heat. CH,(g)-, 2 O2(g) → CO2(g) + 2 H2O(g) dMrsn =-802.3 kJ Express your answer using three significant figures. Submit G Give Up Part B Determine the mass of CO2 produced by burning enough of ℃,Hs(g1+ 502(g)...
Part A and Part B for reference: Chapter 18 <Chapter 18 Byproducts of Burning Fossil Fuels © 10 0f 15 > Review Constants Periodic Table Coal is a fossil fuel made primarily of carbon, but it also contains sulfur among other elements. Submit Previous Answers When carbon, C, burns in air, it reacts with oxygen, O2, to produce carbon dioxide, CO2 C(s) + O2(g) +CO2(g) Correct Since SO, readily forms sulfuric acid, H.SO, sulfur dioxide in the atmosphere leads to...