Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 460kJ of heat. C(s)+O...

Question

Question

Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 460kJ of heat. C(s)+O...

Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 460kJ of heat. C(s)+O2(g)❝CO2(g)ΝH❝rxn=❝393.5kJ

science chemistry

Add a comment Improve this question Transcribed image text

Answer 1

Answer #1

The given reaction is, C(s)+O2 (g)CO2 (g) AH393.5kJ The energy released for one mole of gas is 393.5kJ For 460kJ of heat, the

Add a comment

Answer 2

Answer #2

C + O2 --> CO2 delta H rxn = -393.5

First, they gave you that the enthalpy of reaction is -393.5 kJ/mole (those are the units that should have been included). The amount of material to give you 520 kJ is

Moles carbon = 460 kJ/(393.5 kJ/mole) = 1.168 moles
Moles CO2 = moles C = 1.32 moles
Mass CO2 = 1.168 moles * 44.01 g/mole = 51.44g

Add a comment

Answer 3

Similar Homework Help Questions

Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to...

Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 450 kJ of heat. C(s)+O2(g)→CO2(g)ΔH∘rxn=−393.5kJ
Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to...

Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 4.50×10^2 kJ of heat. C(s)+O2(g)→CO2(g) ΔrH∘= −393.5kJ mol−1
Determine the mass of CO2produced by burning enough carbon (in the form of charcoal) to produce...

Determine the mass of CO2produced by burning enough carbon (in the form of charcoal) to produce 450 kJ of heat. C(s)+O2(g)→CO2(g)ΔH∘rxn=−393.5kJ

Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon to produce 5.00 x 102 kJ of...

Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon to produce 5.00 x 102 kJ of heat. C(s) + O2(g) = CO2(g) DH = -393.5 kJ
a) Determine the mass of CO2 produced by burning enough of methane to produce 1.50×102kJ of...

a) Determine the mass of CO2 produced by burning enough of methane to produce 1.50×102kJ of heat. CH4(g)+2O2(g)→CO2(g)+2H2O(g)ΔH∘rxn=−802.3kJ b) Determine the mass of CO2 produced by burning enough of propane to produce 1.50×102kJ of heat. C3H8(g)+5O2(g)→3CO2(g)+4H2O(g)ΔH∘rxn=−2217kJ c) Determine the mass of CO2 produced by burning enough of octane to produce 1.50×102kJ of heat. C8H18(l)+25/2O2(g)→8CO2(g)+9H2O(g)ΔH∘rxn=−5074.1kJ d) Which fuel contributes least to global warming per of heat produced? methane propane octane
A) A silver block, initially at 55.4 ∘C, is submerged into 100.0 g of water at...

A) A silver block, initially at 55.4 ∘C, is submerged into 100.0 g of water at 25.3 ∘C, in an insulated container. The final temperature of the mixture upon reaching thermal equilibrium is 26.8 ∘C. What is the mass of the silver block? B) Charcoal is primarily carbon. What mass of CO2 is produced if you burn enough carbon (in the form of charcoal) to produce 4.50×102kJ of heat? The balanced chemical equation is as follows: C(s)+O2(g)→CO2(g),ΔH∘rxn=−393.5kJ

Calculate the heat change, in kJ, if 8.7395x1012 ng of carbon dioxide were produced in the following reaction: C(s)...

Calculate the heat change, in kJ, if 8.7395x1012 ng of carbon dioxide were produced in the following reaction: C(s) + O2(g) CO2(g) AH = -393.5 kJ/mol q=C MAT
Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide. Carbon dioxide...

Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide. Carbon dioxide is a greenhouse gas, so over-production can have negative effects on the environment. Use enthalpy of formation data to calculate the number of moles of CO2(g) produced per megajoule of heat released from the combustion of each fuel under standard conditions (1 atm and 25 �C). Each must be in mol * MJ^-1 (a) coal, C(s, graphite) (b) natural gas, CH4(g); (c) propane, C3H8(g);...
Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form...

Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form of heat accoarding to the reaction below. CH2CO(g)+2O2(g)=2CO2+H2O(g) Delta H=-981.1 KJ

Calculate the amount of carbon dioxide produced when burning 10.0 g of propane with 5 g...

Calculate the amount of carbon dioxide produced when burning 10.0 g of propane with 5 g of oxygen in the following reaction. C3H8 + 5 O2 -------> 3 CO2 + 4 H2O

Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 460kJ of heat. C(s)+O...

Homework Answers

Add Answer to:
Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to produce 460kJ of heat. C(s)+O...

Post as a guest

Earn Coins

Charcoal is primarily carbon. Determine the mass of CO2 produced by burning enough carbon (in the form of charcoal) to...