Homework Answers
Add Answer to:
Question 2 (1 pt) When treated with aqueous NaOH, the following compounds give an aldol product...
NaOEt OET ETOH HCI H2O NaOH H2O 1. LIAIHA 2. H20 CH420 Question 2 (1 pt)...
NaOEt OET ETOH HCI H2O NaOH H2O 1. LIAIHA 2. H20 CH420 Question 2 (1 pt) When treated with aqueous NaOH, the following compounds give an aldol product which then undergoes dehydration to give a new product (with Estereochemistry). Please give structural formulas for both products. NaOH NaOH + H20 Н20 H20 Aldol product Question 3 (1 pt) How many different aldols (B-hydroxyaldehydes), including constitutional isomers and stereoisomers, are formed upon treatment of propanal with a base?
Due date: Nov. 8, 2019 (right before lecture). Total points: 5 Question 1 (3 pts) Please...
Due date: Nov. 8, 2019 (right before lecture). Total points: 5 Question 1 (3 pts) Please fill in the boxes with the missing structures. HCI NaOEt NaOH HC 2 Hо OEt EIOH Но Hао 1. LIAH 2.H20 CaHO Question 2 (1 pt) When treated with aqueous NaOH, the following compounds give an aldol product which then undergoes dehydration to give a new product (with E stereochemistry). Please give structural formulas for both products. NaOH NaOH + H20 H + Нао...
Draw a structural formula for the product of each crossed aldol reaction (catalyzed by NaOH) and...
Draw a structural formula for the product of each crossed aldol reaction (catalyzed by NaOH) and for the compounds formed by dehydration of each aldol product. 1. a) -H20 b) но -H2o d) -H2O
8. What product is expected when the following aldehyde is treated with an aqueous sodium hydroxide...
8. What product is expected when the following aldehyde is treated with an aqueous sodium hydroxide solution? OH H20 он OH OH OH 19 Consider the transformation shown below. Two reactions, both of which involve an enolate, take place, which leads to the product shown. What reactions take place? 1. strong base 0 2. H20 A A Michael addition and a Dieckmann reaction B An Aldol reaction and a Michael addition C Two Michael additions D ADieckmann reaction and an...
Practice the Skill 21.15a When the following ketone is treated with aqueous sodium hydroxide, the aldol...
Practice the Skill 21.15a When the following ketone is treated with aqueous sodium hydroxide, the aldol product is obtained in poor yields. In these cases, special distillation techniques are used to increase the yield of aldol product. Predict the aldol addition product that is obtained, and propose a mechanism for its formation. For the mechanism, draw the curved arrows as needed. Include lone pairs and charges in your answer. Do not draw out any hydrogen explicitly in your products. Do...
which of the following molecules cannot undergo an intramolecular aldol condensation when treated with NaOH Which...
which of the following molecules cannot undergo an
intramolecular aldol condensation when treated with NaOH
Which of the following molecules cannot undergo an intramolecular aldol condensation when treated with NaOH
4. In the following reaction the aldol product C is difficult to isolate, and even without...
4. In the following reaction the aldol product C is difficult to isolate, and even without heating the dehydration product D is formed instead. Explain. ОН н NaOH Н Н.о н С 5. Draw all possible aldol products from this mixed aldol reaction (not dehydrated). NaOH + Н.о H 6. Give the major organic product from each mixed aldol reaction. Then explain why the reaction conditions favor one product instead of generating a mixture of products. NaOH a. Но Н...
please answer all of the 4 questions What cyclic product is formed in the intramolecular Aldol...
please answer all of the 4 questions
What cyclic product is formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? OT 11 0 0 IV What is the Aldol addition product formed from reaction of the following compound with itself? ++,C#o Cาถวาย 0 0 0 What is the cyclic product formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? 08 pod od IV OT O II III O...
1. Predict the product(s) obtained when the following compounds is treated with HNO/H,50 2. Predict the...
1. Predict the product(s) obtained when the following compounds is treated with HNO/H,50 2. Predict the products when each of the following compounds is treated with CH,Cl/AICI, assume conditions are controlled for mono-alkylation:
11.10_1 What is a major product of the following reaction? NaOH, HO 2 ~ CHO ?...
11.10_1 What is a major product of the following reaction? NaOH, HO 2 ~ CHO ? heat CHO CHO A) B) CHO D) CHO C) СА B oc 11.105 Which of the following is the best way to synthesize the compound in the box in high yield? A) Phyp NaOH B) mily Н,0 PPhg C) NaOH ox + D) H2O 11.10_4 In the presence of a base which of the following compounds WILL NOT undergo self- condensation to give an...
NaOEt OET ETOH HCI H2O NaOH H2O 1. LIAIHA 2. H20 CH420 Question 2 (1 pt) When treated with aqueous NaOH, the following compounds give an aldol product which then undergoes dehydration to give a new product (with Estereochemistry). Please give structural formulas for both products. NaOH NaOH + H20 Н20 H20 Aldol product Question 3 (1 pt) How many different aldols (B-hydroxyaldehydes), including constitutional isomers and stereoisomers, are formed upon treatment of propanal with a base?
Due date: Nov. 8, 2019 (right before lecture). Total points: 5 Question 1 (3 pts) Please fill in the boxes with the missing structures. HCI NaOEt NaOH HC 2 Hо OEt EIOH Но Hао 1. LIAH 2.H20 CaHO Question 2 (1 pt) When treated with aqueous NaOH, the following compounds give an aldol product which then undergoes dehydration to give a new product (with E stereochemistry). Please give structural formulas for both products. NaOH NaOH + H20 H + Нао...
Draw a structural formula for the product of each crossed aldol reaction (catalyzed by NaOH) and for the compounds formed by dehydration of each aldol product. 1. a) -H20 b) но -H2o d) -H2O
8. What product is expected when the following aldehyde is treated with an aqueous sodium hydroxide solution? OH H20 он OH OH OH 19 Consider the transformation shown below. Two reactions, both of which involve an enolate, take place, which leads to the product shown. What reactions take place? 1. strong base 0 2. H20 A A Michael addition and a Dieckmann reaction B An Aldol reaction and a Michael addition C Two Michael additions D ADieckmann reaction and an...
Practice the Skill 21.15a When the following ketone is treated with aqueous sodium hydroxide, the aldol product is obtained in poor yields. In these cases, special distillation techniques are used to increase the yield of aldol product. Predict the aldol addition product that is obtained, and propose a mechanism for its formation. For the mechanism, draw the curved arrows as needed. Include lone pairs and charges in your answer. Do not draw out any hydrogen explicitly in your products. Do...
which of the following molecules cannot undergo an
intramolecular aldol condensation when treated with NaOH
Which of the following molecules cannot undergo an intramolecular aldol condensation when treated with NaOH
4. In the following reaction the aldol product C is difficult to isolate, and even without heating the dehydration product D is formed instead. Explain. ОН н NaOH Н Н.о н С 5. Draw all possible aldol products from this mixed aldol reaction (not dehydrated). NaOH + Н.о H 6. Give the major organic product from each mixed aldol reaction. Then explain why the reaction conditions favor one product instead of generating a mixture of products. NaOH a. Но Н...
please answer all of the 4 questions
What cyclic product is formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? OT 11 0 0 IV What is the Aldol addition product formed from reaction of the following compound with itself? ++,C#o Cาถวาย 0 0 0 What is the cyclic product formed in the intramolecular Aldol condensation when the following compound is treated with aqueous NaOH? 08 pod od IV OT O II III O...
1. Predict the product(s) obtained when the following compounds is treated with HNO/H,50 2. Predict the products when each of the following compounds is treated with CH,Cl/AICI, assume conditions are controlled for mono-alkylation:
11.10_1 What is a major product of the following reaction? NaOH, HO 2 ~ CHO ? heat CHO CHO A) B) CHO D) CHO C) СА B oc 11.105 Which of the following is the best way to synthesize the compound in the box in high yield? A) Phyp NaOH B) mily Н,0 PPhg C) NaOH ox + D) H2O 11.10_4 In the presence of a base which of the following compounds WILL NOT undergo self- condensation to give an...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago